Mol-LLaMA SFT
Collection
RCR_RP: Reagents Prediction; RCR_CP: Catalyst Prediction; RCR_SP: Solvent Prediction; HTE_RAS: Reagent Selection • 17 items • Updated
instruction stringlengths 95 493 | input stringclasses 1
value | output stringlengths 3 67 |
|---|---|---|
C1=COCCC1.OCCCCCCCCCCCCBr>>BrCCCCCCCCCCCCOC1CCCCO1 Please propose potential solvents that might have been utilized in the provided chemical reaction. | Sure. A potential answer could be: CCCCCC . | |
Can you suggest some solvents that might have been used in the given chemical reaction? CCOC(=O)Oc1ccc(F)c(F)c1F.O=[N+]([O-])O>>CCOC(=O)Oc1cc([N+](=O)[O-])c(F)c(F)c1F | A probable solvent could be O=S(=O)(O)O . | |
Based on the given chemical reaction BrC(Br)(Br)Br.CCN(CC)C(=O)c1ccc(C(CCO)c2cccc(OC)c2)cc1>>CCN(CC)C(=O)c1ccc(C(CCBr)c2cccc(OC)c2)cc1, suggest some possible solvents. | The solvent can be CC#N . | |
Based on the given chemical reaction Cc1ccc(S(=O)(=O)Cl)cc1.OC1Cc2ccccc2C(C2CCCCC2)C1>>Cc1ccc(S(=O)(=O)OC2Cc3ccccc3C(C3CCCCC3)C2)cc1, suggest some possible solvents. | The solvent can be c1ccncc1 . | |
Based on the given chemical reaction CNC(=O)c1ccc(C=CC(=O)OC)cc1>>CNC(=O)c1ccc(C=CC(=O)O)cc1, suggest some possible solvents. | The solvent can be CO . | |
COC(=O)C(O)c1cccc(Cl)c1>>OCC(O)c1cccc(Cl)c1 From the provided chemical reaction, propose some possible solvents that could have been used. | CO . | |
Given the following chemical reaction Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)Cl.Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1Cl>>Cc1cc(C(C)(C)C)cc(C)c1S(=O)(=O)Nc1cc(C(F)(F)F)cc(C(F)(F)F)c1Cl, what are some potential solvents that could have been employed? | c1ccncc1 . | |
Given the following chemical reaction Cc1cc(O)cc2c(C3CCN(C)CC3)cn(C)c12.O=S(=O)(Cl)c1c(F)cccc1F>>Cc1cc(OS(=O)(=O)c2c(F)cccc2F)cc2c(C3CCN(C)CC3)cn(C)c12, what are some potential solvents that could have been employed? | C1CCOC1.O . | |
Please provide possible solvents based on the following chemical reaction COS(=O)(=O)OC.Cc1ccc(Cl)c(O)c1>>COc1cc(C)ccc1Cl. | C1CCOC1.O . | |
O=C(O)c1cccc(O)c1.O=[N+]([O-])c1cc(C(F)(F)F)ccc1Cl>>O=C(O)c1cccc(Oc2ccc(C(F)(F)F)cc2[N+](=O)[O-])c1 Based on the given chemical reaction, can you propose some likely solvents that might have been utilized? | A possible solvent can be CN(C)C=O . | |
Please provide possible solvents based on the following chemical reaction O=C1CCC(=O)N1Cl.Oc1ccc2cc(Br)ccc2c1>>Oc1ccc2cc(Br)ccc2c1Cl. | C1CCOC1 . | |
CNC(=O)Nc1nc2c(s1)CN(C(=O)OC(C)(C)C)CC2>>CNC(=O)Nc1nc2c(s1)CNCC2 Please propose potential solvents that might have been utilized in the provided chemical reaction. | Sure. A potential answer could be: ClC(Cl)Cl . | |
