Upload 14 files
Browse files- 1_Pooling/config.json +10 -0
- README.md +590 -3
- config.json +53 -0
- config_chem_mrl.json +37 -0
- config_sentence_transformers.json +14 -0
- configuration_modchembert.py +90 -0
- model.safetensors +3 -0
- modeling_modchembert.py +780 -0
- modules.json +20 -0
- sentence_bert_config.json +4 -0
- similarity_evaluation_pubchem_10m_genmol_similarity_float32_results.csv +14 -0
- special_tokens_map.json +37 -0
- tokenizer.json +2554 -0
- tokenizer_config.json +57 -0
1_Pooling/config.json
ADDED
|
@@ -0,0 +1,10 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"word_embedding_dimension": 1024,
|
| 3 |
+
"pooling_mode_cls_token": false,
|
| 4 |
+
"pooling_mode_mean_tokens": true,
|
| 5 |
+
"pooling_mode_max_tokens": false,
|
| 6 |
+
"pooling_mode_mean_sqrt_len_tokens": false,
|
| 7 |
+
"pooling_mode_weightedmean_tokens": false,
|
| 8 |
+
"pooling_mode_lasttoken": false,
|
| 9 |
+
"include_prompt": true
|
| 10 |
+
}
|
README.md
CHANGED
|
@@ -1,3 +1,590 @@
|
|
| 1 |
-
---
|
| 2 |
-
license: apache-2.0
|
| 3 |
-
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
---
|
| 2 |
+
license: apache-2.0
|
| 3 |
+
tags:
|
| 4 |
+
- sentence-transformers
|
| 5 |
+
- modchembert
|
| 6 |
+
- cheminformatics
|
| 7 |
+
- smiles
|
| 8 |
+
- molecular-similarity
|
| 9 |
+
- feature-extraction
|
| 10 |
+
- dense
|
| 11 |
+
- generated_from_trainer
|
| 12 |
+
- dataset_size:19381001
|
| 13 |
+
- loss:Matryoshka2dLoss
|
| 14 |
+
- loss:MatryoshkaLoss
|
| 15 |
+
- loss:TanimotoSentLoss
|
| 16 |
+
base_model: Derify/ModChemBERT-IR-BASE
|
| 17 |
+
widget:
|
| 18 |
+
- source_sentence: COC(=O)c1sc(-c2ccc(C)cc2)c2c1NC(=O)C2(c1ccccc1)c1ccccc1
|
| 19 |
+
sentences:
|
| 20 |
+
- COC(=O)c1sc(Nc2ccc(Br)cn2)c2c1NC(=O)C2(c1ccccc1)c1ccccc1
|
| 21 |
+
- CC[NH+]1CCOC(C(NN)c2ccccc2Br)C1
|
| 22 |
+
- CC([NH2+]C(C)c1ccccc1)C(=O)P(C)C(C)(C)C
|
| 23 |
+
- source_sentence: O=C(C=Cc1ccccc1)CC(=O)c1ccccc1O
|
| 24 |
+
sentences:
|
| 25 |
+
- COCCN(NCc1c(C)n(C(C)=O)c2ccc(OC)cc12)c1nccs1
|
| 26 |
+
- CCN(CCC(N)=O)C(=O)c1ccc(=O)[nH]n1
|
| 27 |
+
- N=CCC(=Cc1ccccc1)C(=O)COc1ccccc1O
|
| 28 |
+
- source_sentence: COc1cccc(-c2sc3ccccc3c2C#N)c1
|
| 29 |
+
sentences:
|
| 30 |
+
- COCC(C)(C)c1cnnn1CCCI
|
| 31 |
+
- N#Cc1c(-c2cccc(CN)c2)sc2ccccc12
|
| 32 |
+
- COc1ccccc1NC(=O)c1cc(NCc2ccco2)cc[nH+]1
|
| 33 |
+
- source_sentence: Nc1nc(-c2ccccc2)c2nc(N)c(N)nc2n1
|
| 34 |
+
sentences:
|
| 35 |
+
- CC(C)CC1NC(=O)C(Cc2ccccc2)NC(=O)c2ccc(cc2)CN(C(=O)CC2CCOCC2)CCCCNC(=O)C(C)NC1=O
|
| 36 |
+
- O=Nc1cccc(OCCC(F)F)c1
|
| 37 |
+
- CCCCNCc1nc(N)nc2nc(N)c(N)nc12
|
| 38 |
+
- source_sentence: OCCCc1cc(F)cc(F)c1
|
| 39 |
+
sentences:
|
| 40 |
+
- CCC(C)C(=O)C1(C(NN)C(C)C)CCCC1
|
| 41 |
+
- Cc1[nH]c2c(C(N)=O)ccc(C(=O)N3CCCCC3)c2c1C
|
| 42 |
+
- Fc1cc(F)cc(-n2cc[o+]n2)c1
|
| 43 |
+
datasets:
|
| 44 |
+
- Derify/pubchem_10m_genmol_similarity
|
| 45 |
+
pipeline_tag: sentence-similarity
|
| 46 |
+
library_name: sentence-transformers
|
| 47 |
+
metrics:
|
| 48 |
+
- spearman
|
| 49 |
+
co2_eq_emissions:
|
| 50 |
+
emissions: 4039.5232961852894
|
| 51 |
+
energy_consumed: 19.679154905865374
|
| 52 |
+
source: codecarbon
|
| 53 |
+
training_type: fine-tuning
|
| 54 |
+
on_cloud: false
|
| 55 |
+
cpu_model: AMD Ryzen 7 3700X 8-Core Processor
|
| 56 |
+
ram_total_size: 62.69887161254883
|
| 57 |
+
hours_used: 74.966
|
| 58 |
+
hardware_used: 2 x NVIDIA GeForce RTX 3090
|
| 59 |
+
model-index:
|
| 60 |
+
- name: 'ChemMRL: SMILES Matryoshka Representation Learning Embedding Transformer'
|
| 61 |
+
results:
|
| 62 |
+
- task:
|
| 63 |
+
type: semantic-similarity
|
| 64 |
+
name: Semantic Similarity
|
| 65 |
+
dataset:
|
| 66 |
+
name: pubchem 10m genmol similarity (validation)
|
| 67 |
+
type: pubchem_10m_genmol_similarity_validation
|
| 68 |
+
metrics:
|
| 69 |
+
- type: spearman
|
| 70 |
+
value: 0.9881056976837288
|
| 71 |
+
name: Spearman
|
| 72 |
+
- task:
|
| 73 |
+
type: semantic-similarity
|
| 74 |
+
name: Semantic Similarity
|
| 75 |
+
dataset:
|
| 76 |
+
name: pubchem 10m genmol similarity (test)
|
| 77 |
+
type: pubchem_10m_genmol_similarity_test
|
| 78 |
+
metrics:
|
| 79 |
+
- type: spearman
|
| 80 |
+
value: 0.988127555600757
|
| 81 |
+
name: Spearman
|
| 82 |
+
new_version: Derify/ChemMRL
|
| 83 |
+
---
|
| 84 |
+
|
| 85 |
+
# ChemMRL: SMILES Matryoshka Representation Learning Embedding Transformer
|
| 86 |
+
|
| 87 |
+
This is a [Chem-MRL](https://github.com/emapco/chem-mrl) ([sentence-transformers](https://www.SBERT.net)) model finetuned from [Derify/ModChemBERT-IR-BASE](https://huggingface.co/Derify/ModChemBERT-IR-BASE) on the [pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity) dataset. It maps SMILES to a 1024-dimensional dense vector space and can be used for molecular similarity, semantic search, database indexing, molecular classification, clustering, and more.
|
| 88 |
+
|
| 89 |
+
## Model Details
|
| 90 |
+
|
| 91 |
+
### Model Description
|
| 92 |
+
- **Model Type:** ChemMRL (Sentence Transformer)
|
| 93 |
+
- **Base model:** [Derify/ModChemBERT-IR-BASE](https://huggingface.co/Derify/ModChemBERT-IR-BASE) <!-- at revision fde8c1ed2606783be3ff621be0a4fde825f12169 -->
|
| 94 |
+
- **Maximum Sequence Length:** 512 tokens
|
| 95 |
+
- **Output Dimensionality:** 1024 dimensions
|
| 96 |
+
- **Similarity Function:** Tanimoto
|
| 97 |
+
- **Training Dataset:**
|
| 98 |
+
- [pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity)
|
| 99 |
+
- **License:** apache-2.0
|
| 100 |
+
|
| 101 |
+
### Model Sources
|
| 102 |
+
|
| 103 |
+
- **Repository:** [Chem-MRL on GitHub](https://github.com/emapco/chem-mrl)
|
| 104 |
+
- **Demo App Repository:** [Chem-MRL-demo on GitHub](https://github.com/emapco/chem-mrl-demo)
|
| 105 |
+
|
| 106 |
+
### Full Model Architecture
|
| 107 |
+
|
| 108 |
+
```
|
| 109 |
+
SentenceTransformer(
|
| 110 |
+
(0): Transformer({'max_seq_length': 512, 'do_lower_case': False, 'architecture': 'ModChemBertModel'})
|
| 111 |
+
(1): Pooling({'word_embedding_dimension': 1024, 'pooling_mode_cls_token': False, 'pooling_mode_mean_tokens': True, 'pooling_mode_max_tokens': False, 'pooling_mode_mean_sqrt_len_tokens': False, 'pooling_mode_weightedmean_tokens': False, 'pooling_mode_lasttoken': False, 'include_prompt': True})
|
| 112 |
+
(2): Normalize()
|
| 113 |
+
)
|
| 114 |
+
```
|
| 115 |
+
|
| 116 |
+
## Usage
|
| 117 |
+
|
| 118 |
+
### Direct Usage (Chem-MRL)
|
| 119 |
+
|
| 120 |
+
First install the Chem-MRL library:
|
| 121 |
+
|
| 122 |
+
```bash
|
| 123 |
+
pip install -U chem-mrl>=0.7.3
|
| 124 |
+
```
|
| 125 |
+
|
| 126 |
+
Then you can load this model and run inference.
|
| 127 |
+
```python
|
| 128 |
+
from chem_mrl import ChemMRL
|
| 129 |
+
|
| 130 |
+
# Download from the 🤗 Hub
|
| 131 |
+
model = ChemMRL(
|
| 132 |
+
"Derify/ChemMRL",
|
| 133 |
+
trust_remote_code=True,
|
| 134 |
+
model_kwargs={"torch_dtype": "bfloat16"},
|
| 135 |
+
)
|
| 136 |
+
# Run inference
|
| 137 |
+
sentences = [
|
| 138 |
+
'OCCCc1cc(F)cc(F)c1',
|
| 139 |
+
'Fc1cc(F)cc(-n2cc[o+]n2)c1',
|
| 140 |
+
'CCC(C)C(=O)C1(C(NN)C(C)C)CCCC1',
|
| 141 |
+
]
|
| 142 |
+
embeddings = model.backbone.encode(sentences)
|
| 143 |
+
print(embeddings.shape)
|
| 144 |
+
# [3, 1024]
|
| 145 |
+
|
| 146 |
+
# Get the similarity scores for the embeddings
|
| 147 |
+
similarities = model.backbone.similarity(embeddings, embeddings)
|
| 148 |
+
print(similarities)
|
| 149 |
+
# tensor([[1.0000, 0.4184, 0.0166],
|
| 150 |
+
# [0.4158, 1.0000, 0.0136],
|
| 151 |
+
# [0.0167, 0.0137, 1.0000]])
|
| 152 |
+
```
|
| 153 |
+
|
| 154 |
+
### Direct Usage (Sentence Transformers)
|
| 155 |
+
|
| 156 |
+
<details><summary>Click to see the direct usage in Transformers</summary>
|
| 157 |
+
|
| 158 |
+
First install the Sentence Transformers library:
|
| 159 |
+
|
| 160 |
+
```bash
|
| 161 |
+
pip install -U sentence-transformers
|
| 162 |
+
```
|
| 163 |
+
|
| 164 |
+
Then you can load this model and run inference.
|
| 165 |
+
```python
|
| 166 |
+
from sentence_transformers import SentenceTransformer
|
| 167 |
+
|
| 168 |
+
# Download from the 🤗 Hub
|
| 169 |
+
model = SentenceTransformer(
|
| 170 |
+
"Derify/ChemMRL",
|
| 171 |
+
# SentenceTransformer doesn't support tanimoto similarity natively so we set a different similarity function here
|
| 172 |
+
similarity_fn_name="cosine",
|
| 173 |
+
trust_remote_code=True,
|
| 174 |
+
model_kwargs={"torch_dtype": "bfloat16"},
|
| 175 |
+
)
|
| 176 |
+
# Run inference
|
| 177 |
+
sentences = [
|
| 178 |
+
'OCCCc1cc(F)cc(F)c1',
|
| 179 |
+
'Fc1cc(F)cc(-n2cc[o+]n2)c1',
|
| 180 |
+
'CCC(C)C(=O)C1(C(NN)C(C)C)CCCC1',
|
| 181 |
+
]
|
| 182 |
+
embeddings = model.encode(sentences)
|
| 183 |
+
print(embeddings.shape)
|
| 184 |
+
# [3, 1024]
|
| 185 |
+
|
| 186 |
+
# Get the similarity scores for the embeddings
|
| 187 |
+
similarities = model.similarity(embeddings, embeddings)
|
| 188 |
+
print(similarities)
|
| 189 |
+
# tensor([[1.0000, 0.5887, 0.0327],
|
| 190 |
+
# [0.5887, 1.0000, 0.0269],
|
| 191 |
+
# [0.0327, 0.0269, 1.0000]])
|
| 192 |
+
```
|
| 193 |
+
|
| 194 |
+
</details>
|
| 195 |
+
|
| 196 |
+
## Evaluation
|
| 197 |
+
|
| 198 |
+
### Metrics
|
| 199 |
+
|
| 200 |
+
#### Semantic Similarity
|
| 201 |
+
|
| 202 |
+
* Dataset: `pubchem_10m_genmol_similarity`
|
| 203 |
+
* Evaluated with <code>chem_mrl.evaluation.EmbeddingSimilarityEvaluator.EmbeddingSimilarityEvaluator</code> with these parameters:
|
| 204 |
+
```json
|
| 205 |
+
{
|
| 206 |
+
"precision": "float32"
|
| 207 |
+
}
|
| 208 |
+
```
|
| 209 |
+
|
| 210 |
+
| Split | Metric | Value |
|
| 211 |
+
| :------------- | :----------- | :---------- |
|
| 212 |
+
| **validation** | **spearman** | **0.98811** |
|
| 213 |
+
| **test** | **spearman** | **0.98813** |
|
| 214 |
+
|
| 215 |
+
## Training Details
|
| 216 |
+
|
| 217 |
+
### Training Dataset
|
| 218 |
+
|
| 219 |
+
#### pubchem_10m_genmol_similarity
|
| 220 |
+
|
| 221 |
+
* Dataset: [pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity) at [9aec8fd](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity/tree/9aec8fd3ed70c21a0e39a3164830879a9929b052)
|
| 222 |
+
* Size: 19,381,001 training samples
|
| 223 |
+
* Columns: <code>smiles_a</code>, <code>smiles_b</code>, and <code>label</code>
|
| 224 |
+
* Approximate statistics based on the first 1000 samples:
|
| 225 |
+
| | smiles_a | smiles_b | label |
|
| 226 |
+
| :------ | :---------------------------------------------------------------------------------- | :---------------------------------------------------------------------------------- | :-------------------------------------------------------------- |
|
| 227 |
+
| type | string | string | float |
|
| 228 |
+
| details | <ul><li>min: 17 tokens</li><li>mean: 42.36 tokens</li><li>max: 122 tokens</li></ul> | <ul><li>min: 11 tokens</li><li>mean: 40.93 tokens</li><li>max: 122 tokens</li></ul> | <ul><li>min: 0.02</li><li>mean: 0.56</li><li>max: 1.0</li></ul> |
|
| 229 |
+
* Samples:
|
| 230 |
+
| smiles_a | smiles_b | label |
|
| 231 |
+
| :--------------------------------------------------------------------------------------------------- | :------------------------------------------------------------------------------------------------- | :------------------------------ |
|
| 232 |
+
| <code>COc1ccc(NC(=O)C2CC[NH+](C(C)C(=O)Nc3ccc(C(=O)Nc4ccc(F)c(F)c4)cc3C)CC2)cc1NC(=O)C1CCCCC1</code> | <code>Cc1cc(C(=O)Nc2ccc(F)c(F)c2)ccc1NC(=O)C(C)[NH+]1CCC(C(=O)Nc2cccc(NC(=O)C3CCCCC3)c2)CC1</code> | <code>0.8495575189590454</code> |
|
| 233 |
+
| <code>OCCN1CC[NH+](Cc2ccccc2OC2CC2)CC1</code> | <code>OCCN1CC[NH+](Cc2ccccc2On2cccn2)CC1</code> | <code>0.6615384817123413</code> |
|
| 234 |
+
| <code>CC1CN(C(=O)C2CC[NH+](Cc3cccc(C(N)=O)c3)CC2)CC(C)O1</code> | <code>CC1CN(C(=O)C2CC[NH+](Cc3ccccc3)CC2)CC(C)O1</code> | <code>0.7123287916183472</code> |
|
| 235 |
+
* Loss: [<code>Matryoshka2dLoss</code>](https://sbert.net/docs/package_reference/sentence_transformer/losses.html#matryoshka2dloss) with these parameters:
|
| 236 |
+
```json
|
| 237 |
+
{
|
| 238 |
+
"loss": "TanimotoSentLoss",
|
| 239 |
+
"n_layers_per_step": 11,
|
| 240 |
+
"last_layer_weight": 1.0,
|
| 241 |
+
"prior_layers_weight": 1.5,
|
| 242 |
+
"kl_div_weight": 0.5,
|
| 243 |
+
"kl_temperature": 0.3,
|
| 244 |
+
"matryoshka_dims": [
|
| 245 |
+
1024,
|
| 246 |
+
512,
|
| 247 |
+
256,
|
| 248 |
+
128,
|
| 249 |
+
64,
|
| 250 |
+
32,
|
| 251 |
+
16,
|
| 252 |
+
8
|
| 253 |
+
],
|
| 254 |
+
"matryoshka_weights": [
|
| 255 |
+
1,
|
| 256 |
+
1,
|
| 257 |
+
1,
|
| 258 |
+
1,
|
| 259 |
+
1,
|
| 260 |
+
1,
|
| 261 |
+
1,
|
| 262 |
+
1
|
| 263 |
+
],
|
| 264 |
+
"n_dims_per_step": 4
|
| 265 |
+
}
|
| 266 |
+
```
|
| 267 |
+
|
| 268 |
+
### Evaluation Dataset
|
| 269 |
+
|
| 270 |
+
#### pubchem_10m_genmol_similarity
|
| 271 |
+
|
| 272 |
+
* Dataset: [pubchem_10m_genmol_similarity](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity) at [9aec8fd](https://huggingface.co/datasets/Derify/pubchem_10m_genmol_similarity/tree/9aec8fd3ed70c21a0e39a3164830879a9929b052)
|
| 273 |
+
* Size: 1,080,394 evaluation samples
|
| 274 |
+
* Columns: <code>smiles_a</code>, <code>smiles_b</code>, and <code>label</code>
|
| 275 |
+
* Approximate statistics based on the first 1000 samples:
|
| 276 |
+
| | smiles_a | smiles_b | label |
|
| 277 |
+
| :------ | :---------------------------------------------------------------------------------- | :---------------------------------------------------------------------------------- | :------------------------------------------------------------- |
|
| 278 |
+
| type | string | string | float |
|
| 279 |
+
| details | <ul><li>min: 16 tokens</li><li>mean: 42.05 tokens</li><li>max: 101 tokens</li></ul> | <ul><li>min: 11 tokens</li><li>mean: 40.23 tokens</li><li>max: 104 tokens</li></ul> | <ul><li>min: 0.0</li><li>mean: 0.57</li><li>max: 1.0</li></ul> |
|
| 280 |
+
* Samples:
|
| 281 |
+
| smiles_a | smiles_b | label |
|
| 282 |
+
| :------------------------------------- | :---------------------------------------- | :------------------------------ |
|
| 283 |
+
| <code>N#CCCN(Cc1cnc(N)cn1)C1CC1</code> | <code>N#CCCN(Cc1cnc(N)cn1)C1CCCC1</code> | <code>0.8600000143051147</code> |
|
| 284 |
+
| <code>N#CCCN(Cc1cnc(N)cn1)C1CC1</code> | <code>N#CCCN(Cc1cnc(N)cn1)C1CCOCC1</code> | <code>0.7962962985038757</code> |
|
| 285 |
+
| <code>N#CCCN(Cc1cnc(N)cn1)C1CC1</code> | <code>N#CCCN(Cc1cnc(N)cn1)CC(F)F</code> | <code>0.5517241358757019</code> |
|
| 286 |
+
* Loss: [<code>Matryoshka2dLoss</code>](https://sbert.net/docs/package_reference/sentence_transformer/losses.html#matryoshka2dloss) with these parameters:
|
| 287 |
+
```json
|
| 288 |
+
{
|
| 289 |
+
"loss": "TanimotoSentLoss",
|
| 290 |
+
"n_layers_per_step": 11,
|
| 291 |
+
"last_layer_weight": 1.0,
|
| 292 |
+
"prior_layers_weight": 1.5,
|
| 293 |
+
"kl_div_weight": 0.5,
|
| 294 |
+
"kl_temperature": 0.3,
|
| 295 |
+
"matryoshka_dims": [
|
| 296 |
+
1024,
|
| 297 |
+
512,
|
| 298 |
+
256,
|
| 299 |
+
128,
|
| 300 |
+
64,
|
| 301 |
+
32,
|
| 302 |
+
16,
|
| 303 |
+
8
|
| 304 |
+
],
|
| 305 |
+
"matryoshka_weights": [
|
| 306 |
+
1,
|
| 307 |
+
1,
|
| 308 |
+
1,
|
| 309 |
+
1,
|
| 310 |
+
1,
|
| 311 |
+
1,
|
| 312 |
+
1,
|
| 313 |
+
1
|
| 314 |
+
],
|
| 315 |
+
"n_dims_per_step": 4
|
| 316 |
+
}
|
| 317 |
+
```
|
| 318 |
+
|
| 319 |
+
### Training Hyperparameters
|
| 320 |
+
#### Non-Default Hyperparameters
|
| 321 |
+
|
| 322 |
+
- `eval_strategy`: steps
|
| 323 |
+
- `per_device_train_batch_size`: 192
|
| 324 |
+
- `per_device_eval_batch_size`: 512
|
| 325 |
+
- `learning_rate`: 8e-06
|
| 326 |
+
- `weight_decay`: 1e-05
|
| 327 |
+
- `max_grad_norm`: None
|
| 328 |
+
- `lr_scheduler_type`: warmup_stable_decay
|
| 329 |
+
- `lr_scheduler_kwargs`: {'num_decay_steps': 100943, 'warmup_type': 'linear', 'decay_type': '1-sqrt'}
|
| 330 |
+
- `warmup_steps`: 100943
|
| 331 |
+
- `data_seed`: 42
|
| 332 |
+
- `bf16`: True
|
| 333 |
+
- `bf16_full_eval`: True
|
| 334 |
+
- `tf32`: True
|
| 335 |
+
- `optim`: stable_adamw
|
| 336 |
+
- `optim_args`: decouple_lr=True,max_lr=8.0e-6
|
| 337 |
+
- `dataloader_pin_memory`: False
|
| 338 |
+
- `eval_on_start`: True
|
| 339 |
+
|
| 340 |
+
#### All Hyperparameters
|
| 341 |
+
<details><summary>Click to expand</summary>
|
| 342 |
+
|
| 343 |
+
- `overwrite_output_dir`: False
|
| 344 |
+
- `do_predict`: False
|
| 345 |
+
- `eval_strategy`: steps
|
| 346 |
+
- `prediction_loss_only`: True
|
| 347 |
+
- `per_device_train_batch_size`: 192
|
| 348 |
+
- `per_device_eval_batch_size`: 512
|
| 349 |
+
- `per_gpu_train_batch_size`: None
|
| 350 |
+
- `per_gpu_eval_batch_size`: None
|
| 351 |
+
- `gradient_accumulation_steps`: 1
|
| 352 |
+
- `eval_accumulation_steps`: None
|
| 353 |
+
- `torch_empty_cache_steps`: None
|
| 354 |
+
- `learning_rate`: 8e-06
|
| 355 |
+
- `weight_decay`: 1e-05
|
| 356 |
+
- `adam_beta1`: 0.9
|
| 357 |
+
- `adam_beta2`: 0.999
|
| 358 |
+
- `adam_epsilon`: 1e-08
|
| 359 |
+
- `max_grad_norm`: None
|
| 360 |
+
- `num_train_epochs`: 3
|
| 361 |
+
- `max_steps`: -1
|
| 362 |
+
- `lr_scheduler_type`: warmup_stable_decay
|
| 363 |
+
- `lr_scheduler_kwargs`: {'num_decay_steps': 100943, 'warmup_type': 'linear', 'decay_type': '1-sqrt'}
|
| 364 |
+
- `warmup_ratio`: 0.0
|
| 365 |
+
- `warmup_steps`: 100943
|
| 366 |
+
- `log_level`: passive
|
| 367 |
+
- `log_level_replica`: warning
|
| 368 |
+
- `log_on_each_node`: True
|
| 369 |
+
- `logging_nan_inf_filter`: True
|
| 370 |
+
- `save_safetensors`: True
|
| 371 |
+
- `save_on_each_node`: False
|
| 372 |
+
- `save_only_model`: False
|
| 373 |
+
- `restore_callback_states_from_checkpoint`: False
|
| 374 |
+
- `no_cuda`: False
|
| 375 |
+
- `use_cpu`: False
|
| 376 |
+
- `use_mps_device`: False
|
| 377 |
+
- `seed`: 42
|
| 378 |
+
- `data_seed`: 42
|
| 379 |
+
- `jit_mode_eval`: False
|
| 380 |
+
- `bf16`: True
|
| 381 |
+
- `fp16`: False
|
| 382 |
+
- `fp16_opt_level`: O1
|
| 383 |
+
- `half_precision_backend`: auto
|
| 384 |
+
- `bf16_full_eval`: True
|
| 385 |
+
- `fp16_full_eval`: False
|
| 386 |
+
- `tf32`: True
|
| 387 |
+
- `local_rank`: 0
|
| 388 |
+
- `ddp_backend`: None
|
| 389 |
+
- `tpu_num_cores`: None
|
| 390 |
+
- `tpu_metrics_debug`: False
|
| 391 |
+
- `debug`: []
|
| 392 |
+
- `dataloader_drop_last`: False
|
| 393 |
+
- `dataloader_num_workers`: 0
|
| 394 |
+
- `dataloader_prefetch_factor`: None
|
| 395 |
+
- `past_index`: -1
|
| 396 |
+
- `disable_tqdm`: False
|
| 397 |
+
- `remove_unused_columns`: True
|
| 398 |
+
- `label_names`: None
|
| 399 |
+
- `load_best_model_at_end`: False
|
| 400 |
+
- `ignore_data_skip`: False
|
| 401 |
+
- `fsdp`: []
|
| 402 |
+
- `fsdp_min_num_params`: 0
|
| 403 |
+
- `fsdp_config`: {'min_num_params': 0, 'xla': False, 'xla_fsdp_v2': False, 'xla_fsdp_grad_ckpt': False}
|
| 404 |
+
- `fsdp_transformer_layer_cls_to_wrap`: None
|
| 405 |
+
- `accelerator_config`: {'split_batches': False, 'dispatch_batches': None, 'even_batches': True, 'use_seedable_sampler': True, 'non_blocking': False, 'gradient_accumulation_kwargs': None}
|
| 406 |
+
- `parallelism_config`: None
|
| 407 |
+
- `deepspeed`: None
|
| 408 |
+
- `label_smoothing_factor`: 0.0
|
| 409 |
+
- `optim`: stable_adamw
|
| 410 |
+
- `optim_args`: decouple_lr=True,max_lr=8.0e-6
|
| 411 |
+
- `adafactor`: False
|
| 412 |
+
- `group_by_length`: False
|
| 413 |
+
- `length_column_name`: length
|
| 414 |
+
- `project`: huggingface
|
| 415 |
+
- `trackio_space_id`: trackio
|
| 416 |
+
- `ddp_find_unused_parameters`: None
|
| 417 |
+
- `ddp_bucket_cap_mb`: None
|
| 418 |
+
- `ddp_broadcast_buffers`: False
|
| 419 |
+
- `dataloader_pin_memory`: False
|
| 420 |
+
- `dataloader_persistent_workers`: False
|
| 421 |
+
- `skip_memory_metrics`: True
|
| 422 |
+
- `use_legacy_prediction_loop`: False
|
| 423 |
+
- `push_to_hub`: False
|
| 424 |
+
- `resume_from_checkpoint`: None
|
| 425 |
+
- `hub_model_id`: None
|
| 426 |
+
- `hub_strategy`: every_save
|
| 427 |
+
- `hub_private_repo`: None
|
| 428 |
+
- `hub_always_push`: False
|
| 429 |
+
- `hub_revision`: None
|
| 430 |
+
- `gradient_checkpointing`: False
|
| 431 |
+
- `gradient_checkpointing_kwargs`: None
|
| 432 |
+
- `include_inputs_for_metrics`: False
|
| 433 |
+
- `include_for_metrics`: []
|
| 434 |
+
- `eval_do_concat_batches`: True
|
| 435 |
+
- `fp16_backend`: auto
|
| 436 |
+
- `push_to_hub_model_id`: None
|
| 437 |
+
- `push_to_hub_organization`: None
|
| 438 |
+
- `mp_parameters`:
|
| 439 |
+
- `auto_find_batch_size`: False
|
| 440 |
+
- `full_determinism`: False
|
| 441 |
+
- `torchdynamo`: None
|
| 442 |
+
- `ray_scope`: last
|
| 443 |
+
- `ddp_timeout`: 1800
|
| 444 |
+
- `torch_compile`: False
|
| 445 |
+
- `torch_compile_backend`: None
|
| 446 |
+
- `torch_compile_mode`: None
|
| 447 |
+
- `include_tokens_per_second`: False
|
| 448 |
+
- `include_num_input_tokens_seen`: no
|
| 449 |
+
- `neftune_noise_alpha`: None
|
| 450 |
+
- `optim_target_modules`: None
|
| 451 |
+
- `batch_eval_metrics`: False
|
| 452 |
+
- `eval_on_start`: True
|
| 453 |
+
- `use_liger_kernel`: False
|
| 454 |
+
- `liger_kernel_config`: None
|
| 455 |
+
- `eval_use_gather_object`: False
|
| 456 |
+
- `average_tokens_across_devices`: True
|
| 457 |
+
- `prompts`: None
|
| 458 |
+
- `batch_sampler`: batch_sampler
|
| 459 |
+
- `multi_dataset_batch_sampler`: proportional
|
| 460 |
+
- `router_mapping`: {}
|
| 461 |
+
- `learning_rate_mapping`: {}
|
| 462 |
+
|
| 463 |
+
</details>
|
| 464 |
+
|
| 465 |
+
### Training Logs
|
| 466 |
+
<details><summary>Click to expand</summary>
|
| 467 |
+
|
| 468 |
+
| Epoch | Step | Training Loss | pubchem 10m genmol similarity loss | pubchem_10m_genmol_similarity_spearman |
|
| 469 |
+
| :----: | :----: | :-----------: | :--------------------------------: | :------------------------------------: |
|
| 470 |
+
| 0 | 0 | - | 85.7997 | 0.7261 |
|
| 471 |
+
| 0.0000 | 1 | 69.0605 | - | - |
|
| 472 |
+
| 0.2477 | 25000 | 47.1696 | - | - |
|
| 473 |
+
| 0.2500 | 25235 | - | 56.9634 | 0.8997 |
|
| 474 |
+
| 0.4978 | 50250 | 45.6212 | - | - |
|
| 475 |
+
| 0.5000 | 50470 | - | 55.4366 | 0.9599 |
|
| 476 |
+
| 0.7479 | 75500 | 45.1404 | - | - |
|
| 477 |
+
| 0.7500 | 75705 | - | 54.5667 | 0.9755 |
|
| 478 |
+
| 0.9981 | 100750 | 44.5023 | - | - |
|
| 479 |
+
| 1.0000 | 100940 | - | 54.1244 | 0.9810 |
|
| 480 |
+
| 1.2482 | 126000 | 43.7545 | - | - |
|
| 481 |
+
| 1.2500 | 126175 | - | 53.6974 | 0.9838 |
|
| 482 |
+
| 1.4984 | 151250 | 43.7865 | - | - |
|
| 483 |
+
| 1.5000 | 151410 | - | 53.4775 | 0.9855 |
|
| 484 |
+
| 1.7485 | 176500 | 43.3512 | - | - |
|
| 485 |
+
| 1.7499 | 176645 | - | 53.3775 | 0.9866 |
|
| 486 |
+
| 1.9987 | 201750 | 43.5808 | - | - |
|
| 487 |
+
| 1.9999 | 201880 | - | 53.3119 | 0.9874 |
|
| 488 |
+
| 2.2488 | 227000 | 43.281 | - | - |
|
| 489 |
+
| 2.2499 | 227115 | - | 53.1854 | 0.9879 |
|
| 490 |
+
| 2.4989 | 252250 | 43.3097 | - | - |
|
| 491 |
+
| 2.4999 | 252350 | - | 53.1972 | 0.9880 |
|
| 492 |
+
| 2.7491 | 277500 | 43.2376 | - | - |
|
| 493 |
+
| 2.7499 | 277585 | - | 53.1833 | 0.9881 |
|
| 494 |
+
| 2.9992 | 302750 | 43.2006 | - | - |
|
| 495 |
+
| 2.9999 | 302820 | - | 53.1241 | 0.9881 |
|
| 496 |
+
| 3.0000 | 302829 | - | - | 0.98811 |
|
| 497 |
+
|
| 498 |
+
</details>
|
| 499 |
+
|
| 500 |
+
### Environmental Impact
|
| 501 |
+
Carbon emissions were measured using [CodeCarbon](https://github.com/mlco2/codecarbon).
|
| 502 |
+
- **Energy Consumed**: 19.679 kWh
|
| 503 |
+
- **Carbon Emitted**: 4.040 kg of CO2
|
| 504 |
+
- **Hours Used**: 74.966 hours
|
| 505 |
+
|
| 506 |
+
### Training Hardware
|
| 507 |
+
- **On Cloud**: No
|
| 508 |
+
- **GPU Model**: 1 x NVIDIA GeForce RTX 3090
|
| 509 |
+
- **CPU Model**: AMD Ryzen 7 3700X 8-Core Processor
|
| 510 |
+
- **RAM Size**: 62.70 GB
|
| 511 |
+
|
| 512 |
+
### Framework Versions
|
| 513 |
+
- Python: 3.13.7
|
| 514 |
+
- Sentence Transformers: 5.1.1
|
| 515 |
+
- Transformers: 4.57.1
|
| 516 |
+
- PyTorch: 2.8.0+cu128
|
| 517 |
+
- Accelerate: 1.10.1
|
| 518 |
+
- Datasets: 3.6.0
|
| 519 |
+
- Tokenizers: 0.22.1
|
| 520 |
+
|
| 521 |
+
## Citation
|
| 522 |
+
|
| 523 |
+
### BibTeX
|
| 524 |
+
|
| 525 |
+
#### Sentence Transformers
|
| 526 |
+
```bibtex
|
| 527 |
+
@inproceedings{reimers-2019-sentence-bert,
|
| 528 |
+
title = "Sentence-BERT: Sentence Embeddings using Siamese BERT-Networks",
|
| 529 |
+
author = "Reimers, Nils and Gurevych, Iryna",
|
| 530 |
+
booktitle = "Proceedings of the 2019 Conference on Empirical Methods in Natural Language Processing",
|
| 531 |
+
month = "11",
|
| 532 |
+
year = "2019",
|
| 533 |
+
publisher = "Association for Computational Linguistics",
|
| 534 |
+
url = "https://arxiv.org/abs/1908.10084",
|
| 535 |
+
}
|
| 536 |
+
```
|
| 537 |
+
|
| 538 |
+
#### Matryoshka2dLoss
|
| 539 |
+
```bibtex
|
| 540 |
+
@misc{li20242d,
|
| 541 |
+
title={2D Matryoshka Sentence Embeddings},
|
| 542 |
+
author={Xianming Li and Zongxi Li and Jing Li and Haoran Xie and Qing Li},
|
| 543 |
+
year={2024},
|
| 544 |
+
eprint={2402.14776},
|
| 545 |
+
archivePrefix={arXiv},
|
| 546 |
+
primaryClass={cs.CL}
|
| 547 |
+
}
|
| 548 |
+
```
|
| 549 |
+
|
| 550 |
+
#### MatryoshkaLoss
|
| 551 |
+
```bibtex
|
| 552 |
+
@misc{kusupati2024matryoshka,
|
| 553 |
+
title={Matryoshka Representation Learning},
|
| 554 |
+
author={Aditya Kusupati and Gantavya Bhatt and Aniket Rege and Matthew Wallingford and Aditya Sinha and Vivek Ramanujan and William Howard-Snyder and Kaifeng Chen and Sham Kakade and Prateek Jain and Ali Farhadi},
|
| 555 |
+
year={2024},
|
| 556 |
+
eprint={2205.13147},
|
| 557 |
+
archivePrefix={arXiv},
|
| 558 |
+
primaryClass={cs.LG}
|
| 559 |
+
}
|
| 560 |
+
```
|
| 561 |
+
|
| 562 |
+
#### CoSENTLoss
|
| 563 |
+
```bibtex
|
| 564 |
+
@online{kexuefm-8847,
|
| 565 |
+
title={CoSENT: A more efficient sentence vector scheme than Sentence-BERT},
|
| 566 |
+
author={Su Jianlin},
|
| 567 |
+
year={2022},
|
| 568 |
+
month={Jan},
|
| 569 |
+
url={https://kexue.fm/archives/8847},
|
| 570 |
+
}
|
| 571 |
+
```
|
| 572 |
+
|
| 573 |
+
#### TanimotoSentLoss
|
| 574 |
+
```bibtex
|
| 575 |
+
@online{cortes-2025-tanimotosentloss,
|
| 576 |
+
title={TanimotoSentLoss: Tanimoto Loss for SMILES Embeddings},
|
| 577 |
+
author={Emmanuel Cortes},
|
| 578 |
+
year={2025},
|
| 579 |
+
month={Jan},
|
| 580 |
+
url={https://github.com/emapco/chem-mrl},
|
| 581 |
+
}
|
| 582 |
+
```
|
| 583 |
+
|
| 584 |
+
## Model Card Authors
|
| 585 |
+
|
| 586 |
+
[@eacortes](https://huggingface.co/eacortes)
|
| 587 |
+
|
| 588 |
+
## Model Card Contact
|
| 589 |
+
|
| 590 |
+
Manny Cortes ([email protected])
|
config.json
ADDED
|
@@ -0,0 +1,53 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"architectures": [
|
| 3 |
+
"ModChemBertModel"
|
| 4 |
+
],
|
| 5 |
+
"attention_bias": false,
|
| 6 |
+
"attention_dropout": 0.1,
|
| 7 |
+
"auto_map": {
|
| 8 |
+
"AutoConfig": "configuration_modchembert.ModChemBertConfig",
|
| 9 |
+
"AutoModel": "modeling_modchembert.ModChemBertModel",
|
| 10 |
+
"AutoModelForMaskedLM": "modeling_modchembert.ModChemBertForMaskedLM",
|
| 11 |
+
"AutoModelForSequenceClassification": "modeling_modchembert.ModChemBertForSequenceClassification"
|
| 12 |
+
},
|
| 13 |
+
"bos_token_id": 0,
|
| 14 |
+
"classifier_activation": "gelu",
|
| 15 |
+
"classifier_bias": false,
|
| 16 |
+
"classifier_dropout": 0.0,
|
| 17 |
+
"classifier_pooling": "max_seq_mha",
|
| 18 |
+
"classifier_pooling_attention_dropout": 0.1,
|
| 19 |
+
"classifier_pooling_last_k": 5,
|
| 20 |
+
"classifier_pooling_num_attention_heads": 4,
|
| 21 |
+
"cls_token_id": 0,
|
| 22 |
+
"decoder_bias": true,
|
| 23 |
+
"deterministic_flash_attn": false,
|
| 24 |
+
"dtype": "bfloat16",
|
| 25 |
+
"embedding_dropout": 0.1,
|
| 26 |
+
"eos_token_id": 1,
|
| 27 |
+
"global_attn_every_n_layers": 3,
|
| 28 |
+
"global_rope_theta": 160000.0,
|
| 29 |
+
"hidden_activation": "gelu",
|
| 30 |
+
"hidden_size": 1024,
|
| 31 |
+
"initializer_cutoff_factor": 2.0,
|
| 32 |
+
"initializer_range": 0.02,
|
| 33 |
+
"intermediate_size": 1536,
|
| 34 |
+
"layer_norm_eps": 1e-05,
|
| 35 |
+
"local_attention": 8,
|
| 36 |
+
"local_rope_theta": 10000.0,
|
| 37 |
+
"max_position_embeddings": 512,
|
| 38 |
+
"mlp_bias": false,
|
| 39 |
+
"mlp_dropout": 0.1,
|
| 40 |
+
"model_type": "modchembert",
|
| 41 |
+
"norm_bias": false,
|
| 42 |
+
"norm_eps": 1e-05,
|
| 43 |
+
"num_attention_heads": 16,
|
| 44 |
+
"num_hidden_layers": 22,
|
| 45 |
+
"pad_token_id": 2,
|
| 46 |
+
"position_embedding_type": "absolute",
|
| 47 |
+
"repad_logits_with_grad": false,
|
| 48 |
+
"sep_token_id": 1,
|
| 49 |
+
"sparse_pred_ignore_index": -100,
|
| 50 |
+
"sparse_prediction": false,
|
| 51 |
+
"transformers_version": "4.57.1",
|
| 52 |
+
"vocab_size": 2362
|
| 53 |
+
}
|
config_chem_mrl.json
ADDED
|
@@ -0,0 +1,37 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"__version__": "0.7.4",
|
| 3 |
+
"embedding_pooling": "mean",
|
| 4 |
+
"eval_metric": "spearman",
|
| 5 |
+
"eval_similarity_fct": "tanimoto",
|
| 6 |
+
"kl_div_weight": 0.5,
|
| 7 |
+
"kl_temperature": 0.3,
|
| 8 |
+
"last_layer_weight": 1.0,
|
| 9 |
+
"loss_func": "tanimotosentloss",
|
| 10 |
+
"model_name": "Derify/ModChemBERT-IR-BASE",
|
| 11 |
+
"mrl_dimension_weights": [
|
| 12 |
+
1,
|
| 13 |
+
1,
|
| 14 |
+
1,
|
| 15 |
+
1,
|
| 16 |
+
1,
|
| 17 |
+
1,
|
| 18 |
+
1,
|
| 19 |
+
1
|
| 20 |
+
],
|
| 21 |
+
"mrl_dimensions": [
|
| 22 |
+
1024,
|
| 23 |
+
512,
|
| 24 |
+
256,
|
| 25 |
+
128,
|
| 26 |
+
64,
|
| 27 |
+
32,
|
| 28 |
+
16,
|
| 29 |
+
8
|
| 30 |
+
],
|
| 31 |
+
"n_dims_per_step": 4,
|
| 32 |
+
"n_layers_per_step": 11,
|
| 33 |
+
"prior_layers_weight": 1.5,
|
| 34 |
+
"tanimoto_similarity_loss_func": null,
|
| 35 |
+
"use_2d_matryoshka": true,
|
| 36 |
+
"use_query_tokenizer": false
|
| 37 |
+
}
|
config_sentence_transformers.json
ADDED
|
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"model_type": "SentenceTransformer",
|
| 3 |
+
"__version__": {
|
| 4 |
+
"sentence_transformers": "5.1.1",
|
| 5 |
+
"transformers": "4.57.1",
|
| 6 |
+
"pytorch": "2.8.0+cu128"
|
| 7 |
+
},
|
| 8 |
+
"prompts": {
|
| 9 |
+
"query": "",
|
| 10 |
+
"document": ""
|
| 11 |
+
},
|
| 12 |
+
"default_prompt_name": null,
|
| 13 |
+
"similarity_fn_name": "tanimoto"
|
| 14 |
+
}
|
configuration_modchembert.py
ADDED
|
@@ -0,0 +1,90 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Copyright 2025 Emmanuel Cortes, All Rights Reserved.
|
| 2 |
+
#
|
| 3 |
+
# Licensed under the Apache License, Version 2.0 (the "License");
|
| 4 |
+
# you may not use this file except in compliance with the License.
|
| 5 |
+
# You may obtain a copy of the License at
|
| 6 |
+
#
|
| 7 |
+
# http://www.apache.org/licenses/LICENSE-2.0
|
| 8 |
+
#
|
| 9 |
+
# Unless required by applicable law or agreed to in writing, software
|
| 10 |
+
# distributed under the License is distributed on an "AS IS" BASIS,
|
| 11 |
+
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 12 |
+
# See the License for the specific language governing permissions and
|
| 13 |
+
# limitations under the License.
|
| 14 |
+
|
| 15 |
+
from typing import Literal
|
| 16 |
+
|
| 17 |
+
from transformers.models.modernbert.configuration_modernbert import ModernBertConfig
|
| 18 |
+
|
| 19 |
+
|
| 20 |
+
class ModChemBertConfig(ModernBertConfig):
|
| 21 |
+
"""
|
| 22 |
+
Configuration class for ModChemBert models.
|
| 23 |
+
|
| 24 |
+
This configuration class extends ModernBertConfig with additional parameters specific to
|
| 25 |
+
chemical molecule modeling and custom pooling strategies for classification/regression tasks.
|
| 26 |
+
It accepts all arguments and keyword arguments from ModernBertConfig.
|
| 27 |
+
|
| 28 |
+
Args:
|
| 29 |
+
classifier_pooling (str, optional): Pooling strategy for sequence classification.
|
| 30 |
+
Available options:
|
| 31 |
+
- "cls": Use CLS token representation
|
| 32 |
+
- "mean": Attention-weighted average pooling
|
| 33 |
+
- "sum_mean": Sum all hidden states across layers, then mean pool over sequence (ChemLM approach)
|
| 34 |
+
- "sum_sum": Sum all hidden states across layers, then sum pool over sequence
|
| 35 |
+
- "mean_mean": Mean all hidden states across layers, then mean pool over sequence
|
| 36 |
+
- "mean_sum": Mean all hidden states across layers, then sum pool over sequence
|
| 37 |
+
- "max_cls": Element-wise max pooling over last k hidden states, then take CLS token
|
| 38 |
+
- "cls_mha": Multi-head attention with CLS token as query and full sequence as keys/values
|
| 39 |
+
- "max_seq_mha": Max pooling over last k states + multi-head attention with CLS as query
|
| 40 |
+
- "max_seq_mean": Max pooling over last k hidden states, then mean pooling over sequence
|
| 41 |
+
Defaults to "sum_mean".
|
| 42 |
+
classifier_pooling_num_attention_heads (int, optional): Number of attention heads for multi-head attention
|
| 43 |
+
pooling strategies (cls_mha, max_seq_mha). Defaults to 4.
|
| 44 |
+
classifier_pooling_attention_dropout (float, optional): Dropout probability for multi-head attention
|
| 45 |
+
pooling strategies (cls_mha, max_seq_mha). Defaults to 0.0.
|
| 46 |
+
classifier_pooling_last_k (int, optional): Number of last hidden layers to use for max pooling
|
| 47 |
+
strategies (max_cls, max_seq_mha, max_seq_mean). Defaults to 8.
|
| 48 |
+
*args: Variable length argument list passed to ModernBertConfig.
|
| 49 |
+
**kwargs: Arbitrary keyword arguments passed to ModernBertConfig.
|
| 50 |
+
|
| 51 |
+
Note:
|
| 52 |
+
This class inherits all configuration parameters from ModernBertConfig including
|
| 53 |
+
hidden_size, num_hidden_layers, num_attention_heads, intermediate_size, etc.
|
| 54 |
+
"""
|
| 55 |
+
|
| 56 |
+
model_type = "modchembert"
|
| 57 |
+
|
| 58 |
+
def __init__(
|
| 59 |
+
self,
|
| 60 |
+
*args,
|
| 61 |
+
classifier_pooling: Literal[
|
| 62 |
+
"cls",
|
| 63 |
+
"mean",
|
| 64 |
+
"sum_mean",
|
| 65 |
+
"sum_sum",
|
| 66 |
+
"mean_mean",
|
| 67 |
+
"mean_sum",
|
| 68 |
+
"max_cls",
|
| 69 |
+
"cls_mha",
|
| 70 |
+
"max_seq_mha",
|
| 71 |
+
"max_seq_mean",
|
| 72 |
+
] = "max_seq_mha",
|
| 73 |
+
classifier_pooling_num_attention_heads: int = 4,
|
| 74 |
+
classifier_pooling_attention_dropout: float = 0.0,
|
| 75 |
+
classifier_pooling_last_k: int = 8,
|
| 76 |
+
**kwargs,
|
| 77 |
+
):
|
| 78 |
+
# Pass classifier_pooling="cls" to circumvent ValueError in ModernBertConfig init
|
| 79 |
+
super().__init__(*args, classifier_pooling="cls", **kwargs)
|
| 80 |
+
# Override with custom value
|
| 81 |
+
self.classifier_pooling = classifier_pooling
|
| 82 |
+
self.classifier_pooling_num_attention_heads = classifier_pooling_num_attention_heads
|
| 83 |
+
self.classifier_pooling_attention_dropout = classifier_pooling_attention_dropout
|
| 84 |
+
self.classifier_pooling_last_k = classifier_pooling_last_k
|
| 85 |
+
self.auto_map = {
|
| 86 |
+
"AutoConfig": "configuration_modchembert.ModChemBertConfig",
|
| 87 |
+
"AutoModel": "modeling_modchembert.ModChemBertModel",
|
| 88 |
+
"AutoModelForMaskedLM": "modeling_modchembert.ModChemBertForMaskedLM",
|
| 89 |
+
"AutoModelForSequenceClassification": "modeling_modchembert.ModChemBertForSequenceClassification",
|
| 90 |
+
}
|
model.safetensors
ADDED
|
@@ -0,0 +1,3 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
version https://git-lfs.github.com/spec/v1
|
| 2 |
+
oid sha256:4bdfc920fcc3c65314ef0cf0f5129884443d23748f09e23467015d54d5338ce4
|
| 3 |
+
size 397110232
|
modeling_modchembert.py
ADDED
|
@@ -0,0 +1,780 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
# Copyright 2025 Emmanuel Cortes, All Rights Reserved.
|
| 2 |
+
#
|
| 3 |
+
# Copyright 2024 Answer.AI, LightOn, and contributors, and the HuggingFace Inc. team. All rights reserved.
|
| 4 |
+
#
|
| 5 |
+
#
|
| 6 |
+
# Licensed under the Apache License, Version 2.0 (the "License");
|
| 7 |
+
# you may not use this file except in compliance with the License.
|
| 8 |
+
# You may obtain a copy of the License at
|
| 9 |
+
#
|
| 10 |
+
# http://www.apache.org/licenses/LICENSE-2.0
|
| 11 |
+
#
|
| 12 |
+
# Unless required by applicable law or agreed to in writing, software
|
| 13 |
+
# distributed under the License is distributed on an "AS IS" BASIS,
|
| 14 |
+
# WITHOUT WARRANTIES OR CONDITIONS OF ANY KIND, either express or implied.
|
| 15 |
+
# See the License for the specific language governing permissions and
|
| 16 |
+
# limitations under the License.
|
| 17 |
+
|
| 18 |
+
# This file is adapted from the transformers library.
|
| 19 |
+
# Modifications include:
|
| 20 |
+
# - Additional classifier_pooling options for ModChemBertForSequenceClassification
|
| 21 |
+
# - sum_mean, sum_sum, mean_sum, mean_mean: from ChemLM (utilizes all hidden states)
|
| 22 |
+
# - max_cls, cls_mha, max_seq_mha: from MaxPoolBERT (utilizes last k hidden states)
|
| 23 |
+
# - max_seq_mean: a merge between sum_mean and max_cls (utilizes last k hidden states)
|
| 24 |
+
# - Addition of ModChemBertPoolingAttention for cls_mha and max_seq_mha pooling options
|
| 25 |
+
|
| 26 |
+
import copy
|
| 27 |
+
import math
|
| 28 |
+
import typing
|
| 29 |
+
from contextlib import nullcontext
|
| 30 |
+
|
| 31 |
+
import torch
|
| 32 |
+
import torch.nn as nn
|
| 33 |
+
from torch.nn import BCEWithLogitsLoss, CrossEntropyLoss, MSELoss
|
| 34 |
+
from transformers.modeling_attn_mask_utils import _prepare_4d_attention_mask
|
| 35 |
+
from transformers.modeling_outputs import BaseModelOutput, MaskedLMOutput, SequenceClassifierOutput
|
| 36 |
+
from transformers.models.modernbert.modeling_modernbert import (
|
| 37 |
+
MODERNBERT_ATTENTION_FUNCTION,
|
| 38 |
+
ModernBertEmbeddings,
|
| 39 |
+
ModernBertEncoderLayer,
|
| 40 |
+
ModernBertModel,
|
| 41 |
+
ModernBertPredictionHead,
|
| 42 |
+
ModernBertPreTrainedModel,
|
| 43 |
+
ModernBertRotaryEmbedding,
|
| 44 |
+
_pad_modernbert_output,
|
| 45 |
+
_unpad_modernbert_input,
|
| 46 |
+
)
|
| 47 |
+
from transformers.utils import logging
|
| 48 |
+
|
| 49 |
+
from .configuration_modchembert import ModChemBertConfig
|
| 50 |
+
|
| 51 |
+
logger = logging.get_logger(__name__)
|
| 52 |
+
|
| 53 |
+
|
| 54 |
+
class InitWeightsMixin:
|
| 55 |
+
def _init_weights(self, module: nn.Module):
|
| 56 |
+
super()._init_weights(module) # type: ignore
|
| 57 |
+
|
| 58 |
+
cutoff_factor = self.config.initializer_cutoff_factor # type: ignore
|
| 59 |
+
if cutoff_factor is None:
|
| 60 |
+
cutoff_factor = 3
|
| 61 |
+
|
| 62 |
+
def init_weight(module: nn.Module, std: float):
|
| 63 |
+
if isinstance(module, nn.Linear):
|
| 64 |
+
nn.init.trunc_normal_(
|
| 65 |
+
module.weight,
|
| 66 |
+
mean=0.0,
|
| 67 |
+
std=std,
|
| 68 |
+
a=-cutoff_factor * std,
|
| 69 |
+
b=cutoff_factor * std,
|
| 70 |
+
)
|
| 71 |
+
if module.bias is not None:
|
| 72 |
+
nn.init.zeros_(module.bias)
|
| 73 |
+
|
| 74 |
+
stds = {
|
| 75 |
+
"in": self.config.initializer_range, # type: ignore
|
| 76 |
+
"out": self.config.initializer_range / math.sqrt(2.0 * self.config.num_hidden_layers), # type: ignore
|
| 77 |
+
"final_out": self.config.hidden_size**-0.5, # type: ignore
|
| 78 |
+
}
|
| 79 |
+
|
| 80 |
+
if isinstance(module, ModChemBertForMaskedLM):
|
| 81 |
+
init_weight(module.decoder, stds["out"])
|
| 82 |
+
elif isinstance(module, ModChemBertForSequenceClassification):
|
| 83 |
+
init_weight(module.classifier, stds["final_out"])
|
| 84 |
+
elif isinstance(module, ModChemBertPoolingAttention):
|
| 85 |
+
init_weight(module.Wq, stds["in"])
|
| 86 |
+
init_weight(module.Wk, stds["in"])
|
| 87 |
+
init_weight(module.Wv, stds["in"])
|
| 88 |
+
init_weight(module.Wo, stds["out"])
|
| 89 |
+
|
| 90 |
+
|
| 91 |
+
class ModChemBertPoolingAttention(nn.Module):
|
| 92 |
+
"""Performs multi-headed self attention on a batch of sequences."""
|
| 93 |
+
|
| 94 |
+
def __init__(self, config: ModChemBertConfig):
|
| 95 |
+
super().__init__()
|
| 96 |
+
self.config = copy.deepcopy(config)
|
| 97 |
+
# Override num_attention_heads to use classifier_pooling_num_attention_heads
|
| 98 |
+
self.config.num_attention_heads = config.classifier_pooling_num_attention_heads
|
| 99 |
+
# Override attention_dropout to use classifier_pooling_attention_dropout
|
| 100 |
+
self.config.attention_dropout = config.classifier_pooling_attention_dropout
|
| 101 |
+
|
| 102 |
+
if config.hidden_size % config.num_attention_heads != 0:
|
| 103 |
+
raise ValueError(
|
| 104 |
+
f"The hidden size ({config.hidden_size}) is not a multiple of the number of attention heads "
|
| 105 |
+
f"({config.num_attention_heads})"
|
| 106 |
+
)
|
| 107 |
+
|
| 108 |
+
self.attention_dropout = config.attention_dropout
|
| 109 |
+
self.num_heads = config.num_attention_heads
|
| 110 |
+
self.head_dim = config.hidden_size // config.num_attention_heads
|
| 111 |
+
self.all_head_size = self.head_dim * self.num_heads
|
| 112 |
+
self.Wq = nn.Linear(config.hidden_size, self.all_head_size, bias=config.attention_bias)
|
| 113 |
+
self.Wk = nn.Linear(config.hidden_size, self.all_head_size, bias=config.attention_bias)
|
| 114 |
+
self.Wv = nn.Linear(config.hidden_size, self.all_head_size, bias=config.attention_bias)
|
| 115 |
+
|
| 116 |
+
# Use global attention
|
| 117 |
+
self.local_attention = (-1, -1)
|
| 118 |
+
rope_theta = config.global_rope_theta
|
| 119 |
+
# sdpa path from original ModernBert implementation
|
| 120 |
+
config_copy = copy.deepcopy(config)
|
| 121 |
+
config_copy.rope_theta = rope_theta
|
| 122 |
+
self.rotary_emb = ModernBertRotaryEmbedding(config=config_copy)
|
| 123 |
+
|
| 124 |
+
self.Wo = nn.Linear(config.hidden_size, config.hidden_size, bias=config.attention_bias)
|
| 125 |
+
self.out_drop = (
|
| 126 |
+
nn.Dropout(config.attention_dropout)
|
| 127 |
+
if config.attention_dropout > 0.0
|
| 128 |
+
else nn.Identity()
|
| 129 |
+
)
|
| 130 |
+
self.pruned_heads = set()
|
| 131 |
+
|
| 132 |
+
def forward(
|
| 133 |
+
self,
|
| 134 |
+
q: torch.Tensor,
|
| 135 |
+
kv: torch.Tensor,
|
| 136 |
+
attention_mask: torch.Tensor | None = None,
|
| 137 |
+
**kwargs,
|
| 138 |
+
) -> torch.Tensor:
|
| 139 |
+
bs, seq_len = kv.shape[:2]
|
| 140 |
+
q_proj: torch.Tensor = self.Wq(q)
|
| 141 |
+
k_proj: torch.Tensor = self.Wk(kv)
|
| 142 |
+
v_proj: torch.Tensor = self.Wv(kv)
|
| 143 |
+
qkv = torch.stack(
|
| 144 |
+
(
|
| 145 |
+
q_proj.reshape(bs, seq_len, self.num_heads, self.head_dim),
|
| 146 |
+
k_proj.reshape(bs, seq_len, self.num_heads, self.head_dim),
|
| 147 |
+
v_proj.reshape(bs, seq_len, self.num_heads, self.head_dim),
|
| 148 |
+
),
|
| 149 |
+
dim=2,
|
| 150 |
+
) # (bs, seq_len, 3, num_heads, head_dim)
|
| 151 |
+
|
| 152 |
+
device = kv.device
|
| 153 |
+
if attention_mask is None:
|
| 154 |
+
attention_mask = torch.ones((bs, seq_len), device=device, dtype=torch.bool)
|
| 155 |
+
position_ids = torch.arange(seq_len, device=device).unsqueeze(0).long()
|
| 156 |
+
|
| 157 |
+
attn_outputs = MODERNBERT_ATTENTION_FUNCTION["sdpa"](
|
| 158 |
+
self,
|
| 159 |
+
qkv=qkv,
|
| 160 |
+
attention_mask=_prepare_4d_attention_mask(attention_mask, kv.dtype),
|
| 161 |
+
sliding_window_mask=None, # not needed when using global attention
|
| 162 |
+
position_ids=position_ids,
|
| 163 |
+
local_attention=self.local_attention,
|
| 164 |
+
bs=bs,
|
| 165 |
+
dim=self.all_head_size,
|
| 166 |
+
**kwargs,
|
| 167 |
+
)
|
| 168 |
+
hidden_states = attn_outputs[0]
|
| 169 |
+
hidden_states = self.out_drop(self.Wo(hidden_states))
|
| 170 |
+
|
| 171 |
+
return hidden_states
|
| 172 |
+
|
| 173 |
+
|
| 174 |
+
class ModChemBertModel(ModernBertPreTrainedModel):
|
| 175 |
+
config_class = ModChemBertConfig
|
| 176 |
+
|
| 177 |
+
def __init__(self, config: ModChemBertConfig):
|
| 178 |
+
super().__init__(config)
|
| 179 |
+
self.config = config
|
| 180 |
+
self.embeddings = ModernBertEmbeddings(config)
|
| 181 |
+
self.layers = nn.ModuleList(
|
| 182 |
+
[
|
| 183 |
+
ModernBertEncoderLayer(config, layer_id)
|
| 184 |
+
for layer_id in range(config.num_hidden_layers)
|
| 185 |
+
]
|
| 186 |
+
)
|
| 187 |
+
self.final_norm = nn.LayerNorm(
|
| 188 |
+
config.hidden_size, eps=config.norm_eps, bias=config.norm_bias
|
| 189 |
+
)
|
| 190 |
+
self.gradient_checkpointing = False
|
| 191 |
+
self.post_init()
|
| 192 |
+
|
| 193 |
+
def get_input_embeddings(self):
|
| 194 |
+
return self.embeddings.tok_embeddings
|
| 195 |
+
|
| 196 |
+
def set_input_embeddings(self, value):
|
| 197 |
+
self.embeddings.tok_embeddings = value # type: ignore
|
| 198 |
+
|
| 199 |
+
def forward(
|
| 200 |
+
self,
|
| 201 |
+
input_ids: torch.LongTensor | None = None,
|
| 202 |
+
attention_mask: torch.Tensor | None = None,
|
| 203 |
+
sliding_window_mask: torch.Tensor | None = None,
|
| 204 |
+
position_ids: torch.LongTensor | None = None,
|
| 205 |
+
inputs_embeds: torch.Tensor | None = None,
|
| 206 |
+
indices: torch.Tensor | None = None,
|
| 207 |
+
cu_seqlens: torch.Tensor | None = None,
|
| 208 |
+
max_seqlen: int | None = None,
|
| 209 |
+
batch_size: int | None = None,
|
| 210 |
+
seq_len: int | None = None,
|
| 211 |
+
output_attentions: bool | None = None,
|
| 212 |
+
output_hidden_states: bool | None = None,
|
| 213 |
+
return_dict: bool | None = None,
|
| 214 |
+
) -> tuple[torch.Tensor, ...] | BaseModelOutput:
|
| 215 |
+
r"""
|
| 216 |
+
sliding_window_mask (`torch.Tensor` of shape `(batch_size, sequence_length)`, *optional*):
|
| 217 |
+
Mask to avoid performing attention on padding or far-away tokens. In ModernBert, only every few layers
|
| 218 |
+
perform global attention, while the rest perform local attention. This mask is used to avoid attending to
|
| 219 |
+
far-away tokens in the local attention layers when not using Flash Attention.