Given the following chemical reaction CC(C)(Oc1ccc([N+](=O)[O-])cc1)C(F)(F)F>>CC(C)(Oc1ccc(N)cc1)C(F)(F)F, what are some potential solvents that could have been employed? | CO . | |
Based on the given chemical reaction OCc1cc2ccccc2[nH]1>>O=Cc1cc2ccccc2[nH]1, suggest some possible solvents. | The solvent can be ClCCl . | |
Please provide possible solvents based on the following chemical reaction CN1CC(C(=O)OC(C)(C)C)NC1=O>>CN1CC(C(=O)O)NC1=O. | ClCCl.O=C(O)C(F)(F)F . | |
Given the following reaction Cn1ccc(Nc2ncnc3ccc(O)cc23)n1.Fc1ncc(OCCC2OCCO2)cc1Cl>>Cn1ccc(Nc2ncnc3ccc(Oc4ncc(OCCC5OCCO5)cc4Cl)cc23)n1, what are some possible solvents that could have been utilized? | CC(=O)N(C)C . | |
Can you provide potential solvents for the following chemical reaction? COc1ccc([N+](=O)[O-])cc1-c1c(F)cnn1C>>COc1ccc(N)cc1-c1c(F)cnn1C | CCO . | |
Can you suggest some solvents that might have been used in the given chemical reaction? COc1ccccc1N1CCN(CCC(C(=O)C2CCCCC2)c2ccccc2)CC1>>COc1ccccc1N1CCN(CCC(c2ccccc2)C(O)C2CCCCC2)CC1 | A probable solvent could be Cc1ccccc1.ClCCl . | |
Based on the given chemical reaction CC(=O)c1ccc(O)c(C)c1O.N#Cc1cncc(Sc2cccc(CO)c2)c1>>CC(=O)c1ccc(OCc2cccc(Sc3cncc(C#N)c3)c2)c(C)c1O, suggest some possible solvents. | The solvent can be C1CCOC1 . | |
Given the following reaction CC(C)(C)OC(=O)OC(=O)OC(C)(C)C.CC(c1ccccc1)N1CC2CC=CCC2(N)C1>>CC(c1ccccc1)N1CC2CC=CCC2(NC(=O)OC(C)(C)C)C1, what are some possible solvents that could have been utilized? | ClCCl . | |
Based on the given chemical reaction CC(C)(C)OC(=O)CCSCc1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)Nc2ncc(-c3cccc(C(F)(F)F)c3)cn2)c1>>O=C(O)CCSCc1cccc(C(=O)Nc2ccc(N3CCCCC3)cc2C(=O)Nc2ncc(-c3cccc(C(F)(F)F)c3)cn2)c1, suggest some possible solvents. | The solvent can be ClCCl . | |
Please provide possible solvents based on the following chemical reaction Nc1nc(Cl)c(C=O)s1.O=C(Cl)c1ccccc1>>O=Cc1sc(NC(=O)c2ccccc2)nc1Cl. | C1CCOC1 . | |
What solvents could have been utilized in the following chemical reaction? C1COCCN1.Clc1nccnc1Cl>>Clc1nccnc1N1CCOCC1 | CS(C)=O . | |
Based on the given chemical reaction CCCCCCCCCCCCCCBr.Cc1cccc(O)c1C>>CCCCCCCCCCCCCCOc1cccc(C)c1C, suggest some possible solvents. | The solvent can be CC#N . | |
Given the following reaction CC(C)c1nc(-c2cccc(NS(=O)(=O)c3c(F)cccc3F)c2)c(-c2ccnc(Cl)n2)s1.CS(=O)(=O)CCN>>CC(C)c1nc(-c2cccc(NS(=O)(=O)c3c(F)cccc3F)c2)c(-c2ccnc(NCCS(C)(=O)=O)n2)s1, what are some possible solvents that could have been utilized? | Cl . | |