|
| 220 |
+
indices (`torch.Tensor` of shape `(total_unpadded_tokens,)`, *optional*):
|
| 221 |
+
Indices of the non-padding tokens in the input sequence. Used for unpadding the output.
|
| 222 |
+
cu_seqlens (`torch.Tensor` of shape `(batch + 1,)`, *optional*):
|
| 223 |
+
Cumulative sequence lengths of the input sequences. Used to index the unpadded tensors.
|
| 224 |
+
max_seqlen (`int`, *optional*):
|
| 225 |
+
Maximum sequence length in the batch excluding padding tokens. Used to unpad input_ids and pad output tensors.
|
| 226 |
+
batch_size (`int`, *optional*):
|
| 227 |
+
Batch size of the input sequences. Used to pad the output tensors.
|
| 228 |
+
seq_len (`int`, *optional*):
|
| 229 |
+
Sequence length of the input sequences including padding tokens. Used to pad the output tensors.
|
| 230 |
+
""" # noqa: E501
|
| 231 |
+
output_attentions = (
|
| 232 |
+
output_attentions if output_attentions is not None else self.config.output_attentions
|
| 233 |
+
)
|
| 234 |
+
output_hidden_states = (
|
| 235 |
+
output_hidden_states
|
| 236 |
+
if output_hidden_states is not None
|
| 237 |
+
else self.config.output_hidden_states
|
| 238 |
+
)
|
| 239 |
+
return_dict = return_dict if return_dict is not None else self.config.use_return_dict
|
| 240 |
+
|
| 241 |
+
if (input_ids is None) ^ (inputs_embeds is not None):
|
| 242 |
+
raise ValueError("You must specify exactly one of input_ids or inputs_embeds")
|
| 243 |
+
|
| 244 |
+
all_hidden_states = () if output_hidden_states else None
|
| 245 |
+
all_self_attentions = () if output_attentions else None
|
| 246 |
+
|
| 247 |
+
self._maybe_set_compile()
|
| 248 |
+
|
| 249 |
+
if input_ids is not None:
|
| 250 |
+
self.warn_if_padding_and_no_attention_mask(input_ids, attention_mask)
|
| 251 |
+
|
| 252 |
+
if batch_size is None and seq_len is None:
|
| 253 |
+
if inputs_embeds is not None:
|
| 254 |
+
batch_size, seq_len = inputs_embeds.shape[:2]
|
| 255 |
+
else:
|
| 256 |
+
batch_size, seq_len = input_ids.shape[:2] # type: ignore
|
| 257 |
+
device = input_ids.device if input_ids is not None else inputs_embeds.device # type: ignore
|
| 258 |
+
|
| 259 |
+
if attention_mask is None:
|
| 260 |
+
attention_mask = torch.ones((batch_size, seq_len), device=device, dtype=torch.bool) # type: ignore
|
| 261 |
+
|
| 262 |
+
repad = False
|
| 263 |
+
if self.config._attn_implementation == "flash_attention_2":
|
| 264 |
+
if indices is None and cu_seqlens is None and max_seqlen is None:
|
| 265 |
+
repad = True
|
| 266 |
+
if inputs_embeds is None:
|
| 267 |
+
with torch.no_grad():
|
| 268 |
+
input_ids, indices, cu_seqlens, max_seqlen, *_ = _unpad_modernbert_input(
|
| 269 |
+
inputs=input_ids, # type: ignore
|
| 270 |
+
attention_mask=attention_mask, # type: ignore
|
| 271 |
+
)
|
| 272 |
+
else:
|
| 273 |
+
inputs_embeds, indices, cu_seqlens, max_seqlen, *_ = _unpad_modernbert_input(
|
| 274 |
+
inputs=inputs_embeds,
|
| 275 |
+
attention_mask=attention_mask, # type: ignore
|
| 276 |
+
)
|
| 277 |
+
else:
|
| 278 |
+
if position_ids is None:
|
| 279 |
+
position_ids = torch.arange(seq_len, device=device).unsqueeze(0) # type: ignore
|
| 280 |
+
|
| 281 |
+
attention_mask, sliding_window_mask = self._update_attention_mask(
|
| 282 |
+
attention_mask, # type: ignore
|
| 283 |
+
output_attentions=output_attentions, # type: ignore
|
| 284 |
+
)
|
| 285 |
+
|
| 286 |
+
hidden_states = self.embeddings(input_ids=input_ids, inputs_embeds=inputs_embeds)
|
| 287 |
+
|
| 288 |
+
for encoder_layer in self.layers:
|
| 289 |
+
if output_hidden_states:
|
| 290 |
+
all_hidden_states = all_hidden_states + (hidden_states,) # type: ignore
|
| 291 |
+
|
| 292 |
+
layer_outputs = encoder_layer(
|
| 293 |
+
hidden_states,
|
| 294 |
+
attention_mask=attention_mask,
|
| 295 |
+
sliding_window_mask=sliding_window_mask,
|
| 296 |
+
position_ids=position_ids,
|
| 297 |
+
cu_seqlens=cu_seqlens,
|
| 298 |
+
max_seqlen=max_seqlen,
|
| 299 |
+
output_attentions=output_attentions,
|
| 300 |
+
)
|
| 301 |
+
hidden_states = layer_outputs[0]
|
| 302 |
+
if output_attentions and len(layer_outputs) > 1:
|
| 303 |
+
all_self_attentions = all_self_attentions + (layer_outputs[1],) # type: ignore
|
| 304 |
+
|
| 305 |
+
if output_hidden_states:
|
| 306 |
+
all_hidden_states = all_hidden_states + (hidden_states,) # type: ignore
|
| 307 |
+
|
| 308 |
+
hidden_states = self.final_norm(hidden_states)
|
| 309 |
+
|
| 310 |
+
if repad:
|
| 311 |
+
hidden_states = _pad_modernbert_output(
|
| 312 |
+
inputs=hidden_states,
|
| 313 |
+
indices=indices, # type: ignore
|
| 314 |
+
batch=batch_size, # type: ignore
|
| 315 |
+
seqlen=seq_len, # type: ignore
|
| 316 |
+
)
|
| 317 |
+
if all_hidden_states is not None:
|
| 318 |
+
all_hidden_states = tuple(
|
| 319 |
+
_pad_modernbert_output(
|
| 320 |
+
inputs=hs, indices=indices, batch=batch_size, seqlen=seq_len
|
| 321 |
+
) # type: ignore
|
| 322 |
+
for hs in all_hidden_states
|
| 323 |
+
)
|
| 324 |
+
|
| 325 |
+
if not return_dict:
|
| 326 |
+
return tuple(
|
| 327 |
+
v for v in [hidden_states, all_hidden_states, all_self_attentions] if v is not None
|
| 328 |
+
)
|
| 329 |
+
return BaseModelOutput(
|
| 330 |
+
last_hidden_state=hidden_states, # type: ignore
|
| 331 |
+
hidden_states=all_hidden_states, # type: ignore
|
| 332 |
+
attentions=all_self_attentions,
|
| 333 |
+
)
|
| 334 |
+
|
| 335 |
+
def _update_attention_mask(
|
| 336 |
+
self, attention_mask: torch.Tensor, output_attentions: bool
|
| 337 |
+
) -> torch.Tensor:
|
| 338 |
+
if output_attentions:
|
| 339 |
+
if self.config._attn_implementation == "sdpa":
|
| 340 |
+
logger.warning_once( # type: ignore
|
| 341 |
+
"Outputting attentions is only supported with the 'eager' attention implementation, "
|
| 342 |
+
'not with "sdpa". Falling back to `attn_implementation="eager"`.'
|
| 343 |
+
)
|
| 344 |
+
self.config._attn_implementation = "eager"
|
| 345 |
+
elif self.config._attn_implementation != "eager":
|
| 346 |
+
logger.warning_once( # type: ignore
|
| 347 |
+
"Outputting attentions is only supported with the eager attention implementation, "
|
| 348 |
+
f'not with {self.config._attn_implementation}. Consider setting `attn_implementation="eager"`.'
|
| 349 |
+
" Setting `output_attentions=False`."
|
| 350 |
+
)
|
| 351 |
+
|
| 352 |
+
global_attention_mask = _prepare_4d_attention_mask(attention_mask, self.dtype)
|
| 353 |
+
|
| 354 |
+
# Create position indices
|
| 355 |
+
rows = torch.arange(global_attention_mask.shape[2]).unsqueeze(0)
|
| 356 |
+
# Calculate distance between positions
|
| 357 |
+
distance = torch.abs(rows - rows.T)
|
| 358 |
+
|
| 359 |
+
# Create sliding window mask (1 for positions within window, 0 outside)
|
| 360 |
+
window_mask = (
|
| 361 |
+
(distance <= self.config.local_attention // 2)
|
| 362 |
+
.unsqueeze(0)
|
| 363 |
+
.unsqueeze(0)
|
| 364 |
+
.to(attention_mask.device)
|
| 365 |
+
)
|
| 366 |
+
# Combine with existing mask
|
| 367 |
+
sliding_window_mask = global_attention_mask.masked_fill(
|
| 368 |
+
window_mask.logical_not(), torch.finfo(self.dtype).min
|
| 369 |
+
)
|
| 370 |
+
|
| 371 |
+
return global_attention_mask, sliding_window_mask # type: ignore
|
| 372 |
+
|
| 373 |
+
|
| 374 |
+
class ModChemBertForMaskedLM(InitWeightsMixin, ModernBertPreTrainedModel):
|
| 375 |
+
config_class = ModChemBertConfig
|
| 376 |
+
_tied_weights_keys = ["decoder.weight"]
|
| 377 |
+
|
| 378 |
+
def __init__(self, config: ModChemBertConfig):
|
| 379 |
+
super().__init__(config)
|
| 380 |
+
self.config = config
|
| 381 |
+
self.model = ModChemBertModel(config)
|
| 382 |
+
self.head = ModernBertPredictionHead(config)
|
| 383 |
+
self.decoder = nn.Linear(config.hidden_size, config.vocab_size, bias=config.decoder_bias)
|
| 384 |
+
|
| 385 |
+
self.sparse_prediction = self.config.sparse_prediction
|
| 386 |
+
self.sparse_pred_ignore_index = self.config.sparse_pred_ignore_index
|
| 387 |
+
|
| 388 |
+
# Initialize weights and apply final processing
|
| 389 |
+
self.post_init()
|
| 390 |
+
|
| 391 |
+
def get_output_embeddings(self):
|
| 392 |
+
return self.decoder
|
| 393 |
+
|
| 394 |
+
def set_output_embeddings(self, new_embeddings: nn.Linear):
|
| 395 |
+
self.decoder = new_embeddings
|
| 396 |
+
|
| 397 |
+
@torch.compile(dynamic=True)
|
| 398 |
+
def compiled_head(self, output: torch.Tensor) -> torch.Tensor:
|
| 399 |
+
return self.decoder(self.head(output))
|
| 400 |
+
|
| 401 |
+
def forward(
|
| 402 |
+
self,
|
| 403 |
+
input_ids: torch.LongTensor | None = None,
|
| 404 |
+
attention_mask: torch.Tensor | None = None,
|
| 405 |
+
sliding_window_mask: torch.Tensor | None = None,
|
| 406 |
+
position_ids: torch.Tensor | None = None,
|
| 407 |
+
inputs_embeds: torch.Tensor | None = None,
|
| 408 |
+
labels: torch.Tensor | None = None,
|
| 409 |
+
indices: torch.Tensor | None = None,
|
| 410 |
+
cu_seqlens: torch.Tensor | None = None,
|
| 411 |
+
max_seqlen: int | None = None,
|
| 412 |
+
batch_size: int | None = None,
|
| 413 |
+
seq_len: int | None = None,
|
| 414 |
+
output_attentions: bool | None = None,
|
| 415 |
+
output_hidden_states: bool | None = None,
|
| 416 |
+
return_dict: bool | None = None,
|
| 417 |
+
**kwargs,
|
| 418 |
+
) -> tuple[torch.Tensor] | tuple[torch.Tensor, typing.Any] | MaskedLMOutput:
|
| 419 |
+
r"""
|
| 420 |
+
sliding_window_mask (`torch.Tensor` of shape `(batch_size, sequence_length)`, *optional*):
|
| 421 |
+
Mask to avoid performing attention on padding or far-away tokens. In ModernBert, only every few layers
|
| 422 |
+
perform global attention, while the rest perform local attention. This mask is used to avoid attending to
|
| 423 |
+
far-away tokens in the local attention layers when not using Flash Attention.
|
| 424 |
+
indices (`torch.Tensor` of shape `(total_unpadded_tokens,)`, *optional*):
|
| 425 |
+
Indices of the non-padding tokens in the input sequence. Used for unpadding the output.
|
| 426 |
+
cu_seqlens (`torch.Tensor` of shape `(batch + 1,)`, *optional*):
|
| 427 |
+
Cumulative sequence lengths of the input sequences. Used to index the unpadded tensors.
|
| 428 |
+
max_seqlen (`int`, *optional*):
|
| 429 |
+
Maximum sequence length in the batch excluding padding tokens. Used to unpad input_ids & pad output tensors.
|
| 430 |
+
batch_size (`int`, *optional*):
|
| 431 |
+
Batch size of the input sequences. Used to pad the output tensors.
|
| 432 |
+
seq_len (`int`, *optional*):
|
| 433 |
+
Sequence length of the input sequences including padding tokens. Used to pad the output tensors.
|
| 434 |
+
"""
|
| 435 |
+
return_dict = return_dict if return_dict is not None else self.config.use_return_dict
|
| 436 |
+
self._maybe_set_compile()
|
| 437 |
+
|
| 438 |
+
if self.config._attn_implementation == "flash_attention_2": # noqa: SIM102
|
| 439 |
+
if indices is None and cu_seqlens is None and max_seqlen is None:
|
| 440 |
+
if batch_size is None and seq_len is None:
|
| 441 |
+
if inputs_embeds is not None:
|
| 442 |
+
batch_size, seq_len = inputs_embeds.shape[:2]
|
| 443 |
+
else:
|
| 444 |
+
batch_size, seq_len = input_ids.shape[:2] # type: ignore
|
| 445 |
+
device = input_ids.device if input_ids is not None else inputs_embeds.device # type: ignore
|
| 446 |
+
|
| 447 |
+
if attention_mask is None:
|
| 448 |
+
attention_mask = torch.ones(
|
| 449 |
+
(batch_size, seq_len), device=device, dtype=torch.bool
|
| 450 |
+
) # type: ignore
|
| 451 |
+
|
| 452 |
+
if inputs_embeds is None:
|
| 453 |
+
with torch.no_grad():
|
| 454 |
+
input_ids, indices, cu_seqlens, max_seqlen, position_ids, labels = (
|
| 455 |
+
_unpad_modernbert_input(
|
| 456 |
+
inputs=input_ids, # type: ignore
|
| 457 |
+
attention_mask=attention_mask, # type: ignore
|
| 458 |
+
position_ids=position_ids,
|
| 459 |
+
labels=labels,
|
| 460 |
+
)
|
| 461 |
+
)
|
| 462 |
+
else:
|
| 463 |
+
inputs_embeds, indices, cu_seqlens, max_seqlen, position_ids, labels = (
|
| 464 |
+
_unpad_modernbert_input(
|
| 465 |
+
inputs=inputs_embeds,
|
| 466 |
+
attention_mask=attention_mask, # type: ignore
|
| 467 |
+
position_ids=position_ids,
|
| 468 |
+
labels=labels,
|
| 469 |
+
)
|
| 470 |
+
)
|
| 471 |
+
|
| 472 |
+
outputs = self.model(
|
| 473 |
+
input_ids=input_ids,
|
| 474 |
+
attention_mask=attention_mask,
|
| 475 |
+
sliding_window_mask=sliding_window_mask,
|
| 476 |
+
position_ids=position_ids,
|
| 477 |
+
inputs_embeds=inputs_embeds,
|
| 478 |
+
indices=indices,
|
| 479 |
+
cu_seqlens=cu_seqlens,
|
| 480 |
+
max_seqlen=max_seqlen,
|
| 481 |
+
batch_size=batch_size,
|
| 482 |
+
seq_len=seq_len,
|
| 483 |
+
output_attentions=output_attentions,
|
| 484 |
+
output_hidden_states=output_hidden_states,
|
| 485 |
+
return_dict=return_dict,
|
| 486 |
+
)
|
| 487 |
+
last_hidden_state = outputs[0]
|
| 488 |
+
|
| 489 |
+
if self.sparse_prediction and labels is not None:
|
| 490 |
+
# flatten labels and output first
|
| 491 |
+
labels = labels.view(-1)
|
| 492 |
+
last_hidden_state = last_hidden_state.view(labels.shape[0], -1)
|
| 493 |
+
|
| 494 |
+
# then filter out the non-masked tokens
|
| 495 |
+
mask_tokens = labels != self.sparse_pred_ignore_index
|
| 496 |
+
last_hidden_state = last_hidden_state[mask_tokens]
|
| 497 |
+
labels = labels[mask_tokens]
|
| 498 |
+
|
| 499 |
+
logits = (
|
| 500 |
+
self.compiled_head(last_hidden_state)
|
| 501 |
+
if self.config.reference_compile
|
| 502 |
+
else self.decoder(self.head(last_hidden_state))
|
| 503 |
+
)
|
| 504 |
+
|
| 505 |
+
loss = None
|
| 506 |
+
if labels is not None:
|
| 507 |
+
loss = self.loss_function(logits, labels, vocab_size=self.config.vocab_size, **kwargs)
|
| 508 |
+
|
| 509 |
+
if self.config._attn_implementation == "flash_attention_2":
|
| 510 |
+
with (
|
| 511 |
+
nullcontext()
|
| 512 |
+
if self.config.repad_logits_with_grad or labels is None
|
| 513 |
+
else torch.no_grad()
|
| 514 |
+
):
|
| 515 |
+
logits = _pad_modernbert_output(
|
| 516 |
+
inputs=logits, indices=indices, batch=batch_size, seqlen=seq_len
|
| 517 |
+
) # type: ignore
|
| 518 |
+
|
| 519 |
+
if not return_dict:
|
| 520 |
+
output = (logits,)
|
| 521 |
+
return ((loss,) + output) if loss is not None else output
|
| 522 |
+
|
| 523 |
+
return MaskedLMOutput(
|
| 524 |
+
loss=loss,
|
| 525 |
+
logits=typing.cast(torch.FloatTensor, logits),
|
| 526 |
+
hidden_states=outputs.hidden_states,
|
| 527 |
+
attentions=outputs.attentions,
|
| 528 |
+
)
|
| 529 |
+
|
| 530 |
+
|
| 531 |
+
class ModChemBertForSequenceClassification(InitWeightsMixin, ModernBertPreTrainedModel):
|
| 532 |
+
config_class = ModChemBertConfig
|
| 533 |
+
|
| 534 |
+
def __init__(self, config: ModChemBertConfig):
|
| 535 |
+
super().__init__(config)
|
| 536 |
+
self.num_labels = config.num_labels
|
| 537 |
+
self.config = config
|
| 538 |
+
|
| 539 |
+
self.model = ModernBertModel(config)
|
| 540 |
+
if self.config.classifier_pooling in {"cls_mha", "max_seq_mha"}:
|
| 541 |
+
self.pooling_attn = ModChemBertPoolingAttention(config=self.config)
|
| 542 |
+
else:
|
| 543 |
+
self.pooling_attn = None
|
| 544 |
+
self.head = ModernBertPredictionHead(config)
|
| 545 |
+
self.drop = torch.nn.Dropout(config.classifier_dropout)
|
| 546 |
+
self.classifier = nn.Linear(config.hidden_size, config.num_labels)
|
| 547 |
+
|
| 548 |
+
# Initialize weights and apply final processing
|
| 549 |
+
self.post_init()
|
| 550 |
+
|
| 551 |
+
def forward(
|
| 552 |
+
self,
|
| 553 |
+
input_ids: torch.LongTensor | None = None,
|
| 554 |
+
attention_mask: torch.Tensor | None = None,
|
| 555 |
+
sliding_window_mask: torch.Tensor | None = None,
|
| 556 |
+
position_ids: torch.Tensor | None = None,
|
| 557 |
+
inputs_embeds: torch.Tensor | None = None,
|
| 558 |
+
labels: torch.Tensor | None = None,
|
| 559 |
+
indices: torch.Tensor | None = None,
|
| 560 |
+
cu_seqlens: torch.Tensor | None = None,
|
| 561 |
+
max_seqlen: int | None = None,
|
| 562 |
+
batch_size: int | None = None,
|
| 563 |
+
seq_len: int | None = None,
|
| 564 |
+
output_attentions: bool | None = None,
|
| 565 |
+
output_hidden_states: bool | None = None,
|
| 566 |
+
return_dict: bool | None = None,
|
| 567 |
+
**kwargs,
|
| 568 |
+
) -> tuple[torch.Tensor] | tuple[torch.Tensor, typing.Any] | SequenceClassifierOutput:
|
| 569 |
+
r"""
|
| 570 |
+
sliding_window_mask (`torch.Tensor` of shape `(batch_size, sequence_length)`, *optional*):
|
| 571 |
+
Mask to avoid performing attention on padding or far-away tokens. In ModernBert, only every few layers
|
| 572 |
+
perform global attention, while the rest perform local attention. This mask is used to avoid attending to
|
| 573 |
+
far-away tokens in the local attention layers when not using Flash Attention.
|
| 574 |
+
labels (`torch.LongTensor` of shape `(batch_size,)`, *optional*):
|
| 575 |
+
Labels for computing the sequence classification/regression loss. Indices should be in `[0, ...,
|
| 576 |
+
config.num_labels - 1]`. If `config.num_labels == 1` a regression loss is computed (Mean-Square loss), If
|
| 577 |
+
`config.num_labels > 1` a classification loss is computed (Cross-Entropy).
|
| 578 |
+
indices (`torch.Tensor` of shape `(total_unpadded_tokens,)`, *optional*):
|
| 579 |
+
Indices of the non-padding tokens in the input sequence. Used for unpadding the output.
|
| 580 |
+
cu_seqlens (`torch.Tensor` of shape `(batch + 1,)`, *optional*):
|
| 581 |
+
Cumulative sequence lengths of the input sequences. Used to index the unpadded tensors.
|
| 582 |
+
max_seqlen (`int`, *optional*):
|
| 583 |
+
Maximum sequence length in the batch excluding padding tokens. Used to unpad input_ids & pad output tensors.
|
| 584 |
+
batch_size (`int`, *optional*):
|
| 585 |
+
Batch size of the input sequences. Used to pad the output tensors.
|
| 586 |
+
seq_len (`int`, *optional*):
|
| 587 |
+
Sequence length of the input sequences including padding tokens. Used to pad the output tensors.
|
| 588 |
+
"""
|
| 589 |
+
return_dict = return_dict if return_dict is not None else self.config.use_return_dict
|
| 590 |
+
self._maybe_set_compile()
|
| 591 |
+
|
| 592 |
+
if input_ids is not None:
|
| 593 |
+
self.warn_if_padding_and_no_attention_mask(input_ids, attention_mask)
|
| 594 |
+
|
| 595 |
+
if batch_size is None and seq_len is None:
|
| 596 |
+
if inputs_embeds is not None:
|
| 597 |
+
batch_size, seq_len = inputs_embeds.shape[:2]
|
| 598 |
+
else:
|
| 599 |
+
batch_size, seq_len = input_ids.shape[:2] # type: ignore
|
| 600 |
+
device = input_ids.device if input_ids is not None else inputs_embeds.device # type: ignore
|
| 601 |
+
|
| 602 |
+
if attention_mask is None:
|
| 603 |
+
attention_mask = torch.ones((batch_size, seq_len), device=device, dtype=torch.bool) # type: ignore
|
| 604 |
+
|
| 605 |
+
# Ensure output_hidden_states is True in case pooling mode requires all hidden states
|
| 606 |
+
output_hidden_states = True
|
| 607 |
+
|
| 608 |
+
outputs = self.model(
|
| 609 |
+
input_ids=input_ids,
|
| 610 |
+
attention_mask=attention_mask,
|
| 611 |
+
sliding_window_mask=sliding_window_mask,
|
| 612 |
+
position_ids=position_ids,
|
| 613 |
+
inputs_embeds=inputs_embeds,
|
| 614 |
+
indices=indices,
|
| 615 |
+
cu_seqlens=cu_seqlens,
|
| 616 |
+
max_seqlen=max_seqlen,
|
| 617 |
+
batch_size=batch_size,
|
| 618 |
+
seq_len=seq_len,
|
| 619 |
+
output_attentions=output_attentions,
|
| 620 |
+
output_hidden_states=output_hidden_states,
|
| 621 |
+
return_dict=return_dict,
|
| 622 |
+
)
|
| 623 |
+
last_hidden_state = outputs[0]
|
| 624 |
+
hidden_states = outputs[1]
|
| 625 |
+
|
| 626 |
+
last_hidden_state = _pool_modchembert_output(
|
| 627 |
+
self,
|
| 628 |
+
last_hidden_state,
|
| 629 |
+
hidden_states,
|
| 630 |
+
typing.cast(torch.Tensor, attention_mask),
|
| 631 |
+
)
|
| 632 |
+
pooled_output = self.head(last_hidden_state)
|
| 633 |
+
pooled_output = self.drop(pooled_output)
|
| 634 |
+
logits = self.classifier(pooled_output)
|
| 635 |
+
|
| 636 |
+
loss = None
|
| 637 |
+
if labels is not None:
|
| 638 |
+
if self.config.problem_type is None:
|
| 639 |
+
if self.num_labels == 1:
|
| 640 |
+
self.config.problem_type = "regression"
|
| 641 |
+
elif self.num_labels > 1 and (
|
| 642 |
+
labels.dtype == torch.long or labels.dtype == torch.int
|
| 643 |
+
):
|
| 644 |
+
self.config.problem_type = "single_label_classification"
|
| 645 |
+
else:
|
| 646 |
+
self.config.problem_type = "multi_label_classification"
|
| 647 |
+
|
| 648 |
+
if self.config.problem_type == "regression":
|
| 649 |
+
loss_fct = MSELoss()
|
| 650 |
+
if self.num_labels == 1:
|
| 651 |
+
loss = loss_fct(logits.squeeze(), labels.squeeze())
|
| 652 |
+
else:
|
| 653 |
+
loss = loss_fct(logits, labels)
|
| 654 |
+
elif self.config.problem_type == "single_label_classification":
|
| 655 |
+
loss_fct = CrossEntropyLoss()
|
| 656 |
+
loss = loss_fct(logits.view(-1, self.num_labels), labels.view(-1))
|
| 657 |
+
elif self.config.problem_type == "multi_label_classification":
|
| 658 |
+
loss_fct = BCEWithLogitsLoss()
|
| 659 |
+
loss = loss_fct(logits, labels)
|
| 660 |
+
|
| 661 |
+
if not return_dict:
|
| 662 |
+
output = (logits,)
|
| 663 |
+
return ((loss,) + output) if loss is not None else output
|
| 664 |
+
|
| 665 |
+
return SequenceClassifierOutput(
|
| 666 |
+
loss=loss,
|
| 667 |
+
logits=logits,
|
| 668 |
+
hidden_states=outputs.hidden_states,
|
| 669 |
+
attentions=outputs.attentions,
|
| 670 |
+
)
|
| 671 |
+
|
| 672 |
+
|
| 673 |
+
def _pool_modchembert_output(
|
| 674 |
+
module: ModChemBertForSequenceClassification,
|
| 675 |
+
last_hidden_state: torch.Tensor,
|
| 676 |
+
hidden_states: list[torch.Tensor],
|
| 677 |
+
attention_mask: torch.Tensor,
|
| 678 |
+
):
|
| 679 |
+
"""
|
| 680 |
+
Apply pooling strategy to hidden states for sequence-level classification/regression tasks.
|
| 681 |
+
|
| 682 |
+
This function implements various pooling strategies to aggregate sequence representations
|
| 683 |
+
into a single vector for downstream classification or regression tasks. The pooling method
|
| 684 |
+
is determined by the `classifier_pooling` configuration parameter.
|
| 685 |
+
|
| 686 |
+
Available pooling strategies:
|
| 687 |
+
- cls: Use the CLS token ([CLS]) representation from the last hidden state
|
| 688 |
+
- mean: Average pooling over all tokens in the sequence (attention-weighted)
|
| 689 |
+
- max_cls: Element-wise max pooling over the last k hidden states, then take CLS token
|
| 690 |
+
- cls_mha: Multi-head attention with CLS token as query and full sequence as keys/values
|
| 691 |
+
- max_seq_mha: Max pooling over last k states + multi-head attention with CLS as query
|
| 692 |
+
- max_seq_mean: Max pooling over last k hidden states, then mean pooling over sequence
|
| 693 |
+
- sum_mean: Sum all hidden states across layers, then mean pool over sequence
|
| 694 |
+
- sum_sum: Sum all hidden states across layers, then sum pool over sequence
|
| 695 |
+
- mean_sum: Mean all hidden states across layers, then sum pool over sequence
|
| 696 |
+
- mean_mean: Mean all hidden states across layers, then mean pool over sequence
|
| 697 |
+
|
| 698 |
+
Args:
|
| 699 |
+
module: The model instance containing configuration and pooling attention if needed
|
| 700 |
+
last_hidden_state: Final layer hidden states of shape (batch_size, seq_len, hidden_size)
|
| 701 |
+
hidden_states: List of hidden states from all layers, each of shape (batch_size, seq_len, hidden_size)
|
| 702 |
+
attention_mask: Attention mask of shape (batch_size, seq_len) indicating valid tokens
|
| 703 |
+
|
| 704 |
+
Returns:
|
| 705 |
+
torch.Tensor: Pooled representation of shape (batch_size, hidden_size)
|
| 706 |
+
|
| 707 |
+
Note:
|
| 708 |
+
Some pooling strategies (cls_mha, max_seq_mha) require the module to have a pooling_attn
|
| 709 |
+
attribute containing a ModChemBertPoolingAttention instance.
|
| 710 |
+
"""
|
| 711 |
+
config = typing.cast(ModChemBertConfig, module.config)
|
| 712 |
+
if config.classifier_pooling == "cls":
|
| 713 |
+
last_hidden_state = last_hidden_state[:, 0]
|
| 714 |
+
elif config.classifier_pooling == "mean":
|
| 715 |
+
last_hidden_state = (last_hidden_state * attention_mask.unsqueeze(-1)).sum(
|
| 716 |
+
dim=1
|
| 717 |
+
) / attention_mask.sum(dim=1, keepdim=True)
|
| 718 |
+
elif config.classifier_pooling == "max_cls":
|
| 719 |
+
k_hidden_states = hidden_states[-config.classifier_pooling_last_k :]
|
| 720 |
+
theta = torch.stack(k_hidden_states, dim=1) # (batch, k, seq_len, hidden)
|
| 721 |
+
pooled_seq = torch.max(
|
| 722 |
+
theta, dim=1
|
| 723 |
+
).values # Element-wise max over k -> (batch, seq_len, hidden)
|
| 724 |
+
last_hidden_state = pooled_seq[:, 0, :] # (batch, hidden)
|
| 725 |
+
elif config.classifier_pooling == "cls_mha":
|
| 726 |
+
# Similar to max_seq_mha but without the max pooling step
|
| 727 |
+
# Query is CLS token (position 0); Keys/Values are full sequence
|
| 728 |
+
q = last_hidden_state[:, 0, :].unsqueeze(1) # (batch, 1, hidden)
|
| 729 |
+
q = q.expand(-1, last_hidden_state.shape[1], -1) # (batch, seq_len, hidden)
|
| 730 |
+
attn_out: torch.Tensor = module.pooling_attn( # type: ignore
|
| 731 |
+
q=q, kv=last_hidden_state, attention_mask=attention_mask
|
| 732 |
+
) # (batch, seq_len, hidden)
|
| 733 |
+
last_hidden_state = torch.mean(attn_out, dim=1)
|
| 734 |
+
elif config.classifier_pooling == "max_seq_mha":
|
| 735 |
+
k_hidden_states = hidden_states[-config.classifier_pooling_last_k :]
|
| 736 |
+
theta = torch.stack(k_hidden_states, dim=1) # (batch, k, seq_len, hidden)
|
| 737 |
+
pooled_seq = torch.max(
|
| 738 |
+
theta, dim=1
|
| 739 |
+
).values # Element-wise max over k -> (batch, seq_len, hidden)
|
| 740 |
+
# Query is pooled CLS token (position 0); Keys/Values are pooled sequence
|
| 741 |
+
q = pooled_seq[:, 0, :].unsqueeze(1) # (batch, 1, hidden)
|
| 742 |
+
q = q.expand(-1, pooled_seq.shape[1], -1) # (batch, seq_len, hidden)
|
| 743 |
+
attn_out: torch.Tensor = module.pooling_attn( # type: ignore
|
| 744 |
+
q=q, kv=pooled_seq, attention_mask=attention_mask
|
| 745 |
+
) # (batch, seq_len, hidden)
|
| 746 |
+
last_hidden_state = torch.mean(attn_out, dim=1)
|
| 747 |
+
elif config.classifier_pooling == "max_seq_mean":
|
| 748 |
+
k_hidden_states = hidden_states[-config.classifier_pooling_last_k :]
|
| 749 |
+
theta = torch.stack(k_hidden_states, dim=1) # (batch, k, seq_len, hidden)
|
| 750 |
+
pooled_seq = torch.max(
|
| 751 |
+
theta, dim=1
|
| 752 |
+
).values # Element-wise max over k -> (batch, seq_len, hidden)
|
| 753 |
+
last_hidden_state = torch.mean(pooled_seq, dim=1) # Mean over sequence length
|
| 754 |
+
elif config.classifier_pooling == "sum_mean":
|
| 755 |
+
# ChemLM uses the mean of all hidden states
|
| 756 |
+
# which outperforms using just the last layer mean or the cls embedding
|
| 757 |
+
# https://doi.org/10.1038/s42004-025-01484-4
|
| 758 |
+
# https://static-content.springer.com/esm/art%3A10.1038%2Fs42004-025-01484-4/MediaObjects/42004_2025_1484_MOESM2_ESM.pdf
|
| 759 |
+
all_hidden_states = torch.stack(hidden_states)
|
| 760 |
+
w = torch.sum(all_hidden_states, dim=0)
|
| 761 |
+
last_hidden_state = torch.mean(w, dim=1)
|
| 762 |
+
elif config.classifier_pooling == "sum_sum":
|
| 763 |
+
all_hidden_states = torch.stack(hidden_states)
|
| 764 |
+
w = torch.sum(all_hidden_states, dim=0)
|
| 765 |
+
last_hidden_state = torch.sum(w, dim=1)
|
| 766 |
+
elif config.classifier_pooling == "mean_sum":
|
| 767 |
+
all_hidden_states = torch.stack(hidden_states)
|
| 768 |
+
w = torch.mean(all_hidden_states, dim=0)
|
| 769 |
+
last_hidden_state = torch.sum(w, dim=1)
|
| 770 |
+
elif config.classifier_pooling == "mean_mean":
|
| 771 |
+
all_hidden_states = torch.stack(hidden_states)
|
| 772 |
+
w = torch.mean(all_hidden_states, dim=0)
|
| 773 |
+
last_hidden_state = torch.mean(w, dim=1)
|
| 774 |
+
return last_hidden_state
|
| 775 |
+
|
| 776 |
+
|
| 777 |
+
__all__ = [
|
| 778 |
+
"ModChemBertForMaskedLM",
|
| 779 |
+
"ModChemBertForSequenceClassification",
|
| 780 |
+
]
|
modules.json
ADDED
|
@@ -0,0 +1,20 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
[
|
| 2 |
+
{
|
| 3 |
+
"idx": 0,
|
| 4 |
+
"name": "0",
|
| 5 |
+
"path": "",
|
| 6 |
+
"type": "sentence_transformers.models.Transformer"
|
| 7 |
+
},
|
| 8 |
+
{
|
| 9 |
+
"idx": 1,
|
| 10 |
+
"name": "1",
|
| 11 |
+
"path": "1_Pooling",
|
| 12 |
+
"type": "sentence_transformers.models.Pooling"
|
| 13 |
+
},
|
| 14 |
+
{
|
| 15 |
+
"idx": 2,
|
| 16 |
+
"name": "2",
|
| 17 |
+
"path": "2_Normalize",
|
| 18 |
+
"type": "sentence_transformers.models.Normalize"
|
| 19 |
+
}
|
| 20 |
+
]
|
sentence_bert_config.json
ADDED
|
@@ -0,0 +1,4 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"max_seq_length": 512,
|
| 3 |
+
"do_lower_case": false
|
| 4 |
+
}
|
similarity_evaluation_pubchem_10m_genmol_similarity_float32_results.csv
ADDED
|
@@ -0,0 +1,14 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
epoch,steps,spearman
|
| 2 |
+
0,0,0.7261446896400275
|
| 3 |
+
0.2499925700642937,25235,0.899727524994741
|
| 4 |
+
0.4999851401285874,50470,0.9599428082697957
|
| 5 |
+
0.7499777101928812,75705,0.9755030703217896
|
| 6 |
+
0.9999702802571748,100940,0.9809624466313892
|
| 7 |
+
1.2499628503214686,126175,0.9838128954121899
|
| 8 |
+
1.4999554203857621,151410,0.9854756886661312
|
| 9 |
+
1.749947990450056,176645,0.9865980464822579
|
| 10 |
+
1.9999405605143497,201880,0.9873943693937194
|
| 11 |
+
2.2499331305786434,227115,0.9878659546563734
|
| 12 |
+
2.499925700642937,252350,0.9879865870047979
|
| 13 |
+
2.749918270707231,277585,0.9881075350289332
|
| 14 |
+
2.9999108407715243,302820,0.9881056976837288
|
special_tokens_map.json
ADDED
|
@@ -0,0 +1,37 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"cls_token": {
|
| 3 |
+
"content": "[CLS]",
|
| 4 |
+
"lstrip": false,
|
| 5 |
+
"normalized": false,
|
| 6 |
+
"rstrip": false,
|
| 7 |
+
"single_word": false
|
| 8 |
+
},
|
| 9 |
+
"mask_token": {
|
| 10 |
+
"content": "[MASK]",
|
| 11 |
+
"lstrip": true,
|
| 12 |
+
"normalized": false,
|
| 13 |
+
"rstrip": false,
|
| 14 |
+
"single_word": false
|
| 15 |
+
},
|
| 16 |
+
"pad_token": {
|
| 17 |
+
"content": "[PAD]",
|
| 18 |
+
"lstrip": false,
|
| 19 |
+
"normalized": false,
|
| 20 |
+
"rstrip": false,
|
| 21 |
+
"single_word": false
|
| 22 |
+
},
|
| 23 |
+
"sep_token": {
|
| 24 |
+
"content": "[SEP]",
|
| 25 |
+
"lstrip": false,
|
| 26 |
+
"normalized": false,
|
| 27 |
+
"rstrip": false,
|
| 28 |
+
"single_word": false
|
| 29 |
+
},
|
| 30 |
+
"unk_token": {
|
| 31 |
+
"content": "[UNK]",
|
| 32 |
+
"lstrip": false,
|
| 33 |
+
"normalized": false,
|
| 34 |
+
"rstrip": false,
|
| 35 |
+
"single_word": false
|
| 36 |
+
}
|
| 37 |
+
}
|
tokenizer.json
ADDED
|
@@ -0,0 +1,2554 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"version": "1.0",
|
| 3 |
+
"truncation": {
|
| 4 |
+
"direction": "Right",
|
| 5 |
+
"max_length": 512,
|
| 6 |
+
"strategy": "LongestFirst",
|
| 7 |
+
"stride": 0
|
| 8 |
+
},
|
| 9 |
+
"padding": {
|
| 10 |
+
"strategy": "BatchLongest",
|
| 11 |
+
"direction": "Right",
|
| 12 |
+
"pad_to_multiple_of": null,
|
| 13 |
+
"pad_id": 2,
|
| 14 |
+
"pad_type_id": 0,
|
| 15 |
+
"pad_token": "[PAD]"
|
| 16 |
+
},
|
| 17 |
+
"added_tokens": [
|
| 18 |
+
{
|
| 19 |
+
"id": 0,
|
| 20 |
+
"content": "[CLS]",
|
| 21 |
+
"single_word": false,
|
| 22 |
+
"lstrip": false,
|
| 23 |
+
"rstrip": false,
|
| 24 |
+
"normalized": false,
|
| 25 |
+
"special": true
|
| 26 |
+
},
|
| 27 |
+
{
|
| 28 |
+
"id": 1,
|
| 29 |
+
"content": "[SEP]",
|
| 30 |
+
"single_word": false,
|
| 31 |
+
"lstrip": false,
|
| 32 |
+
"rstrip": false,
|
| 33 |
+
"normalized": false,
|
| 34 |
+
"special": true
|
| 35 |
+
},
|
| 36 |
+
{
|
| 37 |
+
"id": 2,
|
| 38 |
+
"content": "[PAD]",
|
| 39 |
+
"single_word": false,
|
| 40 |
+
"lstrip": false,
|
| 41 |
+
"rstrip": false,
|
| 42 |
+
"normalized": false,
|
| 43 |
+
"special": true
|
| 44 |
+
},
|
| 45 |
+
{
|
| 46 |
+
"id": 3,
|
| 47 |
+
"content": "[MASK]",
|
| 48 |
+
"single_word": false,
|
| 49 |
+
"lstrip": true,
|
| 50 |
+
"rstrip": false,
|
| 51 |
+
"normalized": false,
|
| 52 |
+
"special": true
|
| 53 |
+
},
|
| 54 |
+
{
|
| 55 |
+
"id": 2361,
|
| 56 |
+
"content": "[UNK]",
|
| 57 |
+
"single_word": false,
|
| 58 |
+
"lstrip": false,
|
| 59 |
+
"rstrip": false,
|
| 60 |
+
"normalized": false,
|
| 61 |
+
"special": true
|
| 62 |
+
}
|
| 63 |
+
],
|
| 64 |
+
"normalizer": null,
|
| 65 |
+
"pre_tokenizer": {
|
| 66 |
+
"type": "ByteLevel",
|
| 67 |
+
"add_prefix_space": false,
|
| 68 |
+
"trim_offsets": true,
|
| 69 |
+
"use_regex": true
|
| 70 |
+
},
|
| 71 |
+
"post_processor": {
|
| 72 |
+
"type": "TemplateProcessing",
|
| 73 |
+
"single": [
|
| 74 |
+
{
|
| 75 |
+
"SpecialToken": {
|
| 76 |
+
"id": "[CLS]",
|
| 77 |
+
"type_id": 0
|
| 78 |
+
}
|
| 79 |
+
},
|
| 80 |
+
{
|
| 81 |
+
"Sequence": {
|
| 82 |
+
"id": "A",
|
| 83 |
+
"type_id": 0
|
| 84 |
+
}
|
| 85 |
+
},
|
| 86 |
+
{
|
| 87 |
+
"SpecialToken": {
|
| 88 |
+
"id": "[SEP]",
|
| 89 |
+
"type_id": 0
|
| 90 |
+
}
|
| 91 |
+
}
|
| 92 |
+
],
|
| 93 |
+
"pair": [
|
| 94 |
+
{
|
| 95 |
+
"SpecialToken": {
|
| 96 |
+
"id": "[CLS]",
|
| 97 |
+
"type_id": 0
|
| 98 |
+
}
|
| 99 |
+
},
|
| 100 |
+
{
|
| 101 |
+
"Sequence": {
|
| 102 |
+
"id": "A",
|
| 103 |
+
"type_id": 0
|
| 104 |
+
}
|
| 105 |
+
},
|
| 106 |
+
{
|
| 107 |
+
"SpecialToken": {
|
| 108 |
+
"id": "[SEP]",
|
| 109 |
+
"type_id": 0
|
| 110 |
+
}
|
| 111 |
+
},
|
| 112 |
+
{
|
| 113 |
+
"Sequence": {
|
| 114 |
+
"id": "B",
|
| 115 |
+
"type_id": 0
|
| 116 |
+
}
|
| 117 |
+
},
|
| 118 |
+
{
|
| 119 |
+
"SpecialToken": {
|
| 120 |
+
"id": "[SEP]",
|
| 121 |
+
"type_id": 0
|
| 122 |
+
}
|
| 123 |
+
}
|
| 124 |
+
],
|
| 125 |
+
"special_tokens": {
|
| 126 |
+
"[CLS]": {
|
| 127 |
+
"id": "[CLS]",
|
| 128 |
+
"ids": [
|
| 129 |
+
0
|
| 130 |
+
],
|
| 131 |
+
"tokens": [
|
| 132 |
+
"[CLS]"
|
| 133 |
+
]
|
| 134 |
+
},
|
| 135 |
+
"[MASK]": {
|
| 136 |
+
"id": "[MASK]",
|
| 137 |
+
"ids": [
|
| 138 |
+
3
|
| 139 |
+
],
|
| 140 |
+
"tokens": [
|
| 141 |
+
"[MASK]"
|
| 142 |
+
]
|
| 143 |
+
},
|
| 144 |
+
"[PAD]": {
|
| 145 |
+
"id": "[PAD]",
|
| 146 |
+
"ids": [
|
| 147 |
+
2
|
| 148 |
+
],
|
| 149 |
+
"tokens": [
|
| 150 |
+
"[PAD]"
|
| 151 |
+
]
|
| 152 |
+
},
|
| 153 |
+
"[SEP]": {
|
| 154 |
+
"id": "[SEP]",
|
| 155 |
+
"ids": [
|
| 156 |
+
1
|
| 157 |
+
],
|
| 158 |
+
"tokens": [
|
| 159 |
+
"[SEP]"
|
| 160 |
+
]
|
| 161 |
+
},
|
| 162 |
+
"[UNK]": {
|
| 163 |
+
"id": "[UNK]",
|
| 164 |
+
"ids": [
|
| 165 |
+
2361
|
| 166 |
+
],
|
| 167 |
+
"tokens": [
|
| 168 |
+
"[UNK]"
|
| 169 |
+
]
|
| 170 |
+
}
|
| 171 |
+
}
|
| 172 |
+
},
|
| 173 |
+
"decoder": {
|
| 174 |
+
"type": "ByteLevel",
|
| 175 |
+
"add_prefix_space": false,
|
| 176 |
+
"trim_offsets": true,
|
| 177 |
+
"use_regex": true
|
| 178 |
+
},
|
| 179 |
+
"model": {
|
| 180 |
+
"type": "BPE",
|
| 181 |
+
"dropout": null,
|
| 182 |
+
"unk_token": "[UNK]",
|
| 183 |
+
"continuing_subword_prefix": null,
|
| 184 |
+
"end_of_word_suffix": null,
|
| 185 |
+
"fuse_unk": false,
|
| 186 |
+
"byte_fallback": false,
|
| 187 |
+
"ignore_merges": false,
|
| 188 |
+
"vocab": {
|
| 189 |
+
"[CLS]": 0,
|
| 190 |
+
"[SEP]": 1,
|
| 191 |
+
"[PAD]": 2,
|
| 192 |
+
"[MASK]": 3,
|
| 193 |
+
"C": 4,
|
| 194 |
+
"c": 5,
|
| 195 |
+
"(": 6,
|
| 196 |
+
")": 7,
|
| 197 |
+
"1": 8,
|
| 198 |
+
"O": 9,
|
| 199 |
+
"N": 10,
|
| 200 |
+
"2": 11,
|
| 201 |
+
"=": 12,
|
| 202 |
+
"n": 13,
|
| 203 |
+
"3": 14,
|
| 204 |
+
"[C@H]": 15,
|
| 205 |
+
"[C@@H]": 16,
|
| 206 |
+
"F": 17,
|
| 207 |
+
"S": 18,
|
| 208 |
+
"4": 19,
|
| 209 |
+
"Cl": 20,
|
| 210 |
+
"-": 21,
|
| 211 |
+
"o": 22,
|
| 212 |
+
"s": 23,
|
| 213 |
+
"[nH]": 24,
|
| 214 |
+
"#": 25,
|
| 215 |
+
"/": 26,
|
| 216 |
+
"Br": 27,
|
| 217 |
+
"[C@]": 28,
|
| 218 |
+
"[C@@]": 29,
|
| 219 |
+
"[N+]": 30,
|
| 220 |
+
"[O-]": 31,
|
| 221 |
+
"5": 32,
|
| 222 |
+
"\\": 33,
|
| 223 |
+
".": 34,
|
| 224 |
+
"I": 35,
|
| 225 |
+
"6": 36,
|
| 226 |
+
"[S@]": 37,
|
| 227 |
+
"[S@@]": 38,
|
| 228 |
+
"P": 39,
|
| 229 |
+
"[N-]": 40,
|
| 230 |
+
"[Si]": 41,
|
| 231 |
+
"7": 42,
|
| 232 |
+
"[n+]": 43,
|
| 233 |
+
"[2H]": 44,
|
| 234 |
+
"8": 45,
|
| 235 |
+
"[NH+]": 46,
|
| 236 |
+
"B": 47,
|
| 237 |
+
"9": 48,
|
| 238 |
+
"[C-]": 49,
|
| 239 |
+
"[Na+]": 50,
|
| 240 |
+
"[Cl-]": 51,
|
| 241 |
+
"[c-]": 52,
|
| 242 |
+
"[CH]": 53,
|
| 243 |
+
"%10": 54,
|
| 244 |
+
"[NH2+]": 55,
|
| 245 |
+
"[P+]": 56,
|
| 246 |
+
"[B]": 57,
|
| 247 |
+
"[I-]": 58,
|
| 248 |
+
"%11": 59,
|
| 249 |
+
"[CH2-]": 60,
|
| 250 |
+
"[O+]": 61,
|
| 251 |
+
"[NH3+]": 62,
|
| 252 |
+
"[C]": 63,
|
| 253 |
+
"[Br-]": 64,
|
| 254 |
+
"[IH2]": 65,
|
| 255 |
+
"[S-]": 66,
|
| 256 |
+
"[cH-]": 67,
|
| 257 |
+
"%12": 68,
|
| 258 |
+
"[nH+]": 69,
|
| 259 |
+
"[B-]": 70,
|
| 260 |
+
"[K+]": 71,
|
| 261 |
+
"[Sn]": 72,
|
| 262 |
+
"[Se]": 73,
|
| 263 |
+
"[CH-]": 74,
|
| 264 |
+
"[HH]": 75,
|
| 265 |
+
"[Y]": 76,
|
| 266 |
+
"[n-]": 77,
|
| 267 |
+
"[CH3-]": 78,
|
| 268 |
+
"[SiH]": 79,
|
| 269 |
+
"[S+]": 80,
|
| 270 |
+
"%13": 81,
|
| 271 |
+
"[SiH2]": 82,
|
| 272 |
+
"[Li+]": 83,
|
| 273 |
+
"[NH-]": 84,
|
| 274 |
+
"%14": 85,
|
| 275 |
+
"[Na]": 86,
|
| 276 |
+
"[CH2]": 87,
|
| 277 |
+
"[O-2]": 88,
|
| 278 |
+
"[U+2]": 89,
|
| 279 |
+
"[W]": 90,
|
| 280 |
+
"[Al]": 91,
|
| 281 |
+
"[P@]": 92,
|
| 282 |
+
"[Fe+2]": 93,
|
| 283 |
+
"[PH+]": 94,
|
| 284 |
+
"%15": 95,
|
| 285 |
+
"[Cl+3]": 96,
|
| 286 |
+
"[Zn+2]": 97,
|
| 287 |
+
"[Ir]": 98,
|
| 288 |
+
"[Mg+2]": 99,
|
| 289 |
+
"[Pt+2]": 100,
|
| 290 |
+
"[OH2+]": 101,
|
| 291 |
+
"[As]": 102,
|
| 292 |
+
"[Fe]": 103,
|
| 293 |
+
"[OH+]": 104,
|
| 294 |
+
"[Zr+2]": 105,
|
| 295 |
+
"[3H]": 106,
|
| 296 |
+
"[Ge]": 107,
|
| 297 |
+
"[SiH3]": 108,
|
| 298 |
+
"[OH-]": 109,
|
| 299 |
+
"[NH4+]": 110,
|
| 300 |
+
"[Cu+2]": 111,
|
| 301 |
+
"[P@@]": 112,
|
| 302 |
+
"p": 113,
|
| 303 |
+
"[Pt]": 114,
|
| 304 |
+
"%16": 115,
|
| 305 |
+
"[Ca+2]": 116,
|
| 306 |
+
"[Zr]": 117,
|
| 307 |
+
"[F-]": 118,
|
| 308 |
+
"[C+]": 119,
|
| 309 |
+
"[Ti]": 120,
|
| 310 |
+
"[P-]": 121,
|
| 311 |
+
"[V]": 122,
|
| 312 |
+
"[se]": 123,
|
| 313 |
+
"[U]": 124,
|
| 314 |
+
"[O]": 125,
|
| 315 |
+
"[Ni+2]": 126,
|
| 316 |
+
"[Zn]": 127,
|
| 317 |
+
"[Co]": 128,
|
| 318 |
+
"[Ni]": 129,