What solvents could have been utilized in the following chemical reaction? CCOC(=O)C1CCC(NC(=O)C2(CC(C(=O)O)C3C=CCCC3)CCCC2)CC1>>CCOC(=O)C1CCC(NC(=O)C2(CC(C(=O)O)C3CCCCC3)CCCC2)CC1 | CCO . | |
Based on the given chemical reaction CI.Cc1ccc(C(=O)O)cc1C1OC(COCc2ccccc2)C(OCc2ccccc2)C(OCc2ccccc2)C1OCc1ccccc1>>COC(=O)c1ccc(C)c(C2OC(COCc3ccccc3)C(OCc3ccccc3)C(OCc3ccccc3)C2OCc2ccccc2)c1, suggest some possible solvents. | The solvent can be CN(C)C=O . | |
Based on the given chemical reaction Cc1c(N)ccc2c1cnn2C1CCCCO1.O=C1CC2CCC(C1)N2Cc1ccccc1>>Cc1c(NC2CC3CCC(C2)N3Cc2ccccc2)ccc2c1cnn2C1CCCCO1, suggest some possible solvents. | The solvent can be ClCCCl . | |
CC(C)(C)OC(=O)NCCN(CCNC(=O)OC(C)(C)C)C(=O)CC(NC(=O)OC(C)(C)C)C(=O)O.CN(CCNC(=O)c1ccc(C(F)(F)F)cc1)C(=O)C(N)CCc1ccccc1>>CN(CCNC(=O)c1ccc(C(F)(F)F)cc1)C(=O)C(CCc1ccccc1)NC(=O)C(CC(=O)N(CCNC(=O)OC(C)(C)C)CCNC(=O)OC(C)(C)C)NC(=O)OC(C)(C)C Based on the given chemical reaction, can you propose some likely solvents that might... | A possible solvent can be ClCCl . | |
Can you suggest some solvents that might have been used in the given chemical reaction? O=C(NCCN1CCOCC1)c1cc2ncnc(Oc3ccc([N+](=O)[O-])cc3F)c2s1>>Nc1ccc(Oc2ncnc3cc(C(=O)NCCN4CCOCC4)sc23)c(F)c1 | A probable solvent could be CO . | |
Given the following reaction Cc1cccnc1C.O=C(OO)c1cccc(Cl)c1>>Cc1ccc[n+]([O-])c1C, what are some possible solvents that could have been utilized? | ClC(Cl)Cl . | |
Given this chemical reaction COc1cc2ncnc(Oc3cnc4[nH]ccc4c3)c2cc1O.CS(=O)(=O)N1CCN(CCCO)CC1>>COc1cc2ncnc(Oc3cnc4[nH]ccc4c3)c2cc1OCCCN1CCN(S(C)(=O)=O)CC1, what are some solvents that could have been used? | CN(C)C=O . | |
What solvents could have been utilized in the following chemical reaction? CC1(C)OB(c2ccc3cc(NC(=O)c4ccsc4)ccc3c2)OC1(C)C.Cc1n[nH]c2ccc(Br)cc12>>Cc1n[nH]c2ccc(-c3ccc4cc(NC(=O)c5ccsc5)ccc4c3)cc12 | O . | |
Given the following reaction C1CO1.CC(C)(C)CN>>CC(C)(C)CNCCO, what are some possible solvents that could have been utilized? | CO . | |
Can you suggest some solvents that might have been used in the given chemical reaction? OCCc1coc(-c2cccs2)n1.Oc1ccc(CCCn2ccnc2)cc1>>c1csc(-c2nc(CCOc3ccc(CCCn4ccnc4)cc3)co2)c1 | A probable solvent could be C1CCOC1 . | |
Given this chemical reaction CCI.Nc1c(CC(=O)O)cccc1C(=O)c1ccc(Br)cc1>>CCOC(=O)Cc1cccc(C(=O)c2ccc(Br)cc2)c1N, what are some solvents that could have been used? | CN(C)C=O . | |
Given the following chemical reaction Cc1ccc(S(=O)(=O)Cl)cc1.OCCOCC(F)F>>Cc1ccc(S(=O)(=O)OCCOCC(F)F)cc1, what are some potential solvents that could have been employed? | C1CCOC1.O . | |
Please provide possible solvents based on the following chemical reaction COC(=O)c1cc2cc(OC)c(OCCCl)cc2[nH]1>>COc1cc2cc(C(=O)O)[nH]c2cc1OCCCl. | O . | |