|
| 319 |
+
"[Pd+2]": 130,
|
| 320 |
+
"[Cu]": 131,
|
| 321 |
+
"%17": 132,
|
| 322 |
+
"[Cu+]": 133,
|
| 323 |
+
"[Te]": 134,
|
| 324 |
+
"[H+]": 135,
|
| 325 |
+
"[CH+]": 136,
|
| 326 |
+
"[Li]": 137,
|
| 327 |
+
"[Pd]": 138,
|
| 328 |
+
"[Mo]": 139,
|
| 329 |
+
"[Ru+2]": 140,
|
| 330 |
+
"[o+]": 141,
|
| 331 |
+
"[Re]": 142,
|
| 332 |
+
"[SH+]": 143,
|
| 333 |
+
"%18": 144,
|
| 334 |
+
"[Ac]": 145,
|
| 335 |
+
"[Cr]": 146,
|
| 336 |
+
"[NH2-]": 147,
|
| 337 |
+
"[K]": 148,
|
| 338 |
+
"[13CH2]": 149,
|
| 339 |
+
"[c]": 150,
|
| 340 |
+
"[Zr+4]": 151,
|
| 341 |
+
"[Tl]": 152,
|
| 342 |
+
"[13C]": 153,
|
| 343 |
+
"[Mn]": 154,
|
| 344 |
+
"[N@+]": 155,
|
| 345 |
+
"[Hg]": 156,
|
| 346 |
+
"[Rh]": 157,
|
| 347 |
+
"[Ti+4]": 158,
|
| 348 |
+
"[Sb]": 159,
|
| 349 |
+
"[Co+2]": 160,
|
| 350 |
+
"[Ag+]": 161,
|
| 351 |
+
"[Ru]": 162,
|
| 352 |
+
"%19": 163,
|
| 353 |
+
"[N@@+]": 164,
|
| 354 |
+
"[Ti+2]": 165,
|
| 355 |
+
"[Al+3]": 166,
|
| 356 |
+
"[Pb]": 167,
|
| 357 |
+
"[I+]": 168,
|
| 358 |
+
"[18F]": 169,
|
| 359 |
+
"[s+]": 170,
|
| 360 |
+
"[Rb+]": 171,
|
| 361 |
+
"[Ba+2]": 172,
|
| 362 |
+
"[H-]": 173,
|
| 363 |
+
"[Fe+3]": 174,
|
| 364 |
+
"[Ir+3]": 175,
|
| 365 |
+
"[13cH]": 176,
|
| 366 |
+
"%20": 177,
|
| 367 |
+
"[AlH2]": 178,
|
| 368 |
+
"[Au+]": 179,
|
| 369 |
+
"[13c]": 180,
|
| 370 |
+
"[SH2+]": 181,
|
| 371 |
+
"[Sn+2]": 182,
|
| 372 |
+
"[Mn+2]": 183,
|
| 373 |
+
"[Si-]": 184,
|
| 374 |
+
"[Ag]": 185,
|
| 375 |
+
"[N]": 186,
|
| 376 |
+
"[Bi]": 187,
|
| 377 |
+
"%21": 188,
|
| 378 |
+
"[In]": 189,
|
| 379 |
+
"[CH2+]": 190,
|
| 380 |
+
"[Y+3]": 191,
|
| 381 |
+
"[Ga]": 192,
|
| 382 |
+
"%22": 193,
|
| 383 |
+
"[Co+3]": 194,
|
| 384 |
+
"[Au]": 195,
|
| 385 |
+
"[13CH3]": 196,
|
| 386 |
+
"[Mg]": 197,
|
| 387 |
+
"[Cs+]": 198,
|
| 388 |
+
"[W+2]": 199,
|
| 389 |
+
"[Hf]": 200,
|
| 390 |
+
"[Zn+]": 201,
|
| 391 |
+
"[Se-]": 202,
|
| 392 |
+
"[S-2]": 203,
|
| 393 |
+
"[Ca]": 204,
|
| 394 |
+
"[pH]": 205,
|
| 395 |
+
"[ClH+]": 206,
|
| 396 |
+
"[Ti+3]": 207,
|
| 397 |
+
"%23": 208,
|
| 398 |
+
"[Ru+]": 209,
|
| 399 |
+
"[SH-]": 210,
|
| 400 |
+
"[13CH]": 211,
|
| 401 |
+
"[IH+]": 212,
|
| 402 |
+
"[Hf+4]": 213,
|
| 403 |
+
"[Rf]": 214,
|
| 404 |
+
"[OH3+]": 215,
|
| 405 |
+
"%24": 216,
|
| 406 |
+
"[Pt+4]": 217,
|
| 407 |
+
"[Zr+3]": 218,
|
| 408 |
+
"[PH3+]": 219,
|
| 409 |
+
"[Sr+2]": 220,
|
| 410 |
+
"[Cd+2]": 221,
|
| 411 |
+
"[Cd]": 222,
|
| 412 |
+
"%25": 223,
|
| 413 |
+
"[Os]": 224,
|
| 414 |
+
"[BH-]": 225,
|
| 415 |
+
"[Sn+4]": 226,
|
| 416 |
+
"[Cr+3]": 227,
|
| 417 |
+
"[Ru+3]": 228,
|
| 418 |
+
"[PH2+]": 229,
|
| 419 |
+
"[Rh+2]": 230,
|
| 420 |
+
"[V+2]": 231,
|
| 421 |
+
"%26": 232,
|
| 422 |
+
"[Gd+3]": 233,
|
| 423 |
+
"[Pb+2]": 234,
|
| 424 |
+
"[PH]": 235,
|
| 425 |
+
"[Hg+]": 236,
|
| 426 |
+
"[Mo+2]": 237,
|
| 427 |
+
"[AlH]": 238,
|
| 428 |
+
"[Sn+]": 239,
|
| 429 |
+
"%27": 240,
|
| 430 |
+
"[Pd+]": 241,
|
| 431 |
+
"b": 242,
|
| 432 |
+
"[Rh+3]": 243,
|
| 433 |
+
"[Hg+2]": 244,
|
| 434 |
+
"[15NH]": 245,
|
| 435 |
+
"[14C]": 246,
|
| 436 |
+
"%28": 247,
|
| 437 |
+
"[Mn+3]": 248,
|
| 438 |
+
"[Si+]": 249,
|
| 439 |
+
"[SeH]": 250,
|
| 440 |
+
"[13C@H]": 251,
|
| 441 |
+
"[NH]": 252,
|
| 442 |
+
"[Ga+3]": 253,
|
| 443 |
+
"[SiH-]": 254,
|
| 444 |
+
"[13C@@H]": 255,
|
| 445 |
+
"[Ce]": 256,
|
| 446 |
+
"[Au+3]": 257,
|
| 447 |
+
"[Bi+3]": 258,
|
| 448 |
+
"[15N]": 259,
|
| 449 |
+
"%29": 260,
|
| 450 |
+
"[BH3-]": 261,
|
| 451 |
+
"[14cH]": 262,
|
| 452 |
+
"[Ti+]": 263,
|
| 453 |
+
"[Gd]": 264,
|
| 454 |
+
"[cH+]": 265,
|
| 455 |
+
"[Cr+2]": 266,
|
| 456 |
+
"[Sb-]": 267,
|
| 457 |
+
"%30": 268,
|
| 458 |
+
"[Be+2]": 269,
|
| 459 |
+
"[Al+]": 270,
|
| 460 |
+
"[te]": 271,
|
| 461 |
+
"[11CH3]": 272,
|
| 462 |
+
"[Sm]": 273,
|
| 463 |
+
"[Pr]": 274,
|
| 464 |
+
"[La]": 275,
|
| 465 |
+
"%31": 276,
|
| 466 |
+
"[Al-]": 277,
|
| 467 |
+
"[Ta]": 278,
|
| 468 |
+
"[125I]": 279,
|
| 469 |
+
"[BH2-]": 280,
|
| 470 |
+
"[Nb]": 281,
|
| 471 |
+
"[Si@]": 282,
|
| 472 |
+
"%32": 283,
|
| 473 |
+
"[14c]": 284,
|
| 474 |
+
"[Sb+3]": 285,
|
| 475 |
+
"[Ba]": 286,
|
| 476 |
+
"%33": 287,
|
| 477 |
+
"[Os+2]": 288,
|
| 478 |
+
"[Si@@]": 289,
|
| 479 |
+
"[La+3]": 290,
|
| 480 |
+
"[15n]": 291,
|
| 481 |
+
"[15NH2]": 292,
|
| 482 |
+
"[Nd+3]": 293,
|
| 483 |
+
"%34": 294,
|
| 484 |
+
"[14CH2]": 295,
|
| 485 |
+
"[18O]": 296,
|
| 486 |
+
"[Nd]": 297,
|
| 487 |
+
"[GeH]": 298,
|
| 488 |
+
"[Ni+3]": 299,
|
| 489 |
+
"[Eu]": 300,
|
| 490 |
+
"[Dy+3]": 301,
|
| 491 |
+
"[Sc]": 302,
|
| 492 |
+
"%36": 303,
|
| 493 |
+
"[Se-2]": 304,
|
| 494 |
+
"[As+]": 305,
|
| 495 |
+
"%35": 306,
|
| 496 |
+
"[AsH]": 307,
|
| 497 |
+
"[Tb]": 308,
|
| 498 |
+
"[Sb+5]": 309,
|
| 499 |
+
"[Se+]": 310,
|
| 500 |
+
"[Ce+3]": 311,
|
| 501 |
+
"[c+]": 312,
|
| 502 |
+
"[In+3]": 313,
|
| 503 |
+
"[SnH]": 314,
|
| 504 |
+
"[Mo+4]": 315,
|
| 505 |
+
"%37": 316,
|
| 506 |
+
"[V+4]": 317,
|
| 507 |
+
"[Eu+3]": 318,
|
| 508 |
+
"[Hf+2]": 319,
|
| 509 |
+
"%38": 320,
|
| 510 |
+
"[Pt+]": 321,
|
| 511 |
+
"[p+]": 322,
|
| 512 |
+
"[123I]": 323,
|
| 513 |
+
"[Tl+]": 324,
|
| 514 |
+
"[Sm+3]": 325,
|
| 515 |
+
"%39": 326,
|
| 516 |
+
"[Yb+3]": 327,
|
| 517 |
+
"%40": 328,
|
| 518 |
+
"[Yb]": 329,
|
| 519 |
+
"[Os+]": 330,
|
| 520 |
+
"%41": 331,
|
| 521 |
+
"[10B]": 332,
|
| 522 |
+
"[Sc+3]": 333,
|
| 523 |
+
"[Al+2]": 334,
|
| 524 |
+
"%42": 335,
|
| 525 |
+
"[Sr]": 336,
|
| 526 |
+
"[Tb+3]": 337,
|
| 527 |
+
"[Po]": 338,
|
| 528 |
+
"[Tc]": 339,
|
| 529 |
+
"[PH-]": 340,
|
| 530 |
+
"[AlH3]": 341,
|
| 531 |
+
"[Ar]": 342,
|
| 532 |
+
"[U+4]": 343,
|
| 533 |
+
"[SnH2]": 344,
|
| 534 |
+
"[Cl+2]": 345,
|
| 535 |
+
"[si]": 346,
|
| 536 |
+
"[Fe+]": 347,
|
| 537 |
+
"[14CH3]": 348,
|
| 538 |
+
"[U+3]": 349,
|
| 539 |
+
"[Cl+]": 350,
|
| 540 |
+
"%43": 351,
|
| 541 |
+
"[GeH2]": 352,
|
| 542 |
+
"%44": 353,
|
| 543 |
+
"[Er+3]": 354,
|
| 544 |
+
"[Mo+3]": 355,
|
| 545 |
+
"[I+2]": 356,
|
| 546 |
+
"[Fe+4]": 357,
|
| 547 |
+
"[99Tc]": 358,
|
| 548 |
+
"%45": 359,
|
| 549 |
+
"[11C]": 360,
|
| 550 |
+
"%46": 361,
|
| 551 |
+
"[SnH3]": 362,
|
| 552 |
+
"[S]": 363,
|
| 553 |
+
"[Te+]": 364,
|
| 554 |
+
"[Er]": 365,
|
| 555 |
+
"[Lu+3]": 366,
|
| 556 |
+
"[11B]": 367,
|
| 557 |
+
"%47": 368,
|
| 558 |
+
"%48": 369,
|
| 559 |
+
"[P]": 370,
|
| 560 |
+
"[Tm]": 371,
|
| 561 |
+
"[Th]": 372,
|
| 562 |
+
"[Dy]": 373,
|
| 563 |
+
"[Pr+3]": 374,
|
| 564 |
+
"[Ta+5]": 375,
|
| 565 |
+
"[Nb+5]": 376,
|
| 566 |
+
"[Rb]": 377,
|
| 567 |
+
"[GeH3]": 378,
|
| 568 |
+
"[Br+2]": 379,
|
| 569 |
+
"%49": 380,
|
| 570 |
+
"[131I]": 381,
|
| 571 |
+
"[Fm]": 382,
|
| 572 |
+
"[Cs]": 383,
|
| 573 |
+
"[BH4-]": 384,
|
| 574 |
+
"[Lu]": 385,
|
| 575 |
+
"[15nH]": 386,
|
| 576 |
+
"%50": 387,
|
| 577 |
+
"[Ru+6]": 388,
|
| 578 |
+
"[b-]": 389,
|
| 579 |
+
"[Ho]": 390,
|
| 580 |
+
"[Th+4]": 391,
|
| 581 |
+
"[Ru+4]": 392,
|
| 582 |
+
"%52": 393,
|
| 583 |
+
"[14CH]": 394,
|
| 584 |
+
"%51": 395,
|
| 585 |
+
"[Cr+6]": 396,
|
| 586 |
+
"[18OH]": 397,
|
| 587 |
+
"[Ho+3]": 398,
|
| 588 |
+
"[Ce+4]": 399,
|
| 589 |
+
"[Bi+2]": 400,
|
| 590 |
+
"[Co+]": 401,
|
| 591 |
+
"%53": 402,
|
| 592 |
+
"[Yb+2]": 403,
|
| 593 |
+
"[Fe+6]": 404,
|
| 594 |
+
"[Be]": 405,
|
| 595 |
+
"%54": 406,
|
| 596 |
+
"[SH3+]": 407,
|
| 597 |
+
"[Np]": 408,
|
| 598 |
+
"[As-]": 409,
|
| 599 |
+
"%55": 410,
|
| 600 |
+
"[14C@@H]": 411,
|
| 601 |
+
"[Ir+2]": 412,
|
| 602 |
+
"[GaH3]": 413,
|
| 603 |
+
"[p-]": 414,
|
| 604 |
+
"[GeH4]": 415,
|
| 605 |
+
"[Sn+3]": 416,
|
| 606 |
+
"[Os+4]": 417,
|
| 607 |
+
"%56": 418,
|
| 608 |
+
"[14C@H]": 419,
|
| 609 |
+
"[sH+]": 420,
|
| 610 |
+
"[19F]": 421,
|
| 611 |
+
"[Eu+2]": 422,
|
| 612 |
+
"[TlH]": 423,
|
| 613 |
+
"%57": 424,
|
| 614 |
+
"[Cr+4]": 425,
|
| 615 |
+
"%58": 426,
|
| 616 |
+
"[B@@-]": 427,
|
| 617 |
+
"[SiH+]": 428,
|
| 618 |
+
"[At]": 429,
|
| 619 |
+
"[Am]": 430,
|
| 620 |
+
"[Fe+5]": 431,
|
| 621 |
+
"[AsH2]": 432,
|
| 622 |
+
"[Si+4]": 433,
|
| 623 |
+
"[B@-]": 434,
|
| 624 |
+
"[Pu]": 435,
|
| 625 |
+
"[SbH]": 436,
|
| 626 |
+
"[P-2]": 437,
|
| 627 |
+
"[Tm+3]": 438,
|
| 628 |
+
"*": 439,
|
| 629 |
+
"%59": 440,
|
| 630 |
+
"[se+]": 441,
|
| 631 |
+
"%60": 442,
|
| 632 |
+
"[oH+]": 443,
|
| 633 |
+
"[1H]": 444,
|
| 634 |
+
"[15N+]": 445,
|
| 635 |
+
"[124I]": 446,
|
| 636 |
+
"[S@@+]": 447,
|
| 637 |
+
"[P-3]": 448,
|
| 638 |
+
"[H]": 449,
|
| 639 |
+
"[IH2+]": 450,
|
| 640 |
+
"[TeH]": 451,
|
| 641 |
+
"[Xe]": 452,
|
| 642 |
+
"[PH4+]": 453,
|
| 643 |
+
"[Cr+]": 454,
|
| 644 |
+
"[Cm]": 455,
|
| 645 |
+
"[I+3]": 456,
|
| 646 |
+
"%61": 457,
|
| 647 |
+
"[Nb+2]": 458,
|
| 648 |
+
"[Ru+5]": 459,
|
| 649 |
+
"%62": 460,
|
| 650 |
+
"[Ta+2]": 461,
|
| 651 |
+
"[Tc+4]": 462,
|
| 652 |
+
"[CH3+]": 463,
|
| 653 |
+
"[Pm]": 464,
|
| 654 |
+
"[Si@H]": 465,
|
| 655 |
+
"[No]": 466,
|
| 656 |
+
"%63": 467,
|
| 657 |
+
"[Cr+5]": 468,
|
| 658 |
+
"[Th+2]": 469,
|
| 659 |
+
"[Zn-2]": 470,
|
| 660 |
+
"[13C@]": 471,
|
| 661 |
+
"[Lr]": 472,
|
| 662 |
+
"%64": 473,
|
| 663 |
+
"[99Tc+3]": 474,
|
| 664 |
+
"%65": 475,
|
| 665 |
+
"[13C@@]": 476,
|
| 666 |
+
"%66": 477,
|
| 667 |
+
"[Fe-]": 478,
|
| 668 |
+
"[17O]": 479,
|
| 669 |
+
"[siH]": 480,
|
| 670 |
+
"[Sb+]": 481,
|
| 671 |
+
"[OH]": 482,
|
| 672 |
+
"[IH]": 483,
|
| 673 |
+
"[11CH2]": 484,
|
| 674 |
+
"[Cf]": 485,
|
| 675 |
+
"[SiH2+]": 486,
|
| 676 |
+
"[Gd+2]": 487,
|
| 677 |
+
"[In+]": 488,
|
| 678 |
+
"[Si@@H]": 489,
|
| 679 |
+
"[Mn+]": 490,
|
| 680 |
+
"[99Tc+4]": 491,
|
| 681 |
+
"[Ga-]": 492,
|
| 682 |
+
"%67": 493,
|
| 683 |
+
"[S@+]": 494,
|
| 684 |
+
"[Ge+4]": 495,
|
| 685 |
+
"[Tl+3]": 496,
|
| 686 |
+
"[16OH]": 497,
|
| 687 |
+
"%68": 498,
|
| 688 |
+
"[2H-]": 499,
|
| 689 |
+
"[Ra]": 500,
|
| 690 |
+
"[si-]": 501,
|
| 691 |
+
"[NiH2]": 502,
|
| 692 |
+
"[P@@H]": 503,
|
| 693 |
+
"[Rh+]": 504,
|
| 694 |
+
"[12C]": 505,
|
| 695 |
+
"[35S]": 506,
|
| 696 |
+
"[32P]": 507,
|
| 697 |
+
"[SiH2-]": 508,
|
| 698 |
+
"[AlH2+]": 509,
|
| 699 |
+
"[16O]": 510,
|
| 700 |
+
"%69": 511,
|
| 701 |
+
"[BiH]": 512,
|
| 702 |
+
"[BiH2]": 513,
|
| 703 |
+
"[Zn-]": 514,
|
| 704 |
+
"[BH]": 515,
|
| 705 |
+
"[Tc+3]": 516,
|
| 706 |
+
"[Ir+]": 517,
|
| 707 |
+
"[Ni+]": 518,
|
| 708 |
+
"%70": 519,
|
| 709 |
+
"[InH2]": 520,
|
| 710 |
+
"[InH]": 521,
|
| 711 |
+
"[Nb+3]": 522,
|
| 712 |
+
"[PbH]": 523,
|
| 713 |
+
"[Bi+]": 524,
|
| 714 |
+
"%71": 525,
|
| 715 |
+
"[As+3]": 526,
|
| 716 |
+
"%72": 527,
|
| 717 |
+
"[18O-]": 528,
|
| 718 |
+
"[68Ga+3]": 529,
|
| 719 |
+
"%73": 530,
|
| 720 |
+
"[Pa]": 531,
|
| 721 |
+
"[76Br]": 532,
|
| 722 |
+
"[Tc+5]": 533,
|
| 723 |
+
"[pH+]": 534,
|
| 724 |
+
"[64Cu+2]": 535,
|
| 725 |
+
"[Ru+8]": 536,
|
| 726 |
+
"%74": 537,
|
| 727 |
+
"[PH2-]": 538,
|
| 728 |
+
"[Si+2]": 539,
|
| 729 |
+
"[17OH]": 540,
|
| 730 |
+
"[RuH]": 541,
|
| 731 |
+
"[111In+3]": 542,
|
| 732 |
+
"[AlH+]": 543,
|
| 733 |
+
"%75": 544,
|
| 734 |
+
"%76": 545,
|
| 735 |
+
"[W+]": 546,
|
| 736 |
+
"[SbH2]": 547,
|
| 737 |
+
"[PoH]": 548,
|
| 738 |
+
"[Ru-]": 549,
|
| 739 |
+
"[XeH]": 550,
|
| 740 |
+
"[Tc+2]": 551,
|
| 741 |
+
"[13C-]": 552,
|
| 742 |
+
"[Br+]": 553,
|
| 743 |
+
"[Pt-2]": 554,
|
| 744 |
+
"[Es]": 555,
|
| 745 |
+
"[Cu-]": 556,
|
| 746 |
+
"[Mg+]": 557,
|
| 747 |
+
"[3HH]": 558,
|
| 748 |
+
"[P@H]": 559,
|
| 749 |
+
"[ClH2+]": 560,
|
| 750 |
+
"%77": 561,
|
| 751 |
+
"[SH]": 562,
|
| 752 |
+
"[Au-]": 563,
|
| 753 |
+
"[2HH]": 564,
|
| 754 |
+
"%78": 565,
|
| 755 |
+
"[Sn-]": 566,
|
| 756 |
+
"[11CH]": 567,
|
| 757 |
+
"[PdH2]": 568,
|
| 758 |
+
"0": 569,
|
| 759 |
+
"[Os+6]": 570,
|
| 760 |
+
"%79": 571,
|
| 761 |
+
"[Mo+]": 572,
|
| 762 |
+
"%80": 573,
|
| 763 |
+
"[al]": 574,
|
| 764 |
+
"[PbH2]": 575,
|
| 765 |
+
"[64Cu]": 576,
|
| 766 |
+
"[Cl]": 577,
|
| 767 |
+
"[12CH3]": 578,
|
| 768 |
+
"%81": 579,
|
| 769 |
+
"[Tc+7]": 580,
|
| 770 |
+
"[11c]": 581,
|
| 771 |
+
"%82": 582,
|
| 772 |
+
"[Li-]": 583,
|
| 773 |
+
"[99Tc+5]": 584,
|
| 774 |
+
"[He]": 585,
|
| 775 |
+
"[12c]": 586,
|
| 776 |
+
"[Kr]": 587,
|
| 777 |
+
"[RuH+2]": 588,
|
| 778 |
+
"[35Cl]": 589,
|
| 779 |
+
"[Pd-2]": 590,
|
| 780 |
+
"[GaH2]": 591,
|
| 781 |
+
"[4H]": 592,
|
| 782 |
+
"[Sg]": 593,
|
| 783 |
+
"[Cu-2]": 594,
|
| 784 |
+
"[Br+3]": 595,
|
| 785 |
+
"%83": 596,
|
| 786 |
+
"[37Cl]": 597,
|
| 787 |
+
"[211At]": 598,
|
| 788 |
+
"[IrH+2]": 599,
|
| 789 |
+
"[Mt]": 600,
|
| 790 |
+
"[Ir-2]": 601,
|
| 791 |
+
"[In-]": 602,
|
| 792 |
+
"[12cH]": 603,
|
| 793 |
+
"[12CH2]": 604,
|
| 794 |
+
"[RuH2]": 605,
|
| 795 |
+
"[99Tc+7]": 606,
|
| 796 |
+
"%84": 607,
|
| 797 |
+
"[15n+]": 608,
|
| 798 |
+
"[ClH2+2]": 609,
|
| 799 |
+
"[16N]": 610,
|
| 800 |
+
"[111In]": 611,
|
| 801 |
+
"[Tc+]": 612,
|
| 802 |
+
"[Ru-2]": 613,
|
| 803 |
+
"[12CH]": 614,
|
| 804 |
+
"[si+]": 615,
|
| 805 |
+
"[Tc+6]": 616,
|
| 806 |
+
"%85": 617,
|
| 807 |
+
"%86": 618,
|
| 808 |
+
"[90Y]": 619,
|
| 809 |
+
"[Pd-]": 620,
|
| 810 |
+
"[188Re]": 621,
|
| 811 |
+
"[RuH+]": 622,
|
| 812 |
+
"[NiH]": 623,
|
| 813 |
+
"[SiH3-]": 624,
|
| 814 |
+
"[14n]": 625,
|
| 815 |
+
"[CH3]": 626,
|
| 816 |
+
"[14N]": 627,
|
| 817 |
+
"[10BH2]": 628,
|
| 818 |
+
"%88": 629,
|
| 819 |
+
"%89": 630,
|
| 820 |
+
"%90": 631,
|
| 821 |
+
"[34S]": 632,
|
| 822 |
+
"[77Br]": 633,
|
| 823 |
+
"[GaH]": 634,
|
| 824 |
+
"[Br]": 635,
|
| 825 |
+
"[Ge@]": 636,
|
| 826 |
+
"[B@@H-]": 637,
|
| 827 |
+
"[CuH]": 638,
|
| 828 |
+
"[SiH4]": 639,
|
| 829 |
+
"[3H-]": 640,
|
| 830 |
+
"%87": 641,
|
| 831 |
+
"%91": 642,
|
| 832 |
+
"%92": 643,
|
| 833 |
+
"[67Cu]": 644,
|
| 834 |
+
"[I]": 645,
|
| 835 |
+
"[177Lu]": 646,
|
| 836 |
+
"[ReH]": 647,
|
| 837 |
+
"[67Ga+3]": 648,
|
| 838 |
+
"[Db]": 649,
|
| 839 |
+
"[177Lu+3]": 650,
|
| 840 |
+
"[AlH2-]": 651,
|
| 841 |
+
"[Si+3]": 652,
|
| 842 |
+
"[Ti-2]": 653,
|
| 843 |
+
"[RuH+3]": 654,
|
| 844 |
+
"[al+]": 655,
|
| 845 |
+
"[68Ga]": 656,
|
| 846 |
+
"[2H+]": 657,
|
| 847 |
+
"[B@H-]": 658,
|
| 848 |
+
"[WH2]": 659,
|
| 849 |
+
"[OsH]": 660,
|
| 850 |
+
"[Ir-3]": 661,
|
| 851 |
+
"[AlH-]": 662,
|
| 852 |
+
"[Bk]": 663,
|
| 853 |
+
"[75Se]": 664,
|
| 854 |
+
"[14C@]": 665,
|
| 855 |
+
"[Pt-]": 666,
|
| 856 |
+
"[N@@H+]": 667,
|
| 857 |
+
"[Nb-]": 668,
|
| 858 |
+
"[13NH2]": 669,
|
| 859 |
+
"%93": 670,
|
| 860 |
+
"[186Re]": 671,
|
| 861 |
+
"[Tb+4]": 672,
|
| 862 |
+
"[PtH]": 673,
|
| 863 |
+
"[IrH2]": 674,
|
| 864 |
+
"[Hg-2]": 675,
|
| 865 |
+
"[AlH3-]": 676,
|
| 866 |
+
"[PdH+]": 677,
|
| 867 |
+
"[Md]": 678,
|
| 868 |
+
"[RhH+2]": 679,
|
| 869 |
+
"[11cH]": 680,
|
| 870 |
+
"[Co-2]": 681,
|
| 871 |
+
"[15N-]": 682,
|
| 872 |
+
"[ZrH2]": 683,
|
| 873 |
+
"%94": 684,
|
| 874 |
+
"[Hg-]": 685,
|
| 875 |
+
"[127I]": 686,
|
| 876 |
+
"[AsH2+]": 687,
|
| 877 |
+
"[MoH2]": 688,
|
| 878 |
+
"[Te+4]": 689,
|
| 879 |
+
"[14C@@]": 690,
|
| 880 |
+
"[As+5]": 691,
|
| 881 |
+
"[SnH+3]": 692,
|
| 882 |
+
"[Ge@@]": 693,
|
| 883 |
+
"[6Li+]": 694,
|
| 884 |
+
"[WH]": 695,
|
| 885 |
+
"[Ne]": 696,
|
| 886 |
+
"[14NH2]": 697,
|
| 887 |
+
"[14NH]": 698,
|
| 888 |
+
"[12C@@H]": 699,
|
| 889 |
+
"[Os+7]": 700,
|
| 890 |
+
"[RhH]": 701,
|
| 891 |
+
"[Al-3]": 702,
|
| 892 |
+
"[SnH+]": 703,
|
| 893 |
+
"[15NH3+]": 704,
|
| 894 |
+
"[Zr+]": 705,
|
| 895 |
+
"[197Hg+]": 706,
|
| 896 |
+
"%95": 707,
|
| 897 |
+
"%96": 708,
|
| 898 |
+
"[90Y+3]": 709,
|
| 899 |
+
"[Os-2]": 710,
|
| 900 |
+
"[98Tc+5]": 711,
|
| 901 |
+
"[15NH3]": 712,
|
| 902 |
+
"[bH-]": 713,
|
| 903 |
+
"[33P]": 714,
|
| 904 |
+
"[Zr-2]": 715,
|
| 905 |
+
"[15O]": 716,
|
| 906 |
+
"[Rh-]": 717,
|
| 907 |
+
"[PbH3]": 718,
|
| 908 |
+
"[PH2]": 719,
|
| 909 |
+
"[Ni-]": 720,
|
| 910 |
+
"[CuH+]": 721,
|
| 911 |
+
"%97": 722,
|
| 912 |
+
"%98": 723,
|
| 913 |
+
"%99": 724,
|
| 914 |
+
"[Os+5]": 725,
|
| 915 |
+
"[PtH+]": 726,
|
| 916 |
+
"[ReH4]": 727,
|
| 917 |
+
"[16NH]": 728,
|
| 918 |
+
"[82Br]": 729,
|
| 919 |
+
"[W-]": 730,
|
| 920 |
+
"[18F-]": 731,
|
| 921 |
+
"[15NH4+]": 732,
|
| 922 |
+
"[Se+4]": 733,
|
| 923 |
+
"[SeH-]": 734,
|
| 924 |
+
"[67Cu+2]": 735,
|
| 925 |
+
"[12C@H]": 736,
|
| 926 |
+
"[AsH3]": 737,
|
| 927 |
+
"[HgH]": 738,
|
| 928 |
+
"[10B-]": 739,
|
| 929 |
+
"[99Tc+6]": 740,
|
| 930 |
+
"[117Sn+4]": 741,
|
| 931 |
+
"[Te@]": 742,
|
| 932 |
+
"[P@+]": 743,
|
| 933 |
+
"[35SH]": 744,
|
| 934 |
+
"[SeH+]": 745,
|
| 935 |
+
"[Ni-2]": 746,
|
| 936 |
+
"[Al-2]": 747,
|
| 937 |
+
"[TeH2]": 748,
|
| 938 |
+
"[Bh]": 749,
|
| 939 |
+
"[99Tc+2]": 750,
|
| 940 |
+
"[Os+8]": 751,
|
| 941 |
+
"[PH-2]": 752,
|
| 942 |
+
"[7Li+]": 753,
|
| 943 |
+
"[14nH]": 754,
|
| 944 |
+
"[AlH+2]": 755,
|
| 945 |
+
"[18FH]": 756,
|
| 946 |
+
"[SnH4]": 757,
|
| 947 |
+
"[18O-2]": 758,
|
| 948 |
+
"[IrH]": 759,
|
| 949 |
+
"[13N]": 760,
|
| 950 |
+
"[Te@@]": 761,
|
| 951 |
+
"[Rh-3]": 762,
|
| 952 |
+
"[15NH+]": 763,
|
| 953 |
+
"[AsH3+]": 764,
|
| 954 |
+
"[SeH2]": 765,
|
| 955 |
+
"[AsH+]": 766,
|
| 956 |
+
"[CoH2]": 767,
|
| 957 |
+
"[16NH2]": 768,
|
| 958 |
+
"[AsH-]": 769,
|
| 959 |
+
"[203Hg+]": 770,
|
| 960 |
+
"[P@@+]": 771,
|
| 961 |
+
"[166Ho+3]": 772,
|
| 962 |
+
"[60Co+3]": 773,
|
| 963 |
+
"[13CH2-]": 774,
|
| 964 |
+
"[SeH2+]": 775,
|
| 965 |
+
"[75Br]": 776,
|
| 966 |
+
"[TlH2]": 777,
|
| 967 |
+
"[80Br]": 778,
|
| 968 |
+
"[siH+]": 779,
|
| 969 |
+
"[Ca+]": 780,
|
| 970 |
+
"[153Sm+3]": 781,
|
| 971 |
+
"[PdH]": 782,
|
| 972 |
+
"[225Ac]": 783,
|
| 973 |
+
"[13CH3-]": 784,
|
| 974 |
+
"[AlH4-]": 785,
|
| 975 |
+
"[FeH]": 786,
|
| 976 |
+
"[13CH-]": 787,
|
| 977 |
+
"[14C-]": 788,
|
| 978 |
+
"[11C-]": 789,
|
| 979 |
+
"[153Sm]": 790,
|
| 980 |
+
"[Re-]": 791,
|
| 981 |
+
"[te+]": 792,
|
| 982 |
+
"[13CH4]": 793,
|
| 983 |
+
"[ClH+2]": 794,
|
| 984 |
+
"[8CH2]": 795,
|
| 985 |
+
"[99Mo]": 796,
|
| 986 |
+
"[ClH3+3]": 797,
|
| 987 |
+
"[SbH3]": 798,
|
| 988 |
+
"[25Mg+2]": 799,
|
| 989 |
+
"[16N+]": 800,
|
| 990 |
+
"[SnH2+]": 801,
|
| 991 |
+
"[11C@H]": 802,
|
| 992 |
+
"[122I]": 803,
|
| 993 |
+
"[Re-2]": 804,
|
| 994 |
+
"[RuH2+2]": 805,
|
| 995 |
+
"[ZrH]": 806,
|
| 996 |
+
"[Bi-]": 807,
|
| 997 |
+
"[Pr+]": 808,
|
| 998 |
+
"[Rn]": 809,
|
| 999 |
+
"[Fr]": 810,
|
| 1000 |
+
"[36Cl]": 811,
|
| 1001 |
+
"[18o]": 812,
|
| 1002 |
+
"[YH]": 813,
|
| 1003 |
+
"[79Br]": 814,
|
| 1004 |
+
"[121I]": 815,
|
| 1005 |
+
"[113In+3]": 816,
|
| 1006 |
+
"[TaH]": 817,
|
| 1007 |
+
"[RhH2]": 818,
|
| 1008 |
+
"[Ta-]": 819,
|
| 1009 |
+
"[67Ga]": 820,
|
| 1010 |
+
"[ZnH+]": 821,
|
| 1011 |
+
"[SnH2-]": 822,
|
| 1012 |
+
"[OsH2]": 823,
|
| 1013 |
+
"[16F]": 824,
|
| 1014 |
+
"[FeH2]": 825,
|
| 1015 |
+
"[14O]": 826,
|
| 1016 |
+
"[PbH2+2]": 827,
|
| 1017 |
+
"[BH2]": 828,
|
| 1018 |
+
"[6H]": 829,
|
| 1019 |
+
"[125Te]": 830,
|
| 1020 |
+
"[197Hg]": 831,
|
| 1021 |
+
"[TaH2]": 832,
|
| 1022 |
+
"[TaH3]": 833,
|
| 1023 |
+
"[76As]": 834,
|
| 1024 |
+
"[Nb-2]": 835,
|
| 1025 |
+
"[14N+]": 836,
|
| 1026 |
+
"[125I-]": 837,
|
| 1027 |
+
"[33S]": 838,
|
| 1028 |
+
"[IH2+2]": 839,
|
| 1029 |
+
"[NH2]": 840,
|
| 1030 |
+
"[PtH2]": 841,
|
| 1031 |
+
"[MnH]": 842,
|
| 1032 |
+
"[19C]": 843,
|
| 1033 |
+
"[17F]": 844,
|
| 1034 |
+
"[1H-]": 845,
|
| 1035 |
+
"[SnH4+2]": 846,
|
| 1036 |
+
"[Mn-2]": 847,
|
| 1037 |
+
"[15NH2+]": 848,
|
| 1038 |
+
"[TiH2]": 849,
|
| 1039 |
+
"[ReH7]": 850,
|
| 1040 |
+
"[Cd-2]": 851,
|
| 1041 |
+
"[Fe-3]": 852,
|
| 1042 |
+
"[SH2]": 853,
|
| 1043 |
+
"[17O-]": 854,
|
| 1044 |
+
"[siH-]": 855,
|
| 1045 |
+
"[CoH+]": 856,
|
| 1046 |
+
"[VH]": 857,
|
| 1047 |
+
"[10BH]": 858,
|
| 1048 |
+
"[Ru-3]": 859,
|
| 1049 |
+
"[13O]": 860,
|
| 1050 |
+
"[5H]": 861,
|
| 1051 |
+
"[15n-]": 862,
|
| 1052 |
+
"[153Gd]": 863,
|
| 1053 |
+
"[12C@]": 864,
|
| 1054 |
+
"[11CH3-]": 865,
|
| 1055 |
+
"[IrH3]": 866,
|
| 1056 |
+
"[RuH3]": 867,
|
| 1057 |
+
"[74Se]": 868,
|
| 1058 |
+
"[Se@]": 869,
|
| 1059 |
+
"[Hf+]": 870,
|
| 1060 |
+
"[77Se]": 871,
|
| 1061 |
+
"[166Ho]": 872,
|
| 1062 |
+
"[59Fe+2]": 873,
|
| 1063 |
+
"[203Hg]": 874,
|
| 1064 |
+
"[18OH-]": 875,
|
| 1065 |
+
"[8CH]": 876,
|
| 1066 |
+
"[12C@@]": 877,
|
| 1067 |
+
"[11CH4]": 878,
|
| 1068 |
+
"[15C]": 879,
|
| 1069 |
+
"[249Cf]": 880,
|
| 1070 |
+
"[PbH4]": 881,
|
| 1071 |
+
"[64Zn]": 882,
|
| 1072 |
+
"[99Tc+]": 883,
|
| 1073 |
+
"[14c-]": 884,
|
| 1074 |
+
"[149Pm]": 885,
|
| 1075 |
+
"[IrH4]": 886,
|
| 1076 |
+
"[Se@@]": 887,
|
| 1077 |
+
"[13OH]": 888,
|
| 1078 |
+
"[14CH3-]": 889,
|
| 1079 |
+
"[28Si]": 890,
|
| 1080 |
+
"[Rh-2]": 891,
|
| 1081 |
+
"[Fe-2]": 892,
|
| 1082 |
+
"[131I-]": 893,
|
| 1083 |
+
"[51Cr]": 894,
|
| 1084 |
+
"[62Cu+2]": 895,
|
| 1085 |
+
"[81Br]": 896,
|
| 1086 |
+
"[121Sb]": 897,
|
| 1087 |
+
"[7Li]": 898,
|
| 1088 |
+
"[89Zr+4]": 899,
|
| 1089 |
+
"[SbH3+]": 900,
|
| 1090 |
+
"[11C@@H]": 901,
|
| 1091 |
+
"[98Tc]": 902,
|
| 1092 |
+
"[59Fe+3]": 903,
|
| 1093 |
+
"[BiH2+]": 904,
|
| 1094 |
+
"[SbH+]": 905,
|
| 1095 |
+
"[TiH]": 906,
|
| 1096 |
+
"[14NH3]": 907,
|
| 1097 |
+
"[15OH]": 908,
|
| 1098 |
+
"[119Sn]": 909,
|
| 1099 |
+
"[201Hg]": 910,
|
| 1100 |
+
"[MnH+]": 911,
|
| 1101 |
+
"[201Tl]": 912,
|
| 1102 |
+
"[51Cr+3]": 913,
|
| 1103 |
+
"[123I-]": 914,
|
| 1104 |
+
"[MoH]": 915,
|
| 1105 |
+
"[AlH6-3]": 916,
|
| 1106 |
+
"[MnH2]": 917,
|
| 1107 |
+
"[WH3]": 918,
|
| 1108 |
+
"[213Bi+3]": 919,
|
| 1109 |
+
"[SnH2+2]": 920,
|
| 1110 |
+
"[123IH]": 921,
|
| 1111 |
+
"[13CH+]": 922,
|
| 1112 |
+
"[Zr-]": 923,
|
| 1113 |
+
"[74As]": 924,
|
| 1114 |
+
"[13C+]": 925,
|
| 1115 |
+
"[32P+]": 926,
|
| 1116 |
+
"[KrH]": 927,
|
| 1117 |
+
"[SiH+2]": 928,
|
| 1118 |
+
"[ClH3+2]": 929,
|
| 1119 |
+
"[13NH]": 930,
|
| 1120 |
+
"[9CH2]": 931,
|
| 1121 |
+
"[ZrH2+2]": 932,
|
| 1122 |
+
"[87Sr+2]": 933,
|
| 1123 |
+
"[35s]": 934,
|
| 1124 |
+
"[239Pu]": 935,
|
| 1125 |
+
"[198Au]": 936,
|
| 1126 |
+
"[241Am]": 937,
|
| 1127 |
+
"[203Hg+2]": 938,
|
| 1128 |
+
"[V+]": 939,
|
| 1129 |
+
"[YH2]": 940,
|
| 1130 |
+
"[195Pt]": 941,
|
| 1131 |
+
"[203Pb]": 942,
|
| 1132 |
+
"[RuH4]": 943,
|
| 1133 |
+
"[ThH2]": 944,
|
| 1134 |
+
"[AuH]": 945,
|
| 1135 |
+
"[66Ga+3]": 946,
|
| 1136 |
+
"[11B-]": 947,
|
| 1137 |
+
"[F]": 948,
|
| 1138 |
+
"[24Na+]": 949,
|
| 1139 |
+
"[85Sr+2]": 950,
|
| 1140 |
+
"[201Tl+]": 951,
|
| 1141 |
+
"[14CH4]": 952,
|
| 1142 |
+
"[32S]": 953,
|
| 1143 |
+
"[TeH2+]": 954,
|
| 1144 |
+
"[ClH2+3]": 955,
|
| 1145 |
+
"[AgH]": 956,
|
| 1146 |
+
"[Ge@H]": 957,
|
| 1147 |
+
"[44Ca+2]": 958,
|
| 1148 |
+
"[Os-]": 959,
|
| 1149 |
+
"[31P]": 960,
|
| 1150 |
+
"[15nH+]": 961,
|
| 1151 |
+
"[SbH4]": 962,
|
| 1152 |
+
"[TiH+]": 963,
|
| 1153 |
+
"[Ba+]": 964,
|
| 1154 |
+
"[57Co+2]": 965,
|
| 1155 |
+
"[Ta+]": 966,
|
| 1156 |
+
"[125IH]": 967,
|
| 1157 |
+
"[77As]": 968,
|
| 1158 |
+
"[129I]": 969,
|
| 1159 |
+
"[Fe-4]": 970,
|
| 1160 |
+
"[Ta-2]": 971,
|
| 1161 |
+
"[19O]": 972,
|
| 1162 |
+
"[12O]": 973,
|
| 1163 |
+
"[BiH3]": 974,
|
| 1164 |
+
"[237Np]": 975,
|
| 1165 |
+
"[252Cf]": 976,
|
| 1166 |
+
"[86Y]": 977,
|
| 1167 |
+
"[Cr-2]": 978,
|
| 1168 |
+
"[89Y]": 979,
|
| 1169 |
+
"[195Pt+2]": 980,
|
| 1170 |
+
"[si+2]": 981,
|
| 1171 |
+
"[58Fe+2]": 982,
|
| 1172 |
+
"[Hs]": 983,
|
| 1173 |
+
"[S@@H]": 984,
|
| 1174 |
+
"[8CH4]": 985,
|
| 1175 |
+
"[164Dy+3]": 986,
|
| 1176 |
+
"[47Ca+2]": 987,
|
| 1177 |
+
"[57Co]": 988,
|
| 1178 |
+
"[NbH2]": 989,
|
| 1179 |
+
"[ReH2]": 990,
|
| 1180 |
+
"[ZnH2]": 991,
|
| 1181 |
+
"[CrH2]": 992,
|
| 1182 |
+
"[17NH]": 993,
|
| 1183 |
+
"[ZrH3]": 994,
|
| 1184 |
+
"[RhH3]": 995,
|
| 1185 |
+
"[12C-]": 996,
|
| 1186 |
+
"[18O+]": 997,
|
| 1187 |
+
"[Bi-2]": 998,
|
| 1188 |
+
"[ClH4+3]": 999,
|
| 1189 |
+
"[Ni-3]": 1000,
|
| 1190 |
+
"[Ag-]": 1001,
|
| 1191 |
+
"[111In-]": 1002,
|
| 1192 |
+
"[Mo-2]": 1003,
|
| 1193 |
+
"[55Fe+3]": 1004,
|
| 1194 |
+
"[204Hg+]": 1005,
|
| 1195 |
+
"[35Cl-]": 1006,
|
| 1196 |
+
"[211Pb]": 1007,
|
| 1197 |
+
"[75Ge]": 1008,
|
| 1198 |
+
"[8B]": 1009,
|
| 1199 |
+
"[TeH3]": 1010,
|
| 1200 |
+
"[SnH3+]": 1011,
|
| 1201 |
+
"[Zr-3]": 1012,
|
| 1202 |
+
"[28F]": 1013,
|
| 1203 |
+
"[249Bk]": 1014,
|
| 1204 |
+
"[169Yb]": 1015,
|
| 1205 |
+
"[34SH]": 1016,
|
| 1206 |
+
"[6Li]": 1017,
|
| 1207 |
+
"[94Tc]": 1018,
|
| 1208 |
+
"[197Au]": 1019,
|
| 1209 |
+
"[195Pt+4]": 1020,
|
| 1210 |
+
"[169Yb+3]": 1021,
|
| 1211 |
+
"[32Cl]": 1022,
|
| 1212 |
+
"[82Se]": 1023,
|
| 1213 |
+
"[159Gd+3]": 1024,
|
| 1214 |
+
"[213Bi]": 1025,
|
| 1215 |
+
"[CoH+2]": 1026,
|
| 1216 |
+
"[36S]": 1027,
|
| 1217 |
+
"[35P]": 1028,
|
| 1218 |
+
"[Ru-4]": 1029,
|
| 1219 |
+
"[Cr-3]": 1030,
|
| 1220 |
+
"[60Co]": 1031,
|
| 1221 |
+
"[1H+]": 1032,
|
| 1222 |
+
"[18CH2]": 1033,
|
| 1223 |
+
"[Cd-]": 1034,
|
| 1224 |
+
"[152Sm+3]": 1035,
|
| 1225 |
+
"[106Ru]": 1036,
|
| 1226 |
+
"[238Pu]": 1037,
|
| 1227 |
+
"[220Rn]": 1038,
|
| 1228 |
+
"[45Ca+2]": 1039,
|
| 1229 |
+
"[89Sr+2]": 1040,
|
| 1230 |
+
"[239Np]": 1041,
|
| 1231 |
+
"[90Sr+2]": 1042,
|
| 1232 |
+
"[137Cs+]": 1043,
|
| 1233 |
+
"[165Dy]": 1044,
|
| 1234 |
+
"[68GaH3]": 1045,
|
| 1235 |
+
"[65Zn+2]": 1046,
|
| 1236 |
+
"[89Zr]": 1047,
|
| 1237 |
+
"[BiH2+2]": 1048,
|
| 1238 |
+
"[62Cu]": 1049,
|
| 1239 |
+
"[165Dy+3]": 1050,
|
| 1240 |
+
"[238U]": 1051,
|
| 1241 |
+
"[105Rh+3]": 1052,
|
| 1242 |
+
"[70Zn]": 1053,
|
| 1243 |
+
"[12B]": 1054,
|
| 1244 |
+
"[12OH]": 1055,
|
| 1245 |
+
"[18CH]": 1056,
|
| 1246 |
+
"[17CH]": 1057,
|
| 1247 |
+
"[42K]": 1058,
|
| 1248 |
+
"[76Br-]": 1059,
|
| 1249 |
+
"[71As]": 1060,
|
| 1250 |
+
"[NbH3]": 1061,
|
| 1251 |
+
"[ReH3]": 1062,
|
| 1252 |
+
"[OsH-]": 1063,
|
| 1253 |
+
"[WH4]": 1064,
|
| 1254 |
+
"[MoH3]": 1065,
|
| 1255 |
+
"[OsH4]": 1066,
|
| 1256 |
+
"[RuH6]": 1067,
|
| 1257 |
+
"[PtH3]": 1068,
|
| 1258 |
+
"[CuH2]": 1069,
|
| 1259 |
+
"[CoH3]": 1070,
|
| 1260 |
+
"[TiH4]": 1071,
|
| 1261 |
+
"[64Zn+2]": 1072,
|
| 1262 |
+
"[Si-2]": 1073,
|
| 1263 |
+
"[79BrH]": 1074,
|
| 1264 |
+
"[14CH2-]": 1075,
|
| 1265 |
+
"[PtH2+2]": 1076,
|
| 1266 |
+
"[Os-3]": 1077,
|
| 1267 |
+
"[29Si]": 1078,
|
| 1268 |
+
"[Ti-]": 1079,
|
| 1269 |
+
"[Se+6]": 1080,
|
| 1270 |
+
"[22Na+]": 1081,
|
| 1271 |
+
"[42K+]": 1082,
|
| 1272 |
+
"[131Cs+]": 1083,
|
| 1273 |
+
"[86Rb+]": 1084,
|
| 1274 |
+
"[134Cs+]": 1085,
|
| 1275 |
+
"[209Po]": 1086,
|
| 1276 |
+
"[208Po]": 1087,
|
| 1277 |
+
"[81Rb+]": 1088,
|
| 1278 |
+
"[203Tl+]": 1089,
|
| 1279 |
+
"[Zr-4]": 1090,
|
| 1280 |
+
"[148Sm]": 1091,
|
| 1281 |
+
"[147Sm]": 1092,
|
| 1282 |
+
"[37Cl-]": 1093,
|
| 1283 |
+
"[12CH4]": 1094,
|
| 1284 |
+
"[Ge@@H]": 1095,
|
| 1285 |
+
"[63Cu]": 1096,
|
| 1286 |
+
"[13CH2+]": 1097,
|
| 1287 |
+
"[AsH2-]": 1098,
|
| 1288 |
+
"[CeH]": 1099,
|
| 1289 |
+
"[SnH-]": 1100,
|
| 1290 |
+
"[UH]": 1101,
|
| 1291 |
+
"[9c]": 1102,
|
| 1292 |
+
"[21CH3]": 1103,
|
| 1293 |
+
"[TeH+]": 1104,
|
| 1294 |
+
"[57Co+3]": 1105,
|
| 1295 |
+
"[8BH2]": 1106,
|
| 1296 |
+
"[12BH2]": 1107,
|
| 1297 |
+
"[19BH2]": 1108,
|
| 1298 |
+
"[9BH2]": 1109,
|
| 1299 |
+
"[YbH2]": 1110,
|
| 1300 |
+
"[CrH+2]": 1111,
|
| 1301 |
+
"[208Bi]": 1112,
|
| 1302 |
+
"[152Gd]": 1113,
|
| 1303 |
+
"[61Cu]": 1114,
|
| 1304 |
+
"[115In]": 1115,
|
| 1305 |
+
"[60Co+2]": 1116,
|
| 1306 |
+
"[13NH2-]": 1117,
|
| 1307 |
+
"[120I]": 1118,
|
| 1308 |
+
"[18OH2]": 1119,
|
| 1309 |
+
"[75SeH]": 1120,
|
| 1310 |
+
"[SbH2+]": 1121,
|
| 1311 |
+
"[144Ce]": 1122,
|
| 1312 |
+
"[16n]": 1123,
|
| 1313 |
+
"[113In]": 1124,
|
| 1314 |
+
"[22nH]": 1125,
|
| 1315 |
+
"[129I-]": 1126,
|
| 1316 |
+
"[InH3]": 1127,
|
| 1317 |
+
"[32PH3]": 1128,
|
| 1318 |
+
"[234U]": 1129,
|
| 1319 |
+
"[235U]": 1130,
|
| 1320 |
+
"[59Fe]": 1131,
|
| 1321 |
+
"[82Rb+]": 1132,
|
| 1322 |
+
"[65Zn]": 1133,
|
| 1323 |
+
"[244Cm]": 1134,
|
| 1324 |
+
"[147Pm]": 1135,
|
| 1325 |
+
"[91Y]": 1136,
|
| 1326 |
+
"[237Pu]": 1137,
|
| 1327 |
+
"[231Pa]": 1138,
|
| 1328 |
+
"[253Cf]": 1139,
|
| 1329 |
+
"[127Te]": 1140,
|
| 1330 |
+
"[187Re]": 1141,
|
| 1331 |
+
"[236Np]": 1142,
|
| 1332 |
+
"[235Np]": 1143,
|
| 1333 |
+
"[72Zn]": 1144,
|
| 1334 |
+
"[253Es]": 1145,
|
| 1335 |
+
"[159Dy]": 1146,
|
| 1336 |
+
"[62Zn]": 1147,
|
| 1337 |
+
"[101Tc]": 1148,
|
| 1338 |
+
"[149Tb]": 1149,
|
| 1339 |
+
"[124I-]": 1150,
|
| 1340 |
+
"[SeH3+]": 1151,
|
| 1341 |
+
"[210Pb]": 1152,
|
| 1342 |
+
"[40K]": 1153,
|
| 1343 |
+
"[210Po]": 1154,
|
| 1344 |
+
"[214Pb]": 1155,
|
| 1345 |
+
"[218Po]": 1156,
|
| 1346 |
+
"[214Po]": 1157,
|
| 1347 |
+
"[7Be]": 1158,
|
| 1348 |
+
"[212Pb]": 1159,
|
| 1349 |
+
"[205Pb]": 1160,
|
| 1350 |
+
"[209Pb]": 1161,
|
| 1351 |
+
"[123Te]": 1162,
|
| 1352 |
+
"[202Pb]": 1163,
|
| 1353 |
+
"[72As]": 1164,
|
| 1354 |
+
"[201Pb]": 1165,
|
| 1355 |
+
"[70As]": 1166,
|
| 1356 |
+
"[73Ge]": 1167,
|
| 1357 |
+
"[200Pb]": 1168,
|
| 1358 |
+
"[198Pb]": 1169,
|
| 1359 |
+
"[66Ga]": 1170,
|
| 1360 |
+
"[73Se]": 1171,
|
| 1361 |
+
"[195Pb]": 1172,
|
| 1362 |
+
"[199Pb]": 1173,
|
| 1363 |
+
"[144Ce+3]": 1174,
|
| 1364 |
+
"[235U+2]": 1175,
|
| 1365 |
+
"[90Tc]": 1176,
|
| 1366 |
+
"[114In+3]": 1177,
|
| 1367 |
+
"[128I]": 1178,
|
| 1368 |
+
"[100Tc+]": 1179,
|
| 1369 |
+
"[82Br-]": 1180,
|
| 1370 |
+
"[191Pt+2]": 1181,
|
| 1371 |
+
"[191Pt+4]": 1182,
|
| 1372 |
+
"[193Pt+4]": 1183,
|
| 1373 |
+
"[31PH3]": 1184,
|
| 1374 |
+
"[125I+2]": 1185,
|
| 1375 |
+
"[131I+2]": 1186,
|
| 1376 |
+
"[125Te+4]": 1187,
|
| 1377 |
+
"[82Sr+2]": 1188,
|
| 1378 |
+
"[149Sm]": 1189,
|
| 1379 |
+
"[81BrH]": 1190,
|
| 1380 |
+
"[129Xe]": 1191,
|
| 1381 |
+
"[193Pt+2]": 1192,
|
| 1382 |
+
"[123I+2]": 1193,
|
| 1383 |
+
"[Cr-]": 1194,
|
| 1384 |
+
"[Co-]": 1195,
|
| 1385 |
+
"[227Th+4]": 1196,
|
| 1386 |
+
"[249Cf+3]": 1197,
|
| 1387 |
+
"[252Cf+3]": 1198,
|
| 1388 |
+
"[187Os]": 1199,
|
| 1389 |
+
"[16O-]": 1200,
|
| 1390 |
+
"[17O+]": 1201,
|
| 1391 |
+
"[16OH-]": 1202,
|
| 1392 |
+
"[98Tc+7]": 1203,
|
| 1393 |
+
"[58Co+2]": 1204,
|
| 1394 |
+
"[69Ga+3]": 1205,
|
| 1395 |
+
"[57Fe+2]": 1206,
|
| 1396 |
+
"[43K+]": 1207,
|
| 1397 |
+
"[16C]": 1208,
|
| 1398 |
+
"[52Fe+3]": 1209,
|
| 1399 |
+
"[SeH5]": 1210,
|
| 1400 |
+
"[194Pb]": 1211,
|
| 1401 |
+
"[196Pb]": 1212,
|
| 1402 |
+
"[197Pb]": 1213,
|
| 1403 |
+
"[213Pb]": 1214,
|
| 1404 |
+
"[9B]": 1215,
|
| 1405 |
+
"[19B]": 1216,
|
| 1406 |
+
"[11CH-]": 1217,
|
| 1407 |
+
"[9CH]": 1218,
|
| 1408 |
+
"[20OH]": 1219,
|
| 1409 |
+
"[25OH]": 1220,
|
| 1410 |
+
"[8cH]": 1221,
|
| 1411 |
+
"[TiH+3]": 1222,
|
| 1412 |
+
"[SnH6+3]": 1223,
|
| 1413 |
+
"[N@H+]": 1224,
|
| 1414 |
+
"[52Mn+2]": 1225,
|
| 1415 |
+
"[64Ga]": 1226,
|
| 1416 |
+
"[13B]": 1227,
|
| 1417 |
+
"[216Bi]": 1228,
|
| 1418 |
+
"[117Sn+2]": 1229,
|
| 1419 |
+
"[232Th]": 1230,
|
| 1420 |
+
"[SnH+2]": 1231,
|
| 1421 |
+
"[BiH5]": 1232,
|
| 1422 |
+
"[77Kr]": 1233,
|
| 1423 |
+
"[103Cd]": 1234,
|
| 1424 |
+
"[62Ni]": 1235,
|
| 1425 |
+
"[LaH3]": 1236,
|
| 1426 |
+
"[SmH3]": 1237,
|
| 1427 |
+
"[EuH3]": 1238,
|
| 1428 |
+
"[MoH5]": 1239,
|
| 1429 |
+
"[64Ni]": 1240,
|
| 1430 |
+
"[66Zn]": 1241,
|
| 1431 |
+
"[68Zn]": 1242,
|
| 1432 |
+
"[186W]": 1243,
|
| 1433 |
+
"[FeH4]": 1244,
|
| 1434 |
+
"[MoH4]": 1245,
|
| 1435 |
+
"[HgH2]": 1246,
|
| 1436 |
+
"[15NH2-]": 1247,
|
| 1437 |
+
"[UH2]": 1248,
|
| 1438 |
+
"[204Hg]": 1249,
|
| 1439 |
+
"[GaH4-]": 1250,
|
| 1440 |
+
"[ThH4]": 1251,
|
| 1441 |
+
"[WH6]": 1252,
|
| 1442 |
+
"[PtH4]": 1253,
|
| 1443 |
+
"[VH2]": 1254,
|
| 1444 |
+
"[UH3]": 1255,
|
| 1445 |
+
"[FeH3]": 1256,
|
| 1446 |
+
"[RuH5]": 1257,
|
| 1447 |
+
"[BiH4]": 1258,
|
| 1448 |
+
"[80Br-]": 1259,
|
| 1449 |
+
"[CeH3]": 1260,
|
| 1450 |
+
"[37ClH]": 1261,
|
| 1451 |
+
"[157Gd+3]": 1262,
|
| 1452 |
+
"[205Tl]": 1263,
|
| 1453 |
+
"[203Tl]": 1264,
|
| 1454 |
+
"[62Cu+]": 1265,
|
| 1455 |
+
"[64Cu+]": 1266,
|
| 1456 |
+
"[61Cu+]": 1267,
|
| 1457 |
+
"[37SH2]": 1268,
|
| 1458 |
+
"[30Si]": 1269,
|
| 1459 |
+
"[28Al]": 1270,
|
| 1460 |
+
"[19OH2]": 1271,
|
| 1461 |
+
"[8He]": 1272,
|
| 1462 |
+
"[6He]": 1273,
|
| 1463 |
+
"[153Pm]": 1274,
|
| 1464 |
+
"[209Bi]": 1275,
|
| 1465 |
+
"[66Zn+2]": 1276,
|
| 1466 |
+
"[10CH4]": 1277,
|
| 1467 |
+
"[191Ir]": 1278,
|
| 1468 |
+
"[66Cu]": 1279,
|
| 1469 |
+
"[16O+]": 1280,
|
| 1470 |
+
"[25O]": 1281,
|
| 1471 |
+
"[10c]": 1282,
|
| 1472 |
+
"[Co-3]": 1283,
|
| 1473 |
+
"[Sn@@]": 1284,
|
| 1474 |
+
"[17OH-]": 1285,
|
| 1475 |
+
"[206Po]": 1286,
|
| 1476 |
+
"[204Po]": 1287,
|
| 1477 |
+
"[202Po]": 1288,
|
| 1478 |
+
"[201Po]": 1289,
|
| 1479 |
+
"[200Po]": 1290,
|
| 1480 |
+
"[199Po]": 1291,
|
| 1481 |
+
"[198Po]": 1292,
|
| 1482 |
+
"[197Po]": 1293,
|
| 1483 |
+
"[196Po]": 1294,
|
| 1484 |
+
"[195Po]": 1295,
|
| 1485 |
+
"[194Po]": 1296,
|
| 1486 |
+
"[193Po]": 1297,
|
| 1487 |
+
"[192Po]": 1298,
|
| 1488 |
+
"[191Po]": 1299,
|
| 1489 |
+
"[190Po]": 1300,
|
| 1490 |
+
"[217Po]": 1301,
|
| 1491 |
+
"[BiH4-]": 1302,
|
| 1492 |
+
"[TeH4]": 1303,
|
| 1493 |
+
"[222Ra]": 1304,
|
| 1494 |
+
"[62Ga]": 1305,
|
| 1495 |
+
"[39Ar]": 1306,
|
| 1496 |
+
"[144Sm]": 1307,
|
| 1497 |
+
"[58Fe]": 1308,
|
| 1498 |
+
"[153Eu]": 1309,
|
| 1499 |
+
"[85Rb]": 1310,
|
| 1500 |
+
"[171Yb]": 1311,
|
| 1501 |
+
"[172Yb]": 1312,
|
| 1502 |
+
"[114Cd]": 1313,
|
| 1503 |
+
"[51Fe]": 1314,
|
| 1504 |
+
"[142Ce]": 1315,
|
| 1505 |
+
"[207Tl]": 1316,
|
| 1506 |
+
"[92Mo]": 1317,
|
| 1507 |
+
"[115Sn]": 1318,
|
| 1508 |
+
"[140Ce]": 1319,
|
| 1509 |
+
"[202Hg]": 1320,
|