Based on the given chemical reaction [N-]=[N+]=NCCOc1ccc(C(=C(c2ccc(F)cc2)C(F)(F)F)c2ccccc2)cc1>>NCCOc1ccc(C(=C(c2ccc(F)cc2)C(F)(F)F)c2ccccc2)cc1, suggest some possible solvents. | The solvent can be CO . | |
What solvents could have been utilized in the following chemical reaction? FC(F)(F)c1ccc(Cl)nc1.OCc1cccc(O)c1>>OCc1cccc(Oc2ccc(C(F)(F)F)cn2)c1 | CN(C)C=O . | |
Based on the given chemical reaction CN(C(=O)CC(CCOS(C)(=O)=O)c1ccccc1)c1ccc(Cl)cc1.OC1(c2ccccc2)CCNCC1>>CN(C(=O)CC(CCN1CCC(O)(c2ccccc2)CC1)c1ccccc1)c1ccc(Cl)cc1, suggest some possible solvents. | The solvent can be CN(C)C=O . | |
O=[N+]([O-])c1ccc(CCBr)cc1.c1ccc2c(c1)CCC1CNCCC21>>O=[N+]([O-])c1ccc(CCN2CCC3c4ccccc4CCC3C2)cc1 From the provided chemical reaction, propose some possible solvents that could have been used. | CN(C)C=O . | |
Given the following reaction CCOC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1N.O=S(=O)(Cl)c1ccccc1>>CCOC(=O)c1[nH]c2cc(Cl)cc(Cl)c2c1NS(=O)(=O)c1ccccc1, what are some possible solvents that could have been utilized? | c1ccncc1 . | |
Can you suggest some solvents that might have been used in the given chemical reaction? Nc1cccc(F)c1.O=C(Cl)CCCl>>O=C(CCCl)Nc1cccc(F)c1 | A probable solvent could be ClCCl.O . | |
Can you suggest some solvents that might have been used in the given chemical reaction? Cn1c(Cl)nc(-c2ccncc2)cc1=O.O=C(Nc1ccccc1)C1CCCNC1>>Cn1c(N2CCCC(C(=O)Nc3ccccc3)C2)nc(-c2ccncc2)cc1=O | A probable solvent could be C1CCOC1 . | |
Based on the given chemical reaction CCOC(=O)c1cc2c([N+](=O)[O-])c(-c3ccc(OC(C)C)cc3)ccc2n1-c1ccc(OC(C)C)cc1>>CCOC(=O)c1cc2c(N)c(-c3ccc(OC(C)C)cc3)ccc2n1-c1ccc(OC(C)C)cc1, suggest some possible solvents. | The solvent can be CCOC(C)=O . | |
CC(C)n1cc(C(=O)O)c(=O)c2cc(F)c(F)c(F)c21.CC1CNCCN1>>CC1CN(c2c(F)cc3c(=O)c(C(=O)O)cn(C(C)C)c3c2F)CCN1 From the provided chemical reaction, propose some possible solvents that could have been used. | c1ccncc1 . | |
Can you provide potential solvents for the following chemical reaction? CNS(=O)(=O)c1ccc(N(C)C)c(N)c1.COc1cc2ncnc(Cl)c2cc1OC>>CNS(=O)(=O)c1ccc(N(C)C)c(Nc2ncnc3cc(OC)c(OC)cc23)c1 | CC(C)O . | |
Cc1ccc(Br)c(Cl)c1.N#C[Cu]>>Cc1ccc(C#N)c(Cl)c1 Please propose potential solvents that might have been utilized in the provided chemical reaction. | Sure. A potential answer could be: CN(C)C=O . | |
Please suggest some possible solvents that could have been used in the following chemical reaction CC(=O)CC(=O)CCc1ccc(OCc2ccccc2)cc1>>CC(=O)CC(=O)CCc1ccc(O)cc1. | ClCCl . | |
Can you provide potential solvents for the following chemical reaction? CCOC(=O)C(Cc1ccc(C(F)(F)F)cc1)C(O)c1ccc(Cl)nc1>>O=C(O)C(Cc1ccc(C(F)(F)F)cc1)C(O)c1ccc(Cl)nc1 | CO . | |
Given the following reaction C1CCNC1.Nc1ccc(S(=O)(=O)c2cc(Br)nc(Br)c2)cc1>>Nc1ccc(S(=O)(=O)c2cc(Br)nc(N3CCCC3)c2)cc1, what are some possible solvents that could have been utilized? | C1COCCO1 . | |
Nc1ccc(-n2ncn(-c3ccc(OCC(F)(F)C(F)F)cc3)c2=O)cc1.O=C(Cl)Oc1ccccc1>>O=C(Nc1ccc(-n2ncn(-c3ccc(OCC(F)(F)C(F)F)cc3)c2=O)cc1)Oc1ccccc1 Please propose potential solvents that might have been utilized in the provided chemical reaction. | Sure. A potential answer could be: C1CCOC1.CCOC(C)=O . | |
COC(=O)C(N)Cc1ccc(O)c(C(C)(C)C)c1.N>>CC(C)(C)c1cc(CC(N)C(N)=O)ccc1O Please propose potential solvents that might have been utilized in the provided chemical reaction. | Sure. A potential answer could be: CO . | |
Please provide possible solvents based on the following chemical reaction Nc1c([N+](=O)[O-])cc(F)c(Cl)c1F>>Nc1cc(F)c(Cl)c(F)c1N. | CCO . | |
Please suggest some possible solvents that could have been used in the following chemical reaction Clc1cccc(-c2ccc3[nH]ccc3c2)c1.O=S(=O)(Cl)c1ccccc1>>O=S(=O)(c1ccccc1)n1ccc2cc(-c3cccc(Cl)c3)ccc21. | C1CCOC1 . | |
Can you suggest some solvents that might have been used in the given chemical reaction? CNC.Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cccc(-c3cccc(S(=O)(=O)Cl)c3)n2)n1>>Cc1cc(-c2ccc(C(F)(F)F)cc2)cc(-c2cccc(-c3cccc(S(=O)(=O)N(C)C)c3)n2)n1 | A probable solvent could be C1CCOC1.CCOC(C)=O . | |
Given the following reaction CCOC(=O)C(F)(F)c1ccc(-c2ccc(Br)cc2)cc1>>OCC(F)(F)c1ccc(-c2ccc(Br)cc2)cc1, what are some possible solvents that could have been utilized? | CO . | |
Can you suggest some solvents that might have been used in the given chemical reaction? CCC1CN(C(C)(C)C)CC2(CCN(C(=O)OC(C)(C)C)CC2)O1>>CCC1CN(C(C)(C)C)CC2(CCNCC2)O1 | A probable solvent could be ClCCl . | |
NO.O=Cc1ccccc1[N+](=O)[O-]>>O=[N+]([O-])c1ccccc1C=NO Please propose potential solvents that might have been utilized in the provided chemical reaction. | Sure. A potential answer could be: CO.O . | |
Given the following chemical reaction COc1cc2c(Cl)ncnc2cc1OCCCN1CCCC1.Cn1ccc2cc(O)ccc21>>COc1cc2c(Oc3ccc4c(ccn4C)c3)ncnc2cc1OCCCN1CCCC1, what are some potential solvents that could have been employed? | CC(=O)N(C)C . | |
Given this chemical reaction CC(C)(C)[Si](C)(C)OCCn1ccc(N)n1.CS(=O)(=O)c1ccc(C(CC2CCOC2)C(=O)O)cc1Cl>>CC(C)(C)[Si](C)(C)OCCn1ccc(NC(=O)C(CC2CCOC2)c2ccc(S(C)(=O)=O)c(Cl)c2)n1, what are some solvents that could have been used? | ClCCl . | |
Please provide possible solvents based on the following chemical reaction CC(c1cc2c(Cl)cccc2nc1-c1ccccn1)N1C(=O)c2ccccc2C1=O>>CC(N)c1cc2c(Cl)cccc2nc1-c1ccccn1. | CCO . | |