| 1510 |
+
"[180W]": 1321,
|
| 1511 |
+
"[182W]": 1322,
|
| 1512 |
+
"[183W]": 1323,
|
| 1513 |
+
"[184W]": 1324,
|
| 1514 |
+
"[96Mo]": 1325,
|
| 1515 |
+
"[47Ti]": 1326,
|
| 1516 |
+
"[111Cd]": 1327,
|
| 1517 |
+
"[143Nd]": 1328,
|
| 1518 |
+
"[145Nd]": 1329,
|
| 1519 |
+
"[126Te]": 1330,
|
| 1520 |
+
"[128Te]": 1331,
|
| 1521 |
+
"[130Te]": 1332,
|
| 1522 |
+
"[185Re]": 1333,
|
| 1523 |
+
"[97Mo]": 1334,
|
| 1524 |
+
"[98Mo]": 1335,
|
| 1525 |
+
"[183Re]": 1336,
|
| 1526 |
+
"[52V]": 1337,
|
| 1527 |
+
"[80Se]": 1338,
|
| 1528 |
+
"[87Kr]": 1339,
|
| 1529 |
+
"[137Xe]": 1340,
|
| 1530 |
+
"[196Au]": 1341,
|
| 1531 |
+
"[146Ce]": 1342,
|
| 1532 |
+
"[88Kr]": 1343,
|
| 1533 |
+
"[51Ti]": 1344,
|
| 1534 |
+
"[138Xe]": 1345,
|
| 1535 |
+
"[112Cd]": 1346,
|
| 1536 |
+
"[116Sn]": 1347,
|
| 1537 |
+
"[120Sn]": 1348,
|
| 1538 |
+
"[28SiH3]": 1349,
|
| 1539 |
+
"[35S-]": 1350,
|
| 1540 |
+
"[15NH-]": 1351,
|
| 1541 |
+
"[13CH3+]": 1352,
|
| 1542 |
+
"[34S+]": 1353,
|
| 1543 |
+
"[34s]": 1354,
|
| 1544 |
+
"[SiH4-]": 1355,
|
| 1545 |
+
"[100Tc+5]": 1356,
|
| 1546 |
+
"[NiH2+2]": 1357,
|
| 1547 |
+
"[239Th]": 1358,
|
| 1548 |
+
"[186Lu]": 1359,
|
| 1549 |
+
"[AuH3]": 1360,
|
| 1550 |
+
"[I@@-]": 1361,
|
| 1551 |
+
"[XeH2]": 1362,
|
| 1552 |
+
"[B+]": 1363,
|
| 1553 |
+
"[16CH2]": 1364,
|
| 1554 |
+
"[8C]": 1365,
|
| 1555 |
+
"[TaH5]": 1366,
|
| 1556 |
+
"[FeH4-]": 1367,
|
| 1557 |
+
"[19C@H]": 1368,
|
| 1558 |
+
"[10NH]": 1369,
|
| 1559 |
+
"[FeH6-3]": 1370,
|
| 1560 |
+
"[22CH]": 1371,
|
| 1561 |
+
"[25N]": 1372,
|
| 1562 |
+
"[25N+]": 1373,
|
| 1563 |
+
"[25N-]": 1374,
|
| 1564 |
+
"[21CH2]": 1375,
|
| 1565 |
+
"[18cH]": 1376,
|
| 1566 |
+
"[113I]": 1377,
|
| 1567 |
+
"[ScH3]": 1378,
|
| 1568 |
+
"[30PH3]": 1379,
|
| 1569 |
+
"[43Ca+2]": 1380,
|
| 1570 |
+
"[41Ca+2]": 1381,
|
| 1571 |
+
"[106Cd]": 1382,
|
| 1572 |
+
"[122Sn]": 1383,
|
| 1573 |
+
"[18CH3]": 1384,
|
| 1574 |
+
"[58Co+3]": 1385,
|
| 1575 |
+
"[98Tc+4]": 1386,
|
| 1576 |
+
"[70Ge]": 1387,
|
| 1577 |
+
"[76Ge]": 1388,
|
| 1578 |
+
"[108Cd]": 1389,
|
| 1579 |
+
"[116Cd]": 1390,
|
| 1580 |
+
"[130Xe]": 1391,
|
| 1581 |
+
"[94Mo]": 1392,
|
| 1582 |
+
"[124Sn]": 1393,
|
| 1583 |
+
"[186Os]": 1394,
|
| 1584 |
+
"[188Os]": 1395,
|
| 1585 |
+
"[190Os]": 1396,
|
| 1586 |
+
"[192Os]": 1397,
|
| 1587 |
+
"[106Pd]": 1398,
|
| 1588 |
+
"[110Pd]": 1399,
|
| 1589 |
+
"[120Te]": 1400,
|
| 1590 |
+
"[132Ba]": 1401,
|
| 1591 |
+
"[134Ba]": 1402,
|
| 1592 |
+
"[136Ba]": 1403,
|
| 1593 |
+
"[136Ce]": 1404,
|
| 1594 |
+
"[138Ce]": 1405,
|
| 1595 |
+
"[156Dy]": 1406,
|
| 1596 |
+
"[158Dy]": 1407,
|
| 1597 |
+
"[160Dy]": 1408,
|
| 1598 |
+
"[163Dy]": 1409,
|
| 1599 |
+
"[162Er]": 1410,
|
| 1600 |
+
"[164Er]": 1411,
|
| 1601 |
+
"[167Er]": 1412,
|
| 1602 |
+
"[176Hf]": 1413,
|
| 1603 |
+
"[26Mg]": 1414,
|
| 1604 |
+
"[144Nd]": 1415,
|
| 1605 |
+
"[150Nd]": 1416,
|
| 1606 |
+
"[41K]": 1417,
|
| 1607 |
+
"[46Ti]": 1418,
|
| 1608 |
+
"[48Ti]": 1419,
|
| 1609 |
+
"[49Ti]": 1420,
|
| 1610 |
+
"[50Ti]": 1421,
|
| 1611 |
+
"[170Yb]": 1422,
|
| 1612 |
+
"[173Yb]": 1423,
|
| 1613 |
+
"[91Zr]": 1424,
|
| 1614 |
+
"[92Zr]": 1425,
|
| 1615 |
+
"[96Zr]": 1426,
|
| 1616 |
+
"[34S-]": 1427,
|
| 1617 |
+
"[CuH2-]": 1428,
|
| 1618 |
+
"[38Cl]": 1429,
|
| 1619 |
+
"[25Mg]": 1430,
|
| 1620 |
+
"[51V]": 1431,
|
| 1621 |
+
"[93Nb]": 1432,
|
| 1622 |
+
"[95Mo]": 1433,
|
| 1623 |
+
"[45Sc]": 1434,
|
| 1624 |
+
"[123Sb]": 1435,
|
| 1625 |
+
"[139La]": 1436,
|
| 1626 |
+
"[9Be]": 1437,
|
| 1627 |
+
"[99Y+3]": 1438,
|
| 1628 |
+
"[99Y]": 1439,
|
| 1629 |
+
"[156Ho]": 1440,
|
| 1630 |
+
"[67Zn]": 1441,
|
| 1631 |
+
"[144Ce+4]": 1442,
|
| 1632 |
+
"[210Tl]": 1443,
|
| 1633 |
+
"[42Ca]": 1444,
|
| 1634 |
+
"[54Fe]": 1445,
|
| 1635 |
+
"[193Ir]": 1446,
|
| 1636 |
+
"[92Nb]": 1447,
|
| 1637 |
+
"[141Cs]": 1448,
|
| 1638 |
+
"[52Cr]": 1449,
|
| 1639 |
+
"[35ClH]": 1450,
|
| 1640 |
+
"[46Ca]": 1451,
|
| 1641 |
+
"[139Cs]": 1452,
|
| 1642 |
+
"[65Cu]": 1453,
|
| 1643 |
+
"[71Ga]": 1454,
|
| 1644 |
+
"[60Ni]": 1455,
|
| 1645 |
+
"[16NH3]": 1456,
|
| 1646 |
+
"[148Nd]": 1457,
|
| 1647 |
+
"[72Ge]": 1458,
|
| 1648 |
+
"[161Dy]": 1459,
|
| 1649 |
+
"[49Ca]": 1460,
|
| 1650 |
+
"[43Ca]": 1461,
|
| 1651 |
+
"[8Be]": 1462,
|
| 1652 |
+
"[48Ca]": 1463,
|
| 1653 |
+
"[44Ca]": 1464,
|
| 1654 |
+
"[120Xe]": 1465,
|
| 1655 |
+
"[80Rb]": 1466,
|
| 1656 |
+
"[215At]": 1467,
|
| 1657 |
+
"[180Re]": 1468,
|
| 1658 |
+
"[146Sm]": 1469,
|
| 1659 |
+
"[19Ne]": 1470,
|
| 1660 |
+
"[74Kr]": 1471,
|
| 1661 |
+
"[134La]": 1472,
|
| 1662 |
+
"[76Kr]": 1473,
|
| 1663 |
+
"[219Fr]": 1474,
|
| 1664 |
+
"[121Xe]": 1475,
|
| 1665 |
+
"[220Fr]": 1476,
|
| 1666 |
+
"[216At]": 1477,
|
| 1667 |
+
"[223Ac]": 1478,
|
| 1668 |
+
"[218At]": 1479,
|
| 1669 |
+
"[37Ar]": 1480,
|
| 1670 |
+
"[135I]": 1481,
|
| 1671 |
+
"[110Cd]": 1482,
|
| 1672 |
+
"[94Tc+7]": 1483,
|
| 1673 |
+
"[86Y+3]": 1484,
|
| 1674 |
+
"[135I-]": 1485,
|
| 1675 |
+
"[15O-2]": 1486,
|
| 1676 |
+
"[151Eu+3]": 1487,
|
| 1677 |
+
"[161Tb+3]": 1488,
|
| 1678 |
+
"[197Hg+2]": 1489,
|
| 1679 |
+
"[109Cd+2]": 1490,
|
| 1680 |
+
"[191Os+4]": 1491,
|
| 1681 |
+
"[170Tm+3]": 1492,
|
| 1682 |
+
"[205Bi+3]": 1493,
|
| 1683 |
+
"[233U+4]": 1494,
|
| 1684 |
+
"[126Sb+3]": 1495,
|
| 1685 |
+
"[127Sb+3]": 1496,
|
| 1686 |
+
"[132Cs+]": 1497,
|
| 1687 |
+
"[136Eu+3]": 1498,
|
| 1688 |
+
"[136Eu]": 1499,
|
| 1689 |
+
"[125Sn+4]": 1500,
|
| 1690 |
+
"[175Yb+3]": 1501,
|
| 1691 |
+
"[100Mo]": 1502,
|
| 1692 |
+
"[22Ne]": 1503,
|
| 1693 |
+
"[13c-]": 1504,
|
| 1694 |
+
"[13NH4+]": 1505,
|
| 1695 |
+
"[17C]": 1506,
|
| 1696 |
+
"[9C]": 1507,
|
| 1697 |
+
"[31S]": 1508,
|
| 1698 |
+
"[31SH]": 1509,
|
| 1699 |
+
"[133I]": 1510,
|
| 1700 |
+
"[126I]": 1511,
|
| 1701 |
+
"[36SH]": 1512,
|
| 1702 |
+
"[30S]": 1513,
|
| 1703 |
+
"[32SH]": 1514,
|
| 1704 |
+
"[19CH2]": 1515,
|
| 1705 |
+
"[19c]": 1516,
|
| 1706 |
+
"[18c]": 1517,
|
| 1707 |
+
"[15F]": 1518,
|
| 1708 |
+
"[10C]": 1519,
|
| 1709 |
+
"[RuH-]": 1520,
|
| 1710 |
+
"[62Zn+2]": 1521,
|
| 1711 |
+
"[32ClH]": 1522,
|
| 1712 |
+
"[33ClH]": 1523,
|
| 1713 |
+
"[78BrH]": 1524,
|
| 1714 |
+
"[12Li+]": 1525,
|
| 1715 |
+
"[12Li]": 1526,
|
| 1716 |
+
"[233Ra]": 1527,
|
| 1717 |
+
"[68Ge+4]": 1528,
|
| 1718 |
+
"[44Sc+3]": 1529,
|
| 1719 |
+
"[91Y+3]": 1530,
|
| 1720 |
+
"[106Ru+3]": 1531,
|
| 1721 |
+
"[PoH2]": 1532,
|
| 1722 |
+
"[AtH]": 1533,
|
| 1723 |
+
"[55Fe]": 1534,
|
| 1724 |
+
"[233U]": 1535,
|
| 1725 |
+
"[210PoH2]": 1536,
|
| 1726 |
+
"[230Th]": 1537,
|
| 1727 |
+
"[228Th]": 1538,
|
| 1728 |
+
"[222Rn]": 1539,
|
| 1729 |
+
"[35SH2]": 1540,
|
| 1730 |
+
"[227Th]": 1541,
|
| 1731 |
+
"[192Ir]": 1542,
|
| 1732 |
+
"[133Xe]": 1543,
|
| 1733 |
+
"[81Kr]": 1544,
|
| 1734 |
+
"[95Zr]": 1545,
|
| 1735 |
+
"[240Pu]": 1546,
|
| 1736 |
+
"[54Mn]": 1547,
|
| 1737 |
+
"[103Ru]": 1548,
|
| 1738 |
+
"[95Nb]": 1549,
|
| 1739 |
+
"[109Cd]": 1550,
|
| 1740 |
+
"[141Ce]": 1551,
|
| 1741 |
+
"[85Kr]": 1552,
|
| 1742 |
+
"[110Ag]": 1553,
|
| 1743 |
+
"[58Co]": 1554,
|
| 1744 |
+
"[241Pu]": 1555,
|
| 1745 |
+
"[234Th]": 1556,
|
| 1746 |
+
"[140La]": 1557,
|
| 1747 |
+
"[63Ni]": 1558,
|
| 1748 |
+
"[152Eu]": 1559,
|
| 1749 |
+
"[132IH]": 1560,
|
| 1750 |
+
"[226Rn]": 1561,
|
| 1751 |
+
"[154Eu]": 1562,
|
| 1752 |
+
"[36ClH]": 1563,
|
| 1753 |
+
"[228Ac]": 1564,
|
| 1754 |
+
"[155Eu]": 1565,
|
| 1755 |
+
"[106Rh]": 1566,
|
| 1756 |
+
"[243Am]": 1567,
|
| 1757 |
+
"[227Ac]": 1568,
|
| 1758 |
+
"[243Cm]": 1569,
|
| 1759 |
+
"[236U]": 1570,
|
| 1760 |
+
"[144Pr]": 1571,
|
| 1761 |
+
"[232U]": 1572,
|
| 1762 |
+
"[32SH2]": 1573,
|
| 1763 |
+
"[88Y]": 1574,
|
| 1764 |
+
"[82BrH]": 1575,
|
| 1765 |
+
"[135IH]": 1576,
|
| 1766 |
+
"[242Cm]": 1577,
|
| 1767 |
+
"[115Cd]": 1578,
|
| 1768 |
+
"[242Pu]": 1579,
|
| 1769 |
+
"[46Sc]": 1580,
|
| 1770 |
+
"[56Mn]": 1581,
|
| 1771 |
+
"[234Pa]": 1582,
|
| 1772 |
+
"[41Ar]": 1583,
|
| 1773 |
+
"[147Nd]": 1584,
|
| 1774 |
+
"[187W]": 1585,
|
| 1775 |
+
"[151Sm]": 1586,
|
| 1776 |
+
"[59Ni]": 1587,
|
| 1777 |
+
"[233Pa]": 1588,
|
| 1778 |
+
"[52Mn]": 1589,
|
| 1779 |
+
"[94Nb]": 1590,
|
| 1780 |
+
"[219Rn]": 1591,
|
| 1781 |
+
"[236Pu]": 1592,
|
| 1782 |
+
"[13NH3]": 1593,
|
| 1783 |
+
"[93Zr]": 1594,
|
| 1784 |
+
"[51Cr+6]": 1595,
|
| 1785 |
+
"[TlH3]": 1596,
|
| 1786 |
+
"[123Xe]": 1597,
|
| 1787 |
+
"[160Tb]": 1598,
|
| 1788 |
+
"[170Tm]": 1599,
|
| 1789 |
+
"[182Ta]": 1600,
|
| 1790 |
+
"[175Yb]": 1601,
|
| 1791 |
+
"[93Mo]": 1602,
|
| 1792 |
+
"[143Ce]": 1603,
|
| 1793 |
+
"[191Os]": 1604,
|
| 1794 |
+
"[126IH]": 1605,
|
| 1795 |
+
"[48V]": 1606,
|
| 1796 |
+
"[113Cd]": 1607,
|
| 1797 |
+
"[47Sc]": 1608,
|
| 1798 |
+
"[181Hf]": 1609,
|
| 1799 |
+
"[185W]": 1610,
|
| 1800 |
+
"[143Pr]": 1611,
|
| 1801 |
+
"[191Pt]": 1612,
|
| 1802 |
+
"[181W]": 1613,
|
| 1803 |
+
"[33PH3]": 1614,
|
| 1804 |
+
"[97Ru]": 1615,
|
| 1805 |
+
"[97Tc]": 1616,
|
| 1806 |
+
"[111Ag]": 1617,
|
| 1807 |
+
"[169Er]": 1618,
|
| 1808 |
+
"[107Pd]": 1619,
|
| 1809 |
+
"[103Ru+2]": 1620,
|
| 1810 |
+
"[34SH2]": 1621,
|
| 1811 |
+
"[137Ce]": 1622,
|
| 1812 |
+
"[242Am]": 1623,
|
| 1813 |
+
"[117SnH2]": 1624,
|
| 1814 |
+
"[57Ni]": 1625,
|
| 1815 |
+
"[239U]": 1626,
|
| 1816 |
+
"[60Cu]": 1627,
|
| 1817 |
+
"[250Cf]": 1628,
|
| 1818 |
+
"[193Au]": 1629,
|
| 1819 |
+
"[69Zn]": 1630,
|
| 1820 |
+
"[55Co]": 1631,
|
| 1821 |
+
"[139Ce]": 1632,
|
| 1822 |
+
"[127Xe]": 1633,
|
| 1823 |
+
"[159Gd]": 1634,
|
| 1824 |
+
"[56Co]": 1635,
|
| 1825 |
+
"[177Hf]": 1636,
|
| 1826 |
+
"[244Pu]": 1637,
|
| 1827 |
+
"[38ClH]": 1638,
|
| 1828 |
+
"[142Pr]": 1639,
|
| 1829 |
+
"[199Hg]": 1640,
|
| 1830 |
+
"[179Hf]": 1641,
|
| 1831 |
+
"[178Hf]": 1642,
|
| 1832 |
+
"[237U]": 1643,
|
| 1833 |
+
"[156Eu]": 1644,
|
| 1834 |
+
"[157Eu]": 1645,
|
| 1835 |
+
"[105Ru]": 1646,
|
| 1836 |
+
"[171Tm]": 1647,
|
| 1837 |
+
"[199Au]": 1648,
|
| 1838 |
+
"[155Sm]": 1649,
|
| 1839 |
+
"[80BrH]": 1650,
|
| 1840 |
+
"[108Ag]": 1651,
|
| 1841 |
+
"[128IH]": 1652,
|
| 1842 |
+
"[48Sc]": 1653,
|
| 1843 |
+
"[45Ti]": 1654,
|
| 1844 |
+
"[176Lu]": 1655,
|
| 1845 |
+
"[121SnH2]": 1656,
|
| 1846 |
+
"[148Pm]": 1657,
|
| 1847 |
+
"[57Fe]": 1658,
|
| 1848 |
+
"[10BH3]": 1659,
|
| 1849 |
+
"[96Tc]": 1660,
|
| 1850 |
+
"[133IH]": 1661,
|
| 1851 |
+
"[143Pm]": 1662,
|
| 1852 |
+
"[105Rh]": 1663,
|
| 1853 |
+
"[130IH]": 1664,
|
| 1854 |
+
"[134IH]": 1665,
|
| 1855 |
+
"[131IH]": 1666,
|
| 1856 |
+
"[71Zn]": 1667,
|
| 1857 |
+
"[105Ag]": 1668,
|
| 1858 |
+
"[97Zr]": 1669,
|
| 1859 |
+
"[235Pu]": 1670,
|
| 1860 |
+
"[231Th]": 1671,
|
| 1861 |
+
"[109Pd]": 1672,
|
| 1862 |
+
"[93Y]": 1673,
|
| 1863 |
+
"[190Ir]": 1674,
|
| 1864 |
+
"[135Xe]": 1675,
|
| 1865 |
+
"[53Mn]": 1676,
|
| 1866 |
+
"[134Ce]": 1677,
|
| 1867 |
+
"[234Np]": 1678,
|
| 1868 |
+
"[240Am]": 1679,
|
| 1869 |
+
"[246Cf]": 1680,
|
| 1870 |
+
"[240Cm]": 1681,
|
| 1871 |
+
"[241Cm]": 1682,
|
| 1872 |
+
"[226Th]": 1683,
|
| 1873 |
+
"[39ClH]": 1684,
|
| 1874 |
+
"[229Th]": 1685,
|
| 1875 |
+
"[245Cm]": 1686,
|
| 1876 |
+
"[240U]": 1687,
|
| 1877 |
+
"[240Np]": 1688,
|
| 1878 |
+
"[249Cm]": 1689,
|
| 1879 |
+
"[243Pu]": 1690,
|
| 1880 |
+
"[145Pm]": 1691,
|
| 1881 |
+
"[199Pt]": 1692,
|
| 1882 |
+
"[246Bk]": 1693,
|
| 1883 |
+
"[193Pt]": 1694,
|
| 1884 |
+
"[230U]": 1695,
|
| 1885 |
+
"[250Cm]": 1696,
|
| 1886 |
+
"[44Ti]": 1697,
|
| 1887 |
+
"[175Hf]": 1698,
|
| 1888 |
+
"[254Fm]": 1699,
|
| 1889 |
+
"[255Fm]": 1700,
|
| 1890 |
+
"[257Fm]": 1701,
|
| 1891 |
+
"[92Y]": 1702,
|
| 1892 |
+
"[188Ir]": 1703,
|
| 1893 |
+
"[171Lu]": 1704,
|
| 1894 |
+
"[257Md]": 1705,
|
| 1895 |
+
"[247Bk]": 1706,
|
| 1896 |
+
"[121IH]": 1707,
|
| 1897 |
+
"[250Bk]": 1708,
|
| 1898 |
+
"[179Lu]": 1709,
|
| 1899 |
+
"[224Ac]": 1710,
|
| 1900 |
+
"[195Hg]": 1711,
|
| 1901 |
+
"[244Am]": 1712,
|
| 1902 |
+
"[246Pu]": 1713,
|
| 1903 |
+
"[194Au]": 1714,
|
| 1904 |
+
"[252Fm]": 1715,
|
| 1905 |
+
"[173Hf]": 1716,
|
| 1906 |
+
"[246Cm]": 1717,
|
| 1907 |
+
"[135Ce]": 1718,
|
| 1908 |
+
"[49Cr]": 1719,
|
| 1909 |
+
"[248Cf]": 1720,
|
| 1910 |
+
"[247Cm]": 1721,
|
| 1911 |
+
"[248Cm]": 1722,
|
| 1912 |
+
"[174Ta]": 1723,
|
| 1913 |
+
"[176Ta]": 1724,
|
| 1914 |
+
"[154Tb]": 1725,
|
| 1915 |
+
"[172Ta]": 1726,
|
| 1916 |
+
"[177Ta]": 1727,
|
| 1917 |
+
"[175Ta]": 1728,
|
| 1918 |
+
"[180Ta]": 1729,
|
| 1919 |
+
"[158Tb]": 1730,
|
| 1920 |
+
"[115Ag]": 1731,
|
| 1921 |
+
"[189Os]": 1732,
|
| 1922 |
+
"[251Cf]": 1733,
|
| 1923 |
+
"[145Pr]": 1734,
|
| 1924 |
+
"[147Pr]": 1735,
|
| 1925 |
+
"[76BrH]": 1736,
|
| 1926 |
+
"[102Rh]": 1737,
|
| 1927 |
+
"[238Np]": 1738,
|
| 1928 |
+
"[185Os]": 1739,
|
| 1929 |
+
"[246Am]": 1740,
|
| 1930 |
+
"[233Np]": 1741,
|
| 1931 |
+
"[166Dy]": 1742,
|
| 1932 |
+
"[254Es]": 1743,
|
| 1933 |
+
"[244Cf]": 1744,
|
| 1934 |
+
"[193Os]": 1745,
|
| 1935 |
+
"[245Am]": 1746,
|
| 1936 |
+
"[245Bk]": 1747,
|
| 1937 |
+
"[239Am]": 1748,
|
| 1938 |
+
"[238Am]": 1749,
|
| 1939 |
+
"[97Nb]": 1750,
|
| 1940 |
+
"[245Pu]": 1751,
|
| 1941 |
+
"[254Cf]": 1752,
|
| 1942 |
+
"[188W]": 1753,
|
| 1943 |
+
"[250Es]": 1754,
|
| 1944 |
+
"[251Es]": 1755,
|
| 1945 |
+
"[237Am]": 1756,
|
| 1946 |
+
"[182Hf]": 1757,
|
| 1947 |
+
"[258Md]": 1758,
|
| 1948 |
+
"[232Np]": 1759,
|
| 1949 |
+
"[238Cm]": 1760,
|
| 1950 |
+
"[60Fe]": 1761,
|
| 1951 |
+
"[109Pd+2]": 1762,
|
| 1952 |
+
"[234Pu]": 1763,
|
| 1953 |
+
"[141Ce+3]": 1764,
|
| 1954 |
+
"[136Nd]": 1765,
|
| 1955 |
+
"[136Pr]": 1766,
|
| 1956 |
+
"[173Ta]": 1767,
|
| 1957 |
+
"[110Ru]": 1768,
|
| 1958 |
+
"[147Tb]": 1769,
|
| 1959 |
+
"[253Fm]": 1770,
|
| 1960 |
+
"[139Nd]": 1771,
|
| 1961 |
+
"[178Re]": 1772,
|
| 1962 |
+
"[177Re]": 1773,
|
| 1963 |
+
"[200Au]": 1774,
|
| 1964 |
+
"[182Re]": 1775,
|
| 1965 |
+
"[156Tb]": 1776,
|
| 1966 |
+
"[155Tb]": 1777,
|
| 1967 |
+
"[157Tb]": 1778,
|
| 1968 |
+
"[161Tb]": 1779,
|
| 1969 |
+
"[161Ho]": 1780,
|
| 1970 |
+
"[167Tm]": 1781,
|
| 1971 |
+
"[173Lu]": 1782,
|
| 1972 |
+
"[179Ta]": 1783,
|
| 1973 |
+
"[171Er]": 1784,
|
| 1974 |
+
"[44Sc]": 1785,
|
| 1975 |
+
"[49Sc]": 1786,
|
| 1976 |
+
"[49V]": 1787,
|
| 1977 |
+
"[51Mn]": 1788,
|
| 1978 |
+
"[90Nb]": 1789,
|
| 1979 |
+
"[88Nb]": 1790,
|
| 1980 |
+
"[88Zr]": 1791,
|
| 1981 |
+
"[36SH2]": 1792,
|
| 1982 |
+
"[174Yb]": 1793,
|
| 1983 |
+
"[178Lu]": 1794,
|
| 1984 |
+
"[179W]": 1795,
|
| 1985 |
+
"[83BrH]": 1796,
|
| 1986 |
+
"[107Cd]": 1797,
|
| 1987 |
+
"[75BrH]": 1798,
|
| 1988 |
+
"[62Co]": 1799,
|
| 1989 |
+
"[48Cr]": 1800,
|
| 1990 |
+
"[63Zn]": 1801,
|
| 1991 |
+
"[102Ag]": 1802,
|
| 1992 |
+
"[154Sm]": 1803,
|
| 1993 |
+
"[168Er]": 1804,
|
| 1994 |
+
"[65Ni]": 1805,
|
| 1995 |
+
"[137La]": 1806,
|
| 1996 |
+
"[187Ir]": 1807,
|
| 1997 |
+
"[144Pm]": 1808,
|
| 1998 |
+
"[146Pm]": 1809,
|
| 1999 |
+
"[160Gd]": 1810,
|
| 2000 |
+
"[166Yb]": 1811,
|
| 2001 |
+
"[162Dy]": 1812,
|
| 2002 |
+
"[47V]": 1813,
|
| 2003 |
+
"[141Nd]": 1814,
|
| 2004 |
+
"[141Sm]": 1815,
|
| 2005 |
+
"[166Er]": 1816,
|
| 2006 |
+
"[150Sm]": 1817,
|
| 2007 |
+
"[146Eu]": 1818,
|
| 2008 |
+
"[149Eu]": 1819,
|
| 2009 |
+
"[174Lu]": 1820,
|
| 2010 |
+
"[17NH3]": 1821,
|
| 2011 |
+
"[102Ru]": 1822,
|
| 2012 |
+
"[170Hf]": 1823,
|
| 2013 |
+
"[188Pt]": 1824,
|
| 2014 |
+
"[61Ni]": 1825,
|
| 2015 |
+
"[56Ni]": 1826,
|
| 2016 |
+
"[149Gd]": 1827,
|
| 2017 |
+
"[151Gd]": 1828,
|
| 2018 |
+
"[141Pm]": 1829,
|
| 2019 |
+
"[147Gd]": 1830,
|
| 2020 |
+
"[146Gd]": 1831,
|
| 2021 |
+
"[161Er]": 1832,
|
| 2022 |
+
"[103Ag]": 1833,
|
| 2023 |
+
"[145Eu]": 1834,
|
| 2024 |
+
"[153Tb]": 1835,
|
| 2025 |
+
"[155Dy]": 1836,
|
| 2026 |
+
"[184Re]": 1837,
|
| 2027 |
+
"[180Os]": 1838,
|
| 2028 |
+
"[182Os]": 1839,
|
| 2029 |
+
"[186Pt]": 1840,
|
| 2030 |
+
"[181Os]": 1841,
|
| 2031 |
+
"[181Re]": 1842,
|
| 2032 |
+
"[151Tb]": 1843,
|
| 2033 |
+
"[178Ta]": 1844,
|
| 2034 |
+
"[178W]": 1845,
|
| 2035 |
+
"[189Pt]": 1846,
|
| 2036 |
+
"[194Hg]": 1847,
|
| 2037 |
+
"[145Sm]": 1848,
|
| 2038 |
+
"[150Tb]": 1849,
|
| 2039 |
+
"[132La]": 1850,
|
| 2040 |
+
"[158Gd]": 1851,
|
| 2041 |
+
"[104Ag]": 1852,
|
| 2042 |
+
"[193Hg]": 1853,
|
| 2043 |
+
"[94Ru]": 1854,
|
| 2044 |
+
"[137Pr]": 1855,
|
| 2045 |
+
"[155Ho]": 1856,
|
| 2046 |
+
"[117Cd]": 1857,
|
| 2047 |
+
"[99Ru]": 1858,
|
| 2048 |
+
"[146Nd]": 1859,
|
| 2049 |
+
"[218Rn]": 1860,
|
| 2050 |
+
"[95Y]": 1861,
|
| 2051 |
+
"[79Kr]": 1862,
|
| 2052 |
+
"[120IH]": 1863,
|
| 2053 |
+
"[138Pr]": 1864,
|
| 2054 |
+
"[100Pd]": 1865,
|
| 2055 |
+
"[166Tm]": 1866,
|
| 2056 |
+
"[90Mo]": 1867,
|
| 2057 |
+
"[151Nd]": 1868,
|
| 2058 |
+
"[231U]": 1869,
|
| 2059 |
+
"[138Nd]": 1870,
|