What solvents could have been utilized in the following chemical reaction? O=C(Cl)OCc1ccccc1.OC1CNC1>>O=C(OCc1ccccc1)N1CC(O)C1 | C1CCOC1.O . | |
Please provide possible solvents based on the following chemical reaction CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)O.OCc1ccccc1>>CC(C)(C)OC(=O)NC(Cc1ccccc1)C(=O)OCc1ccccc1. | ClCCl . | |
Given the following chemical reaction CS(=O)(=O)Cl.O=C(NC1CCCc2c1cnn2CCO)OCc1ccccc1>>CS(=O)(=O)OCCn1ncc2c1CCCC2NC(=O)OCc1ccccc1, what are some potential solvents that could have been employed? | ClCCl . | |
CC(=O)ON=C(C(=O)O)c1csc(NC(c2ccccc2)(c2ccccc2)c2ccccc2)n1.CC(=O)OCC=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(N)C2SC1>>CC(=O)OCC=CC1=C(C(=O)OC(c2ccccc2)c2ccccc2)N2C(=O)C(NC(=O)C(=NOC(C)=O)c3csc(NC(c4ccccc4)(c4ccccc4)c4ccccc4)n3)C2SC1 Based on the given chemical reaction, can you propose some likely solvents that might h... | A possible solvent can be C1CCOC1.CCOC(C)=O . | |
NCc1ccccn1.O=C=NCCCc1ccccc1>>O=C(NCCCc1ccccc1)NCc1ccccn1 Based on the given chemical reaction, can you propose some likely solvents that might have been utilized? | A possible solvent can be C1CCOC1.c1ccccc1 . | |
COC(=O)C1=CC=CCC1>>O=C(O)C1=CC=CCC1 From the provided chemical reaction, propose some possible solvents that could have been used. | CO . | |
Given the following chemical reaction CC(C)(C)OC(=O)CON=C(C(=O)NC1C(=O)N2C(C(=O)OCc3ccc([N+](=O)[O-])cc3)=CCSC12)c1csc(NC=O)n1>>O=CNc1nc(C(=NOCC(=O)O)C(=O)NC2C(=O)N3C(C(=O)OCc4ccc([N+](=O)[O-])cc4)=CCSC23)cs1, what are some potential solvents that could have been employed? | COc1ccccc1 . | |
Please provide possible solvents based on the following chemical reaction CCCOC1CCNCC1.CC(CI)CN1C(=O)CCc2ccccc21>>CCCOC1CCN(CC(C)CN2C(=O)CCc3ccccc32)CC1. | CC#N . | |
Can you provide potential solvents for the following chemical reaction? CCOC(=O)c1nn(-c2ccc(OOSN)cc2)c2c1CCc1ccc([N+](=O)[O-])cc1-2>>CCOC(=O)c1nn(-c2ccc(OOSN)cc2)c2c1CCc1ccc(N)cc1-2 | CN(C)C=O . | |
What solvents could have been utilized in the following chemical reaction? CCOc1cc(Nc2nc(Cl)ccc2[N+](=O)[O-])n[nH]1.CC(N)c1ncc(F)cn1>>CCOc1cc(Nc2nc(NC(C)c3ncc(F)cn3)ccc2[N+](=O)[O-])n[nH]1 | CCCCO.CCOC(C)=O . | |
What solvents could have been utilized in the following chemical reaction? CN(CCN)CCNC(=O)OC(C)(C)C.O=C(O)c1ccccc1O>>CN(CCNC(=O)OC(C)(C)C)CCNC(=O)c1ccccc1O | CC#N.CCOC(C)=O . | |
Based on the given chemical reaction CC(C)(C)OC(=O)N1CCC(CO)CC1.CS(=O)(=O)Cl>>CC(C)(C)OC(=O)N1CCC(COS(C)(=O)=O)CC1, suggest some possible solvents. | The solvent can be ClCCl . | |
[N-]=[N+]=NCC1CN(c2ccc(Cl)cn2)C(=O)O1>>NCC1CN(c2ccc(Cl)cn2)C(=O)O1 From the provided chemical reaction, propose some possible solvents that could have been used. | C1CCOC1.O . | |
Please provide possible solvents based on the following chemical reaction CC(C)CC(Sc1ccc(Br)cc1)c1ccc(C(=O)O)cc1.COC(=O)CCN>>COC(=O)CCNC(=O)c1ccc(C(CC(C)C)Sc2ccc(Br)cc2)cc1. | ClCCl . | |
Please suggest some possible solvents that could have been used in the following chemical reaction COC(=O)c1ccc(C2(COc3cc(C)c(-c4ccc(C(F)(F)F)cc4)c(C)c3)CC=CC2)s1>>Cc1cc(OCC2(c3ccc(C(=O)O)s3)CC=CC2)cc(C)c1-c1ccc(C(F)(F)F)cc1. | C1CCOC1 . | |
Can you provide potential solvents for the following chemical reaction? CC(C)(C)OC(=O)N1CCN(c2ccc(-c3oc(-c4cccc5[nH]ccc45)nc3C(N)=O)cc2)CC1>>NC(=O)c1nc(-c2cccc3[nH]ccc23)oc1-c1ccc(N2CCNCC2)cc1 | CO.ClCCl . | |
Given the following reaction BrCCc1ccccc1.Cc1ccc(-c2cc(C(=O)CC3CCNCC3)c3ccccc3n2)cc1>>Cc1ccc(-c2cc(C(=O)CC3CCN(CCc4ccccc4)CC3)c3ccccc3n2)cc1, what are some possible solvents that could have been utilized? | CN(C)C=O . | |
Given the following chemical reaction CCOC(=O)C1Cc2c(n(C)c3ccc(OCc4ccccc4)cc23)C1>>Cn1c2c(c3cc(OCc4ccccc4)ccc31)CC(CO)C2, what are some potential solvents that could have been employed? | C1CCOC1 . | |
Given the following reaction CCC(C(=O)O)c1ccc(OC)cc1.O=C(Cl)C(=O)Cl>>CCC(C(=O)Cl)c1ccc(OC)cc1, what are some possible solvents that could have been utilized? | ClCCl . | |
What solvents could have been utilized in the following chemical reaction? CC(=O)OC(C)=O.O=Cc1ccc(Oc2cnc(Nc3nc(C4CCNCC4)ns3)c(Sc3ccccc3Cl)c2)cc1>>CC(=O)N1CCC(c2nsc(Nc3ncc(Oc4ccc(C=O)cc4)cc3Sc3ccccc3Cl)n2)CC1 | ClCCl . | |
COC(=O)Cn1c(C)c(Cc2ncn(C)c2S(=O)(=O)c2ccccc2)c2cc(F)ccc21>>Cc1c(Cc2ncn(C)c2S(=O)(=O)c2ccccc2)c2cc(F)ccc2n1CC(=O)O Please propose potential solvents that might have been utilized in the provided chemical reaction. | Sure. A potential answer could be: C1CCOC1 . | |
Can you suggest some solvents that might have been used in the given chemical reaction? C=Cc1cc(CNC(=O)OC(C)(C)C)cc(C(F)(F)F)c1NS(C)(=O)=O>>C=Cc1cc(CN)cc(C(F)(F)F)c1NS(C)(=O)=O | A probable solvent could be ClCCl . | |
O=C([O-])CCS(=O)(=O)NC1C=Nc2ccccc2N1OC(c1cccnc1)C(F)(F)F>>O=C(O)CCS(=O)(=O)NC1C=Nc2ccccc2N1OC(c1cccnc1)C(F)(F)F Please propose potential solvents that might have been utilized in the provided chemical reaction. | Sure. A potential answer could be: CO . | |
COC(=O)Cc1ccc(C#Cc2ccc(C3(OC)CC3)cc2)cc1>>COC1(c2ccc(C#Cc3ccc(CC(=O)O)cc3)cc2)CC1 Based on the given chemical reaction, can you propose some likely solvents that might have been utilized? | A possible solvent can be CCO . | |