| 2060 |
+
"[89Nb]": 1871,
|
| 2061 |
+
"[98Nb]": 1872,
|
| 2062 |
+
"[162Ho]": 1873,
|
| 2063 |
+
"[142Sm]": 1874,
|
| 2064 |
+
"[186Ta]": 1875,
|
| 2065 |
+
"[104Tc]": 1876,
|
| 2066 |
+
"[184Ta]": 1877,
|
| 2067 |
+
"[185Ta]": 1878,
|
| 2068 |
+
"[170Er]": 1879,
|
| 2069 |
+
"[107Rh]": 1880,
|
| 2070 |
+
"[131La]": 1881,
|
| 2071 |
+
"[169Lu]": 1882,
|
| 2072 |
+
"[74BrH]": 1883,
|
| 2073 |
+
"[150Pm]": 1884,
|
| 2074 |
+
"[172Tm]": 1885,
|
| 2075 |
+
"[197Pt]": 1886,
|
| 2076 |
+
"[230Pu]": 1887,
|
| 2077 |
+
"[170Lu]": 1888,
|
| 2078 |
+
"[86Zr]": 1889,
|
| 2079 |
+
"[176W]": 1890,
|
| 2080 |
+
"[177W]": 1891,
|
| 2081 |
+
"[101Pd]": 1892,
|
| 2082 |
+
"[105Pd]": 1893,
|
| 2083 |
+
"[108Pd]": 1894,
|
| 2084 |
+
"[149Nd]": 1895,
|
| 2085 |
+
"[164Ho]": 1896,
|
| 2086 |
+
"[159Ho]": 1897,
|
| 2087 |
+
"[167Ho]": 1898,
|
| 2088 |
+
"[176Yb]": 1899,
|
| 2089 |
+
"[156Sm]": 1900,
|
| 2090 |
+
"[77BrH]": 1901,
|
| 2091 |
+
"[189Re]": 1902,
|
| 2092 |
+
"[99Rh]": 1903,
|
| 2093 |
+
"[100Rh]": 1904,
|
| 2094 |
+
"[151Pm]": 1905,
|
| 2095 |
+
"[232Pa]": 1906,
|
| 2096 |
+
"[228Pa]": 1907,
|
| 2097 |
+
"[230Pa]": 1908,
|
| 2098 |
+
"[66Ni]": 1909,
|
| 2099 |
+
"[194Os]": 1910,
|
| 2100 |
+
"[135La]": 1911,
|
| 2101 |
+
"[138La]": 1912,
|
| 2102 |
+
"[141La]": 1913,
|
| 2103 |
+
"[142La]": 1914,
|
| 2104 |
+
"[195Ir]": 1915,
|
| 2105 |
+
"[96Nb]": 1916,
|
| 2106 |
+
"[157Ho]": 1917,
|
| 2107 |
+
"[183Hf]": 1918,
|
| 2108 |
+
"[162Tm]": 1919,
|
| 2109 |
+
"[172Er]": 1920,
|
| 2110 |
+
"[148Eu]": 1921,
|
| 2111 |
+
"[150Eu]": 1922,
|
| 2112 |
+
"[15CH4]": 1923,
|
| 2113 |
+
"[89Kr]": 1924,
|
| 2114 |
+
"[143La]": 1925,
|
| 2115 |
+
"[58Ni]": 1926,
|
| 2116 |
+
"[61Co]": 1927,
|
| 2117 |
+
"[158Eu]": 1928,
|
| 2118 |
+
"[165Er]": 1929,
|
| 2119 |
+
"[167Yb]": 1930,
|
| 2120 |
+
"[173Tm]": 1931,
|
| 2121 |
+
"[175Tm]": 1932,
|
| 2122 |
+
"[172Hf]": 1933,
|
| 2123 |
+
"[172Lu]": 1934,
|
| 2124 |
+
"[93Tc]": 1935,
|
| 2125 |
+
"[177Yb]": 1936,
|
| 2126 |
+
"[124IH]": 1937,
|
| 2127 |
+
"[194Ir]": 1938,
|
| 2128 |
+
"[147Eu]": 1939,
|
| 2129 |
+
"[101Mo]": 1940,
|
| 2130 |
+
"[180Hf]": 1941,
|
| 2131 |
+
"[189Ir]": 1942,
|
| 2132 |
+
"[87Y]": 1943,
|
| 2133 |
+
"[43Sc]": 1944,
|
| 2134 |
+
"[195Au]": 1945,
|
| 2135 |
+
"[112Ag]": 1946,
|
| 2136 |
+
"[84BrH]": 1947,
|
| 2137 |
+
"[106Ag]": 1948,
|
| 2138 |
+
"[109Ag]": 1949,
|
| 2139 |
+
"[101Rh]": 1950,
|
| 2140 |
+
"[162Yb]": 1951,
|
| 2141 |
+
"[228Rn]": 1952,
|
| 2142 |
+
"[139Pr]": 1953,
|
| 2143 |
+
"[94Y]": 1954,
|
| 2144 |
+
"[201Au]": 1955,
|
| 2145 |
+
"[40PH3]": 1956,
|
| 2146 |
+
"[110Ag+]": 1957,
|
| 2147 |
+
"[104Cd]": 1958,
|
| 2148 |
+
"[133Ba+2]": 1959,
|
| 2149 |
+
"[226Ac]": 1960,
|
| 2150 |
+
"[145Gd]": 1961,
|
| 2151 |
+
"[186Ir]": 1962,
|
| 2152 |
+
"[184Ir]": 1963,
|
| 2153 |
+
"[224Rn]": 1964,
|
| 2154 |
+
"[185Ir]": 1965,
|
| 2155 |
+
"[182Ir]": 1966,
|
| 2156 |
+
"[184Hf]": 1967,
|
| 2157 |
+
"[200Pt]": 1968,
|
| 2158 |
+
"[227Pa]": 1969,
|
| 2159 |
+
"[178Yb]": 1970,
|
| 2160 |
+
"[72Br-]": 1971,
|
| 2161 |
+
"[72BrH]": 1972,
|
| 2162 |
+
"[248Am]": 1973,
|
| 2163 |
+
"[238Th]": 1974,
|
| 2164 |
+
"[161Gd]": 1975,
|
| 2165 |
+
"[35S-2]": 1976,
|
| 2166 |
+
"[107Ag]": 1977,
|
| 2167 |
+
"[FeH6-4]": 1978,
|
| 2168 |
+
"[89Sr]": 1979,
|
| 2169 |
+
"[SnH3-]": 1980,
|
| 2170 |
+
"[SeH3]": 1981,
|
| 2171 |
+
"[TeH3+]": 1982,
|
| 2172 |
+
"[SbH4+]": 1983,
|
| 2173 |
+
"[AsH4+]": 1984,
|
| 2174 |
+
"[4He]": 1985,
|
| 2175 |
+
"[AsH3-]": 1986,
|
| 2176 |
+
"[1HH]": 1987,
|
| 2177 |
+
"[3H+]": 1988,
|
| 2178 |
+
"[82Rb]": 1989,
|
| 2179 |
+
"[85Sr]": 1990,
|
| 2180 |
+
"[90Sr]": 1991,
|
| 2181 |
+
"[137Cs]": 1992,
|
| 2182 |
+
"[133Ba]": 1993,
|
| 2183 |
+
"[131Cs]": 1994,
|
| 2184 |
+
"[SbH5]": 1995,
|
| 2185 |
+
"[224Ra]": 1996,
|
| 2186 |
+
"[22Na]": 1997,
|
| 2187 |
+
"[210Bi]": 1998,
|
| 2188 |
+
"[214Bi]": 1999,
|
| 2189 |
+
"[228Ra]": 2000,
|
| 2190 |
+
"[127Sb]": 2001,
|
| 2191 |
+
"[136Cs]": 2002,
|
| 2192 |
+
"[125Sb]": 2003,
|
| 2193 |
+
"[134Cs]": 2004,
|
| 2194 |
+
"[140Ba]": 2005,
|
| 2195 |
+
"[45Ca]": 2006,
|
| 2196 |
+
"[206Pb]": 2007,
|
| 2197 |
+
"[207Pb]": 2008,
|
| 2198 |
+
"[24Na]": 2009,
|
| 2199 |
+
"[86Rb]": 2010,
|
| 2200 |
+
"[212Bi]": 2011,
|
| 2201 |
+
"[208Pb]": 2012,
|
| 2202 |
+
"[124Sb]": 2013,
|
| 2203 |
+
"[204Pb]": 2014,
|
| 2204 |
+
"[44K]": 2015,
|
| 2205 |
+
"[129Te]": 2016,
|
| 2206 |
+
"[113Sn]": 2017,
|
| 2207 |
+
"[204Tl]": 2018,
|
| 2208 |
+
"[87Sr]": 2019,
|
| 2209 |
+
"[208Tl]": 2020,
|
| 2210 |
+
"[87Rb]": 2021,
|
| 2211 |
+
"[47Ca]": 2022,
|
| 2212 |
+
"[135Cs]": 2023,
|
| 2213 |
+
"[216Po]": 2024,
|
| 2214 |
+
"[137Ba]": 2025,
|
| 2215 |
+
"[207Bi]": 2026,
|
| 2216 |
+
"[212Po]": 2027,
|
| 2217 |
+
"[79Se]": 2028,
|
| 2218 |
+
"[223Ra]": 2029,
|
| 2219 |
+
"[86Sr]": 2030,
|
| 2220 |
+
"[122Sb]": 2031,
|
| 2221 |
+
"[26Al]": 2032,
|
| 2222 |
+
"[32Si]": 2033,
|
| 2223 |
+
"[126Sn]": 2034,
|
| 2224 |
+
"[225Ra]": 2035,
|
| 2225 |
+
"[114In]": 2036,
|
| 2226 |
+
"[72Ga]": 2037,
|
| 2227 |
+
"[132Te]": 2038,
|
| 2228 |
+
"[10Be]": 2039,
|
| 2229 |
+
"[125Sn]": 2040,
|
| 2230 |
+
"[73As]": 2041,
|
| 2231 |
+
"[206Bi]": 2042,
|
| 2232 |
+
"[117Sn]": 2043,
|
| 2233 |
+
"[40Ca]": 2044,
|
| 2234 |
+
"[41Ca]": 2045,
|
| 2235 |
+
"[89Rb]": 2046,
|
| 2236 |
+
"[116In]": 2047,
|
| 2237 |
+
"[129Sb]": 2048,
|
| 2238 |
+
"[91Sr]": 2049,
|
| 2239 |
+
"[71Ge]": 2050,
|
| 2240 |
+
"[139Ba]": 2051,
|
| 2241 |
+
"[69Ga]": 2052,
|
| 2242 |
+
"[120Sb]": 2053,
|
| 2243 |
+
"[121Sn]": 2054,
|
| 2244 |
+
"[123Sn]": 2055,
|
| 2245 |
+
"[131Te]": 2056,
|
| 2246 |
+
"[77Ge]": 2057,
|
| 2247 |
+
"[135Ba]": 2058,
|
| 2248 |
+
"[82Sr]": 2059,
|
| 2249 |
+
"[43K]": 2060,
|
| 2250 |
+
"[131Ba]": 2061,
|
| 2251 |
+
"[92Sr]": 2062,
|
| 2252 |
+
"[88Rb]": 2063,
|
| 2253 |
+
"[129Cs]": 2064,
|
| 2254 |
+
"[144Cs]": 2065,
|
| 2255 |
+
"[127Cs]": 2066,
|
| 2256 |
+
"[200Tl]": 2067,
|
| 2257 |
+
"[202Tl]": 2068,
|
| 2258 |
+
"[141Ba]": 2069,
|
| 2259 |
+
"[117Sb]": 2070,
|
| 2260 |
+
"[116Sb]": 2071,
|
| 2261 |
+
"[78As]": 2072,
|
| 2262 |
+
"[131Sb]": 2073,
|
| 2263 |
+
"[126Sb]": 2074,
|
| 2264 |
+
"[128Sb]": 2075,
|
| 2265 |
+
"[130Sb]": 2076,
|
| 2266 |
+
"[67Ge]": 2077,
|
| 2267 |
+
"[68Ge]": 2078,
|
| 2268 |
+
"[78Ge]": 2079,
|
| 2269 |
+
"[66Ge]": 2080,
|
| 2270 |
+
"[223Fr]": 2081,
|
| 2271 |
+
"[132Cs]": 2082,
|
| 2272 |
+
"[125Cs]": 2083,
|
| 2273 |
+
"[138Cs]": 2084,
|
| 2274 |
+
"[133Te]": 2085,
|
| 2275 |
+
"[84Rb]": 2086,
|
| 2276 |
+
"[83Rb]": 2087,
|
| 2277 |
+
"[81Rb]": 2088,
|
| 2278 |
+
"[142Ba]": 2089,
|
| 2279 |
+
"[200Bi]": 2090,
|
| 2280 |
+
"[115Sb]": 2091,
|
| 2281 |
+
"[194Tl]": 2092,
|
| 2282 |
+
"[70Se]": 2093,
|
| 2283 |
+
"[112In]": 2094,
|
| 2284 |
+
"[118Sb]": 2095,
|
| 2285 |
+
"[70Ga]": 2096,
|
| 2286 |
+
"[27Mg]": 2097,
|
| 2287 |
+
"[202Bi]": 2098,
|
| 2288 |
+
"[83Se]": 2099,
|
| 2289 |
+
"[9Li]": 2100,
|
| 2290 |
+
"[69As]": 2101,
|
| 2291 |
+
"[79Rb]": 2102,
|
| 2292 |
+
"[81Sr]": 2103,
|
| 2293 |
+
"[83Sr]": 2104,
|
| 2294 |
+
"[78Se]": 2105,
|
| 2295 |
+
"[109In]": 2106,
|
| 2296 |
+
"[29Al]": 2107,
|
| 2297 |
+
"[118Sn]": 2108,
|
| 2298 |
+
"[117In]": 2109,
|
| 2299 |
+
"[119Sb]": 2110,
|
| 2300 |
+
"[114Sn]": 2111,
|
| 2301 |
+
"[138Ba]": 2112,
|
| 2302 |
+
"[69Ge]": 2113,
|
| 2303 |
+
"[73Ga]": 2114,
|
| 2304 |
+
"[74Ge]": 2115,
|
| 2305 |
+
"[206Tl]": 2116,
|
| 2306 |
+
"[199Tl]": 2117,
|
| 2307 |
+
"[130Cs]": 2118,
|
| 2308 |
+
"[28Mg]": 2119,
|
| 2309 |
+
"[116Te]": 2120,
|
| 2310 |
+
"[112Sn]": 2121,
|
| 2311 |
+
"[126Ba]": 2122,
|
| 2312 |
+
"[211Bi]": 2123,
|
| 2313 |
+
"[81Se]": 2124,
|
| 2314 |
+
"[127Sn]": 2125,
|
| 2315 |
+
"[143Cs]": 2126,
|
| 2316 |
+
"[134Te]": 2127,
|
| 2317 |
+
"[80Sr]": 2128,
|
| 2318 |
+
"[45K]": 2129,
|
| 2319 |
+
"[215Po]": 2130,
|
| 2320 |
+
"[207Po]": 2131,
|
| 2321 |
+
"[111Sn]": 2132,
|
| 2322 |
+
"[211Po]": 2133,
|
| 2323 |
+
"[128Ba]": 2134,
|
| 2324 |
+
"[198Tl]": 2135,
|
| 2325 |
+
"[227Ra]": 2136,
|
| 2326 |
+
"[213Po]": 2137,
|
| 2327 |
+
"[220Ra]": 2138,
|
| 2328 |
+
"[128Sn]": 2139,
|
| 2329 |
+
"[203Po]": 2140,
|
| 2330 |
+
"[205Po]": 2141,
|
| 2331 |
+
"[65Ga]": 2142,
|
| 2332 |
+
"[197Tl]": 2143,
|
| 2333 |
+
"[88Sr]": 2144,
|
| 2334 |
+
"[110In]": 2145,
|
| 2335 |
+
"[31Si]": 2146,
|
| 2336 |
+
"[201Bi]": 2147,
|
| 2337 |
+
"[121Te]": 2148,
|
| 2338 |
+
"[205Bi]": 2149,
|
| 2339 |
+
"[203Bi]": 2150,
|
| 2340 |
+
"[195Tl]": 2151,
|
| 2341 |
+
"[209Tl]": 2152,
|
| 2342 |
+
"[110Sn]": 2153,
|
| 2343 |
+
"[222Fr]": 2154,
|
| 2344 |
+
"[207At]": 2155,
|
| 2345 |
+
"[119In]": 2156,
|
| 2346 |
+
"[As@]": 2157,
|
| 2347 |
+
"[129IH]": 2158,
|
| 2348 |
+
"[157Dy]": 2159,
|
| 2349 |
+
"[111IH]": 2160,
|
| 2350 |
+
"[230Ra]": 2161,
|
| 2351 |
+
"[144Pr+3]": 2162,
|
| 2352 |
+
"[SiH3+]": 2163,
|
| 2353 |
+
"[3He]": 2164,
|
| 2354 |
+
"[AsH5]": 2165,
|
| 2355 |
+
"[72Se]": 2166,
|
| 2356 |
+
"[95Tc]": 2167,
|
| 2357 |
+
"[103Pd]": 2168,
|
| 2358 |
+
"[121Sn+2]": 2169,
|
| 2359 |
+
"[211Rn]": 2170,
|
| 2360 |
+
"[38SH2]": 2171,
|
| 2361 |
+
"[127IH]": 2172,
|
| 2362 |
+
"[74Br-]": 2173,
|
| 2363 |
+
"[133I-]": 2174,
|
| 2364 |
+
"[100Tc+4]": 2175,
|
| 2365 |
+
"[100Tc]": 2176,
|
| 2366 |
+
"[36Cl-]": 2177,
|
| 2367 |
+
"[89Y+3]": 2178,
|
| 2368 |
+
"[104Rh]": 2179,
|
| 2369 |
+
"[152Sm]": 2180,
|
| 2370 |
+
"[226Ra]": 2181,
|
| 2371 |
+
"[19FH]": 2182,
|
| 2372 |
+
"[104Pd]": 2183,
|
| 2373 |
+
"[148Gd]": 2184,
|
| 2374 |
+
"[157Lu]": 2185,
|
| 2375 |
+
"[33SH2]": 2186,
|
| 2376 |
+
"[121I-]": 2187,
|
| 2377 |
+
"[17FH]": 2188,
|
| 2378 |
+
"[71Se]": 2189,
|
| 2379 |
+
"[157Sm]": 2190,
|
| 2380 |
+
"[148Tb]": 2191,
|
| 2381 |
+
"[164Dy]": 2192,
|
| 2382 |
+
"[15OH2]": 2193,
|
| 2383 |
+
"[15O+]": 2194,
|
| 2384 |
+
"[39K]": 2195,
|
| 2385 |
+
"[40Ar]": 2196,
|
| 2386 |
+
"[50Cr+3]": 2197,
|
| 2387 |
+
"[50Cr]": 2198,
|
| 2388 |
+
"[52Ti]": 2199,
|
| 2389 |
+
"[103Pd+2]": 2200,
|
| 2390 |
+
"[130Ba]": 2201,
|
| 2391 |
+
"[142Pm]": 2202,
|
| 2392 |
+
"[153Gd+3]": 2203,
|
| 2393 |
+
"[151Eu]": 2204,
|
| 2394 |
+
"[103Rh]": 2205,
|
| 2395 |
+
"[124Xe]": 2206,
|
| 2396 |
+
"[152Tb]": 2207,
|
| 2397 |
+
"[17OH2]": 2208,
|
| 2398 |
+
"[20Ne]": 2209,
|
| 2399 |
+
"[52Fe]": 2210,
|
| 2400 |
+
"[94Zr+4]": 2211,
|
| 2401 |
+
"[94Zr]": 2212,
|
| 2402 |
+
"[149Pr]": 2213,
|
| 2403 |
+
"[16OH2]": 2214,
|
| 2404 |
+
"[53Cr+6]": 2215,
|
| 2405 |
+
"[53Cr]": 2216,
|
| 2406 |
+
"[81Br-]": 2217,
|
| 2407 |
+
"[112Pd]": 2218,
|
| 2408 |
+
"[125Xe]": 2219,
|
| 2409 |
+
"[155Gd]": 2220,
|
| 2410 |
+
"[157Gd]": 2221,
|
| 2411 |
+
"[168Yb]": 2222,
|
| 2412 |
+
"[184Os]": 2223,
|
| 2413 |
+
"[166Tb]": 2224,
|
| 2414 |
+
"[221Fr]": 2225,
|
| 2415 |
+
"[212Ra]": 2226,
|
| 2416 |
+
"[75Br-]": 2227,
|
| 2417 |
+
"[79Br-]": 2228,
|
| 2418 |
+
"[113Ag]": 2229,
|
| 2419 |
+
"[23Na]": 2230,
|
| 2420 |
+
"[34Cl-]": 2231,
|
| 2421 |
+
"[34ClH]": 2232,
|
| 2422 |
+
"[38Cl-]": 2233,
|
| 2423 |
+
"[56Fe]": 2234,
|
| 2424 |
+
"[68Cu]": 2235,
|
| 2425 |
+
"[77Br-]": 2236,
|
| 2426 |
+
"[90Zr+4]": 2237,
|
| 2427 |
+
"[90Zr]": 2238,
|
| 2428 |
+
"[102Pd]": 2239,
|
| 2429 |
+
"[154Eu+3]": 2240,
|
| 2430 |
+
"[57Mn]": 2241,
|
| 2431 |
+
"[165Tm]": 2242,
|
| 2432 |
+
"[152Dy]": 2243,
|
| 2433 |
+
"[217At]": 2244,
|
| 2434 |
+
"[77se]": 2245,
|
| 2435 |
+
"[13cH-]": 2246,
|
| 2436 |
+
"[122Te]": 2247,
|
| 2437 |
+
"[156Gd]": 2248,
|
| 2438 |
+
"[124Te]": 2249,
|
| 2439 |
+
"[53Ni]": 2250,
|
| 2440 |
+
"[131Xe]": 2251,
|
| 2441 |
+
"[174Hf+4]": 2252,
|
| 2442 |
+
"[174Hf]": 2253,
|
| 2443 |
+
"[76Se]": 2254,
|
| 2444 |
+
"[168Tm]": 2255,
|
| 2445 |
+
"[167Dy]": 2256,
|
| 2446 |
+
"[154Gd]": 2257,
|
| 2447 |
+
"[95Ru]": 2258,
|
| 2448 |
+
"[210At]": 2259,
|
| 2449 |
+
"[85Br]": 2260,
|
| 2450 |
+
"[59Co]": 2261,
|
| 2451 |
+
"[122Xe]": 2262,
|
| 2452 |
+
"[27Al]": 2263,
|
| 2453 |
+
"[54Cr]": 2264,
|
| 2454 |
+
"[198Hg]": 2265,
|
| 2455 |
+
"[85Rb+]": 2266,
|
| 2456 |
+
"[214Tl]": 2267,
|
| 2457 |
+
"[229Rn]": 2268,
|
| 2458 |
+
"[218Pb]": 2269,
|
| 2459 |
+
"[218Bi]": 2270,
|
| 2460 |
+
"[167Tm+3]": 2271,
|
| 2461 |
+
"[18o+]": 2272,
|
| 2462 |
+
"[P@@H+]": 2273,
|
| 2463 |
+
"[P@H+]": 2274,
|
| 2464 |
+
"[13N+]": 2275,
|
| 2465 |
+
"[212Pb+2]": 2276,
|
| 2466 |
+
"[217Bi]": 2277,
|
| 2467 |
+
"[249Cf+2]": 2278,
|
| 2468 |
+
"[18OH3+]": 2279,
|
| 2469 |
+
"[90Sr-]": 2280,
|
| 2470 |
+
"[Cf+3]": 2281,
|
| 2471 |
+
"[200Hg]": 2282,
|
| 2472 |
+
"[86Tc]": 2283,
|
| 2473 |
+
"[141Pr+3]": 2284,
|
| 2474 |
+
"[141Pr]": 2285,
|
| 2475 |
+
"[16nH]": 2286,
|
| 2476 |
+
"[14NH4+]": 2287,
|
| 2477 |
+
"[132Xe]": 2288,
|
| 2478 |
+
"[83Kr]": 2289,
|
| 2479 |
+
"[70Zn+2]": 2290,
|
| 2480 |
+
"[137Ba+2]": 2291,
|
| 2481 |
+
"[36Ar]": 2292,
|
| 2482 |
+
"[38Ar]": 2293,
|
| 2483 |
+
"[21Ne]": 2294,
|
| 2484 |
+
"[126Xe]": 2295,
|
| 2485 |
+
"[136Xe]": 2296,
|
| 2486 |
+
"[128Xe]": 2297,
|
| 2487 |
+
"[134Xe]": 2298,
|
| 2488 |
+
"[84Kr]": 2299,
|
| 2489 |
+
"[86Kr]": 2300,
|
| 2490 |
+
"[78Kr]": 2301,
|
| 2491 |
+
"[80Kr]": 2302,
|
| 2492 |
+
"[82Kr]": 2303,
|
| 2493 |
+
"[67Zn+2]": 2304,
|
| 2494 |
+
"[65Cu+2]": 2305,
|
| 2495 |
+
"[110Te]": 2306,
|
| 2496 |
+
"[58Fe+3]": 2307,
|
| 2497 |
+
"[142Nd]": 2308,
|
| 2498 |
+
"[38K]": 2309,
|
| 2499 |
+
"[198Au+3]": 2310,
|
| 2500 |
+
"[122IH]": 2311,
|
| 2501 |
+
"[38PH3]": 2312,
|
| 2502 |
+
"[130I-]": 2313,
|
| 2503 |
+
"[40K+]": 2314,
|
| 2504 |
+
"[38K+]": 2315,
|
| 2505 |
+
"[28Mg+2]": 2316,
|
| 2506 |
+
"[208Tl+]": 2317,
|
| 2507 |
+
"[13OH2]": 2318,
|
| 2508 |
+
"[198Bi]": 2319,
|
| 2509 |
+
"[192Bi]": 2320,
|
| 2510 |
+
"[194Bi]": 2321,
|
| 2511 |
+
"[196Bi]": 2322,
|
| 2512 |
+
"[132I-]": 2323,
|
| 2513 |
+
"[83Sr+2]": 2324,
|
| 2514 |
+
"[169Er+3]": 2325,
|
| 2515 |
+
"[122I-]": 2326,
|
| 2516 |
+
"[120I-]": 2327,
|
| 2517 |
+
"[92Sr+2]": 2328,
|
| 2518 |
+
"[126I-]": 2329,
|
| 2519 |
+
"[24Mg]": 2330,
|
| 2520 |
+
"[84Sr]": 2331,
|
| 2521 |
+
"[118Pd+2]": 2332,
|
| 2522 |
+
"[118Pd]": 2333,
|
| 2523 |
+
"[AsH4]": 2334,
|
| 2524 |
+
"[127I-]": 2335,
|
| 2525 |
+
"[9C-]": 2336,
|
| 2526 |
+
"[11CH3+]": 2337,
|
| 2527 |
+
"[17B]": 2338,
|
| 2528 |
+
"[7B]": 2339,
|
| 2529 |
+
"[4HH]": 2340,
|
| 2530 |
+
"[18C-]": 2341,
|
| 2531 |
+
"[22CH3-]": 2342,
|
| 2532 |
+
"[22CH4]": 2343,
|
| 2533 |
+
"[17C-]": 2344,
|
| 2534 |
+
"[15CH3]": 2345,
|
| 2535 |
+
"[16CH3]": 2346,
|
| 2536 |
+
"[11NH3]": 2347,
|
| 2537 |
+
"[21NH3]": 2348,
|
| 2538 |
+
"[11N-]": 2349,
|
| 2539 |
+
"[11NH]": 2350,
|
| 2540 |
+
"[16CH]": 2351,
|
| 2541 |
+
"[17CH2]": 2352,
|
| 2542 |
+
"[99Ru+2]": 2353,
|
| 2543 |
+
"[181Ta+2]": 2354,
|
| 2544 |
+
"[181Ta]": 2355,
|
| 2545 |
+
"[20CH]": 2356,
|
| 2546 |
+
"[32PH2]": 2357,
|
| 2547 |
+
"[55Fe+2]": 2358,
|
| 2548 |
+
"[SH3]": 2359,
|
| 2549 |
+
"[S@H]": 2360,
|
| 2550 |
+
"[UNK]": 2361
|
| 2551 |
+
},
|
| 2552 |
+
"merges": []
|
| 2553 |
+
}
|
| 2554 |
+
}
|
tokenizer_config.json
ADDED
|
@@ -0,0 +1,57 @@
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
|
| 1 |
+
{
|
| 2 |
+
"added_tokens_decoder": {
|
| 3 |
+
"0": {
|
| 4 |
+
"content": "[CLS]",
|
| 5 |
+
"lstrip": false,
|
| 6 |
+
"normalized": false,
|
| 7 |
+
"rstrip": false,
|
| 8 |
+
"single_word": false,
|
| 9 |
+
"special": true
|
| 10 |
+
},
|
| 11 |
+
"1": {
|
| 12 |
+
"content": "[SEP]",
|
| 13 |
+
"lstrip": false,
|
| 14 |
+
"normalized": false,
|
| 15 |
+
"rstrip": false,
|
| 16 |
+
"single_word": false,
|
| 17 |
+
"special": true
|
| 18 |
+
},
|
| 19 |
+
"2": {
|
| 20 |
+
"content": "[PAD]",
|
| 21 |
+
"lstrip": false,
|
| 22 |
+
"normalized": false,
|
| 23 |
+
"rstrip": false,
|
| 24 |
+
"single_word": false,
|
| 25 |
+
"special": true
|
| 26 |
+
},
|
| 27 |
+
"3": {
|
| 28 |
+
"content": "[MASK]",
|
| 29 |
+
"lstrip": true,
|
| 30 |
+
"normalized": false,
|
| 31 |
+
"rstrip": false,
|
| 32 |
+
"single_word": false,
|
| 33 |
+
"special": true
|
| 34 |
+
},
|
| 35 |
+
"2361": {
|
| 36 |
+
"content": "[UNK]",
|
| 37 |
+
"lstrip": false,
|
| 38 |
+
"normalized": false,
|
| 39 |
+
"rstrip": false,
|
| 40 |
+
"single_word": false,
|
| 41 |
+
"special": true
|
| 42 |
+
}
|
| 43 |
+
},
|
| 44 |
+
"clean_up_tokenization_spaces": true,
|
| 45 |
+
"cls_token": "[CLS]",
|
| 46 |
+
"extra_special_tokens": {},
|
| 47 |
+
"mask_token": "[MASK]",
|
| 48 |
+
"model_input_names": [
|
| 49 |
+
"input_ids",
|
| 50 |
+
"attention_mask"
|
| 51 |
+
],
|
| 52 |
+
"model_max_length": 512,
|
| 53 |
+
"pad_token": "[PAD]",
|
| 54 |
+
"sep_token": "[SEP]",
|
| 55 |
+
"tokenizer_class": "PreTrainedTokenizerFast",
|
| 56 |
+
"unk_token": "[UNK]"
|
| 57 |
+
}
|