Based on the given chemical reaction CC(O)(c1ccc(F)cc1)C1CCNCC1.ClCCc1ccc(Cl)s1>>CC(O)(c1ccc(F)cc1)C1CCN(CCc2ccc(Cl)s2)CC1, suggest some possible solvents. | The solvent can be CC#N . | |
Given this chemical reaction FC(F)(F)C1CO1.O=S(=O)(c1ccccc1)n1cc(-c2cnn(CC3CCNCC3)c2)c2ccc(F)cc21>>O=S(=O)(c1ccccc1)n1cc(-c2cnn(CC3CCN(CC(O)C(F)(F)F)CC3)c2)c2ccc(F)cc21, what are some solvents that could have been used? | CN(C)C=O . | |
Based on the given chemical reaction CCCCN(CCCC)C(=O)c1nn(-c2ccc(C(=O)OCc3ccccc3)cc2C(=O)OCC)c(C)c1Cl>>CCCCN(CCCC)C(=O)c1nn(-c2ccc(C(=O)O)cc2C(=O)OCC)c(C)c1Cl, suggest some possible solvents. | The solvent can be CO . | |
What solvents could have been utilized in the following chemical reaction? O=S(=O)(OS(=O)(=O)C(F)(F)F)C(F)(F)F.Oc1ccc2ccoc2c1>>O=S(=O)(Oc1ccc2ccoc2c1)C(F)(F)F | ClCCl.O . | |
Given the following chemical reaction CCOC(=O)c1cc(Br)c(Cl)cc1OCOC>>COCOc1cc(Cl)c(Br)cc1CO, what are some potential solvents that could have been employed? | C1CCOC1 . | |
Given this chemical reaction COc1ccc(C=Cc2nc(N3CCOCC3)c([N+](=O)[O-])c(N3CCOCC3)n2)cc1>>COc1ccc(C=Cc2nc(N3CCOCC3)c(N)c(N3CCOCC3)n2)cc1, what are some solvents that could have been used? | CC#N.O . | |
Given the following reaction C1COCCN1.COc1cc2c(Oc3ccc(C)cc3C(=O)c3ccccc3)ccnc2cc1OCCCCCl>>COc1cc2c(Oc3ccc(C)cc3C(=O)c3ccccc3)ccnc2cc1OCCCCN1CCOCC1, what are some possible solvents that could have been utilized? | CN(C)C=O . | |
CC(C)(C)[Si](C)(C)Cl.COc1cc(O)ccc1Br>>COc1cc(O[Si](C)(C)C(C)(C)C)ccc1Br Based on the given chemical reaction, can you propose some likely solvents that might have been utilized? | A possible solvent can be ClCCl.O . | |
Nc1ccc(CCN2CCN(c3nsc4ccccc34)CC2)cc1.O=C1CCC(=O)N1Br>>Nc1ccc(CCN2CCN(c3nsc4ccccc34)CC2)cc1Br Based on the given chemical reaction, can you propose some likely solvents that might have been utilized? | A possible solvent can be ClCCl . | |
Can you provide potential solvents for the following chemical reaction? CN(Cc1nc2cccnc2[nH]1)C(=O)OCc1ccccc1>>CNCc1nc2cccnc2[nH]1 | CO . | |
Based on the given chemical reaction CC(C)(C)OC(=O)NC1(c2ccc(-c3nc4c(cc3-c3ccccc3)C(=O)COC4)cc2)CCC1>>NC1(c2ccc(-c3nc4c(cc3-c3ccccc3)C(=O)COC4)cc2)CCC1, suggest some possible solvents. | The solvent can be O=C(O)C(F)(F)F . | |
Given the following reaction C=CCc1c(O)cc(O)c(C)c1C(=O)OC>>CCCc1c(O)cc(O)c(C)c1C(=O)OC, what are some possible solvents that could have been utilized? | CCOC(C)=O . | |
Given this chemical reaction CCc1cccc(CC)c1NC(=O)c1cc(-c2nc(Nc3ccc(C(=O)OC(C)(C)C)cc3C)ncc2C)n(C)c1>>CCc1cccc(CC)c1NC(=O)c1cc(-c2nc(Nc3ccc(C(=O)O)cc3C)ncc2C)n(C)c1, what are some solvents that could have been used? | ClCCl.O=C(O)C(F)(F)F . |